WO2017063966A1 - Substituted 2-(1h-pyrazol-1-yl)-benzothiazole compounds - Google Patents
Substituted 2-(1h-pyrazol-1-yl)-benzothiazole compounds Download PDFInfo
- Publication number
- WO2017063966A1 WO2017063966A1 PCT/EP2016/074122 EP2016074122W WO2017063966A1 WO 2017063966 A1 WO2017063966 A1 WO 2017063966A1 EP 2016074122 W EP2016074122 W EP 2016074122W WO 2017063966 A1 WO2017063966 A1 WO 2017063966A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- hydrogen atom
- group
- methyl
- atom
- fluorine
- Prior art date
Links
- 0 *c1c(*)c(S)c(*)c(CN(*)N)c1* Chemical compound *c1c(*)c(S)c(*)c(CN(*)N)c1* 0.000 description 11
- UOCIJHXWTPBXDD-FUBQLUNQSA-N CC(CCC(c1c[n](-c2nc(cccc3)c3[s]2)nc1)=O)[C@H](CCc1c2)c1ccc2F Chemical compound CC(CCC(c1c[n](-c2nc(cccc3)c3[s]2)nc1)=O)[C@H](CCc1c2)c1ccc2F UOCIJHXWTPBXDD-FUBQLUNQSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
Definitions
- the present invention relates to substituted 2-(lH-pyrazol-l-yl)-benzothiazole compounds of general formula (I) as described and defined herein, to methods of preparing said compounds, to intermediate compounds useful for preparing said compounds, to pharmaceutical compositions and combinations comprising said compounds and to the use of said compounds for manufacturing a pharmaceutical composition for the treatment or prophylaxis of a disease, in particular of neoplasms, as a sole agent or in combination with other active ingredients.
- Cancer is the leading cause of death in developed countries and the second leading cause of death in developing countries. Deaths from cancer worldwide are projected to continue rising, with an estimated 12 million deaths in 2030. While substantial progress has been made in developing effective therapies, there is a strong need for additional therapeutic modalities that target cancer and related diseases.
- cancer disease arises after a selection process for cells with acquired functional capabilities to enhance survival and/or resistance towards apoptosis and a limitless proliferative potential.
- Due to lagging (neo-) vascularization unrestrained growth of cancer cells leads to tumor regions with suboptimal nutrient and oxygen supply.
- oxygen and nutrient concentrations decrease and cancer cells react by expression of hypoxia and low-nutrition responsive pathways to promote cell survival in an unfavorable metabolic microenvironment.
- cancer cells in undervascularized tumor regions are considered more resistant to radiation and cytostatic chemotherapy and to contribute to repopulation of the tumor after therapy (Minchinton IA, Tannock IF. Drug penetration in solid tumours.
- the objective of the present invention is to provide compounds which can be used for cancer therapy, in particular compounds that target cancer cells including cancer stem(-like) cells in hypoxic or nutrient-deprived tumor regions or which underwent metabolic adjustments to an unfavorable environment.
- WO2008/126899 discloses inter alia N-heteroaryl-pyrazoles and N-heteroaryl-pyrroles as xanthine oxidase inhibitors.
- WO2011/126903 disclosed inter alia lH-pyrazole-3-carboxamides and lH-pyrazole-5- carboxamides as inhibitors of thrombin.
- WO2012/080729 disclosed inter alia lH-pyrazole-4-carboxamides as casein kinase 1 delta inhibitors.
- WO2013/070659 discloses inter alia pyrazole derivatives as modulators of opioid receptors.
- WO2003/037274 A2 discloses sodium channel inhibitors for the treatment of neuropathic pain by the inhibition of sodium channels.
- said compounds of the present invention are suitable to treat cancer.
- the compounds of the present invention have surprisingly been found to effectively reduce tumor cell viability in nutrient deprived regions.
- said compounds of the present invention have been found to effectively kill cancer cells in inner tumor spheroid regions.
- Said compounds of the present invention may therefore be used for the treatment or prophylaxis of diseases of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses or diseases which are accompanied with uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses, for example, haematological tumours, solid tumours, and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas including angioimmunoblastic T-cell lymphomas, head and neck tumours including brain tumours and brain metastases (e.g.
- tumours of the thorax including non-small cell and small cell lung tumours, gastrointestinal tumours including cholangiocarcinoma, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas incl uding chondrosarcomas, and/or metastases thereof.
- the present invention covers compounds of general formula
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from :
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from:
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, ethyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from: methyl, ethyl, cyclopropyl,
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring
- R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from:
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from:
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grour.
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 6 each represents a fluorine, chlorine or bromine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from methyl, trifluoromethyl and trifluoromethoxy,
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 8 each represents a hydrogen atom
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or R 3 represents a fluorine or a chlorine atom, or a group selected from : methyl and methoxy,
- R 5 represents a chlorine atom, or a group selected from :
- R z , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 represents a fluorine or a chlorine atom
- R 5 represents a chlorine atom, or a group selected from :
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 and R 5 each represents a trifluoromethyl group
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from :
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 and R 5 each represents a fluorine atom
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group, or R 3 , R 4 and R 5 each represents a fluorine or a chlorine atom,
- R 2 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a hydrogen atom or a group selected from
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 9 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 1 represents a methyl group
- R 2 represents a fluorine or a chlorine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or
- R 1 represents a methyl group
- R 3 represents a fluorine or a chlorine atom
- R 2 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 5 represents a fluorine or a chlorine atom
- R 2 , R 3 and R 4 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 2 and R 5 each represents a hydrogen atom
- R 3 , R 4 represents a fluorine atom whereas the other one of R 3 , R 4 reprents a hydrogen atom
- R 8 and R 9 each represents a hydrogen atom
- R 1 (R 10 )N represents a
- R 1 represents a hydrogen atom or a methyl group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- substituted means that one or more hydrogens on the designated atom or group are replaced with a selection from the indicated group, provided that the designated atom's normal valency under the existing circumstances is not exceeded. Combinations of substituents and/or variables are permissible.
- the invention therefore includes one or more isotopic variant(s) of the compounds of general formula (I), particularly deuterium-containing compounds of general formula (I).
- Isotopic variant of a compound or a reagent is defined as a compound exhibiting an unnatural proportion of one or more of the isotopes that constitute such a compound.
- Isotopic variant of the compound of general formula (I) is defined as a compound of general formula (I) exhibiting an unnatural proportion of one or more of the isotopes that constitute such a compound.
- unnatural proportion means a proportion of such isotope which is higher than its natural abundance.
- the natural abundances of isotopes to be applied in this context are described in "Isotopic Compositions of the Elements 1997", Pure Appl. Chem., 70(1), 217-235, 1998.
- isotopes include stable and radioactive isotopes of hydrogen, carbon, nitrogen, oxygen, phosphorus, sulfur, fluorine, chlorine, bromine and iodine, such as 2 H (deuterium), 3 H (tritium), 11 C, 13 C, 14 C, 15 N, 17 0, 18 0, 32 P, 33 P, 33 S, 34 S, 35 S, 36 S, 18 F, 36 CI, 82 Br, 123 l, 124 l, 125 l, 129 l and 131 l, respectively.
- isotopes include stable and radioactive isotopes of hydrogen, carbon, nitrogen, oxygen, phosphorus, sulfur, fluorine, chlorine, bromine and iodine, such as 2 H (deuterium), 3 H (tritium), 11 C, 13 C, 14 C, 15 N, 17 0, 18 0, 32 P, 33 P, 33 S, 34 S, 35 S, 36 S, 18 F, 36 CI, 82 Br, 123 l, 124 l, 125
- the isotopic variant(s) of the compounds of general formula (I) preferably contain deuterium ("deuterium- containing compounds of general formula (I)").
- Isotopic variants of the compounds of general formula (I) in which one or more radioactive isotopes, such as 3 H or 14 C, are incorporated are useful e.g. in drug and/or substrate tissue distribution studies. These isotopes are particularly preferred for the ease of their incorporation and detectability.
- Positron emitting isotopes such as 18 F or 11 C may be incorporated into a compound of general formula (I). These isotopic variants of the compounds of general formula (I) are useful for in vivo imaging applications.
- Deuterium-containing and 13 C-containing compounds of general formula (I) can be used in mass spectrometry analyses in the context of preclinical or clinical studies.
- Isotopic variants of the compounds of general formula (I) can generally be prepared by methods known to a person skilled in the art, such as those described in the schemes and/or examples herein, by substituting a reagent for an isotopic variant of said reagent, preferably for a deuterium-containing reagent.
- a reagent for an isotopic variant of said reagent preferably for a deuterium-containing reagent.
- deuterium from D 2 O can be incorporated either directly into the compounds or into reagents that are useful for synthesizing such compounds.
- Deuterium gas is also a useful reagent for incorporating deuterium into molecules.
- Catalytic deuteration of olefinic bonds and acetylenic bonds is a rapid route for incorporation of deuterium.
- Metal catalysts i.e. Pd, Pt, and Rh
- Pd, Pt, and Rh metal catalysts in the presence of deuterium gas can be used to directly exchange deuterium for hydrogen in functional groups containing hydrocarbons.
- a variety of deuterated reagents and synthetic building blocks are commercially available from companies such as for example C/D/N Isotopes, Quebec, Canada; Cambridge Isotope Laboratories Inc., Andover, MA, USA; and CombiPhos Catalysts, Inc., Princeton, NJ, USA.
- deuterium-containing compound of general formula (I) is defined as a compound of general formula (I), in which one or more hydrogen atom(s) is/are replaced by one or more deuterium atom(s) and in which the abundance of deuterium at each deuterated position of the compound of general formula (I) is higher than the natural abundance of deuterium, which is about 0.015%.
- the abundance of deuterium at each deuterated position of the compound of general formula (I) is higher than 10% 20% 30% 40% 50% 60% 70% or 80% preferably higher than 90% 95% 96% or 97%, even more preferably higher than 98% or 99% at said position(s). It is understood that the abundance of deuterium at each deuterated position is independent of the abundance of deuterium at other deuterated position(s).
- the selective incorporation of one or more deuterium atom(s) into a compound of general formula (I) may alter the physicochemical properties (such as for example acidity [C. L. Perrin, et al., J. Am. Chem. Soc, 2007, 129, 4490], basicity [C. L. Perrin et al., J. Am. Chem. Soc, 2005, 127, 9641], lipophilicity [B. Testa et al., Int. J. Pharm., 1984, 19(3), 271]) and/or the metabolic profile of the molecule and may result in changes in the ratio of parent compound to metabolites or in the amounts of metabolites formed.
- physicochemical properties such as for example acidity [C. L. Perrin, et al., J. Am. Chem. Soc, 2007, 129, 4490], basicity [C. L. Perrin et al., J. Am. Chem. Soc, 2005, 127,
- Kassahun et al., WO2012/112363 are examples for this deuterium effect. Still other cases have been reported in which reduced rates of metabolism result in an increase in exposure of the drug without changing the rate of systemic clearance (e.g. Rofecoxib: F. Schneider et al., Arzneim. Forsch. / Drug. Res., 2006, 56, 295; Telaprevir: F. Maltais et al., J. Med. Chem., 2009, 52, 7993). Deuterated drugs showing this effect may have reduced dosing requirements (e.g. lower number of doses or lower dosage to achieve the desired effect) and/or may produce lower metabolite loads.
- a compound of general formula (I) may have multiple potential sites of attack for metabolism.
- deuterium-containing compounds of general formula (I) having a certain pattern of one or more deuterium-hydrogen exchange(s) can be selected.
- the deuterium atom(s) of deuterium-containing compound(s) of general formula (I) is/are attached to a carbon atom and/or is/are located at those positions of the compound of general formula (I), which are sites of attack for metabolizing enzymes such as e.g. cytochrome P 450 .
- the present invention concerns a deuterium-containing compound of general formula (I) having 1, 2, 3 or 4 deuterium atoms, particularly with 1, 2 or 3 deuterium atoms.
- stable compound' or “stable structure” is meant a compound that is sufficiently robust to survive isolation to a useful degree of purity from a reaction mixture, and formulation into an efficacious therapeutic agent.
- the compounds of this invention may contain one asymmetric centre, depending upon the location and nature of the various substituents desired.
- Asymmetric carbon atoms are present in the (R) or (S) configuration, resulting in racemic mixtures in the case of a single asymmetric centre.
- Preferred isomers are those which produce the more desirable biological activity.
- These separated, pure or partially purified isomers or racemic mixtures of the compounds of this invention are also included within the scope of the present invention.
- the purification and the separation of such materials can be accomplished by standard techniques known in the art.
- the optical isomers can be obtained by resolution of the racemic mixtures according to conventional processes, for example, by the formation of diastereoisomeric salts using an optically active acid or base or formation of covalent diastereomers.
- appropriate acids are tartaric, diacetyltartaric, ditoluoyltartaric and camphorsulfonic acid.
- Mixtures of diastereoisomers can be separated into their individual diastereomers on the basis of their physical and/or chemical differences by methods known in the art, for example, by chromatography or fractional crystallisation.
- the optically active bases or acids are then liberated from the separated diastereomeric salts.
- a different process for separation of optical isomers involves the use of chiral chromatography (e.g., chiral HPLC columns), with or without conventional derivatisation, optimally chosen to maximise the separation of the enantiomers.
- Suitable chiral HPLC columns are manufactured by Daicel, e.g., Chiracel OD and Chiracel OJ among many others, all routinely selectable.
- Enzymatic separations, with or without derivatisation are also useful.
- the optically active compounds of this invention can likewise be obtained by chiral syntheses utilizing optically active starting materials.
- Isolation of a single stereoisomer e.g. a single enantiomer of a compound of the present invention is achieved by any suitable state of the art method, such as chromatography, especially chiral chromatography, for example.
- the compounds of the present invention can exist as N-oxides, which are defined in that at least one nitrogen of the compounds of the present invention is oxidised.
- the present invention includes all such possible N-oxides.
- the present invention also relates to useful forms of the compounds as disclosed herein, such as metabolites, hydrates, solvates, prodrugs, salts, in particular pharmaceutically acceptable salts, and co-precipitates.
- the compounds of the present invention can exist as a hydrate, or as a solvate, wherein the compounds of the present invention contain polar solvents, in particular water, methanol or ethanol for example as structural element of the crystal lattice of the compounds.
- polar solvents in particular water, methanol or ethanol for example as structural element of the crystal lattice of the compounds.
- the amount of polar solvents, in particular water may exist in a stoichiometric or non-stoichiometric ratio.
- stoichiometric solvates e.g. a hydrate, hemi-, (semi-), mono-, sesqui-, di-, tri-, tetra-, penta- etc. solvates or hydrates, respectively, are possible.
- the present invention includes all such hydrates or solvates.
- the compounds of the present invention can exist in free form, e.g. as a free base, or as a free acid, or as a zwitterion, or can exist in the form of a salt.
- Said salt may be any salt, either an organic or inorganic addition salt, particularly any pharmaceutically acceptable organic or inorganic addition salt, customarily used in pharmacy.
- pharmaceutically acceptable salt refers to a relatively non-toxic, inorganic or organic acid addition salt of a compound of the present invention.
- pharmaceutically acceptable salt refers to a relatively non-toxic, inorganic or organic acid addition salt of a compound of the present invention.
- S. M. Berge, et al. “Pharmaceutical Salts,” J. Pharm. Sci. 1977, 66, 1-19.
- a suitable pharmaceutically acceptable salt of the compounds of the present invention may be, for example, an acid-addition salt of a compound of the present invention bearing a nitrogen atom, in a chain or in a ring, for example, which is sufficiently basic, such as an acid-addition salt with an inorganic acid, such as hydrochloric, hydrobromic, hydroiodic, sulfuric, bisulfuric, phosphoric, or nitric acid, for example, or with an organic acid, such as formic, acetic, acetoacetic, pyruvic, trifluoroacetic, propionic, butyric, hexanoic, heptanoic, undecanoic, lauric, benzoic, salicylic, 2-(4-hydroxybenzoyl)-benzoic, camphoric, cinnamic, cyclopentanepropionic, digluconic, 3-hydroxy-2-naphthoic, nicotinic, pamoic, pectinic
- an alkali metal salt for example a sodium or potassium salt
- an alkaline earth metal salt for example a calcium or magnesium salt
- an ammonium salt or a salt with an organic base which affords a physiologically acceptable cation, for example a salt with N-methyl-glucamine, dimethyl-glucamine, ethyl-glucamine, lysine, dicyclohexylamine, 1,6-hexadiamine, ethanolamine, glucosamine, sarcosine, serinol, tris-hydroxy-methyl- aminomethane, aminopropandiol, sovak-base, l-amino-2,3,4-butantriol.
- basic nitrogen containing groups may be quaternised with such agents as lower alkyl halides such as methyl, ethyl, propyl, and butyl chlorides, bromides and iodides ; dialkyl sulfates like dimethyl, diethyl, and dibutyl sulfate ; and diamyl sulfates, long chain halides such as decyl, lauryl, myristyl and strearyl chlorides, bromides and iodides, aralkyl halides like benzyl and phenethyl bromides and others.
- lower alkyl halides such as methyl, ethyl, propyl, and butyl chlorides, bromides and iodides
- dialkyl sulfates like dimethyl, diethyl, and dibutyl sulfate
- diamyl sulfates long chain halides such as decyl, la
- acid addition salts of the claimed compounds may be prepared by reaction of the compounds with the appropriate inorganic or organic acid via any of a number of known methods.
- alkali and al kaline earth metal salts of acidic compounds of the invention are prepared by reacting the compounds of the invention with the appropriate base via a variety of known methods.
- the present invention includes all possible salts of the compounds of the present invention as single salts, or as any mixture of said salts, in any ratio.
- in vivo hydrolysable ester is understood as meaning an in vivo hydrolysable ester of a compound of the present invention containing a carboxy or hydroxy group, for example, a pharmaceutically acceptable ester which is hydrolysed in the human or animal body to produce the parent acid or alcohol.
- suitable pharmaceutically acceptable esters for carboxy incl ude for example alkyl, cycloalkyl and optionally substituted phenylalkyl, in particular benzyl esters, Ci-C 6 alkoxymethyl esters, e.g. methoxymethyl, Ci-C 6 alkanoyloxymethyl esters, e.g.
- An in vivo hydrolysable ester of a compound of the present invention containing a hydroxy group includes inorganic esters such as phosphate esters and [alpha]-acyloxyalkyl ethers and related compounds which as a result of the in vivo hydrolysis of the ester breakdown to give the parent hydroxy group.
- inorganic esters such as phosphate esters and [alpha]-acyloxyalkyl ethers and related compounds which as a result of the in vivo hydrolysis of the ester breakdown to give the parent hydroxy group.
- [alpha]-acyloxyalkyl ethers include acetoxymethoxy and 2,2-dimethylpropionyloxymethoxy.
- a selection of in vivo hydrolysable ester forming groups for hydroxy include alkanoyl, benzoyl, phenylacetyl and substituted benzoyl and phenylacetyl, alkoxycarbonyl (to give alkyl carbonate esters), dialkylcarbamoyl and N-(dialkylaminoethyl)-N- alkylcarbamoyl (to give carbamates), dialkylaminoacetyl and carboxyacetyl.
- the present invention covers all such esters.
- the present invention includes all possible crystalline forms, or polymorphs, of the compounds of the present invention, either as single polymorph, or as a mixture of more than one polymorph, in any ratio.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from :
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluon or a chlorine atom or with a group selected from: methyl and methoxy, and R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a chlorine atom, or a group selected from:
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from : methyl, ethyl and
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring, and R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from:
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 6 each represents a fluorine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 8 each represents a hydrogen atom
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
- R 5 represents a chlorine atom, or a group selected from :
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 represents a fluorine atom
- R 5 represents a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a trifluoromethyl group
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a fluorine atom
- R 2 , R 4 and R 5 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl grou
- R 3 , R 4 and R 5 each represents a fluorine atom
- R 2 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 (R 10 )N represents a group
- R 1 represents a hydrogen atom or a group selected from: methyl, ethyl and cyclopropyl methyl-,
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 9 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 1 represents a methyl group
- R 3 represents a fluorine atom
- R 2 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 4 represents a fluorine atom
- R 2 , R 3 and R s each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a hydrogen atom or a methyl group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 1 represents a methyl group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 , R 3 , R 4 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from:
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from:
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from:
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 5 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 5 each represents a hydrogen atom
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 5 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom
- R 4 , R 5 and R 5 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy or
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring, and R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from:
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or R 2 represents a fluorine or a chlorine atom, or a group selected from: methyl and trifluoromethoxy,
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 2 and R 6 each represents a fluorine, chlorine or bromine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 5 each represents a hydrogen atom
- R 1 and R 8 each represents a hydrogen atom
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
- R 3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
- R 5 represents a chlorine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom
- R 5 represents a chlorine atom, or a group selected from:
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a trifluoromethyl group
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a fluorine atom
- R 2 , R 4 and R 5 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 3 , R 4 and R 5 each represents a fluorine or a chlorine atom
- R 2 and R 5 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom or a chlorine atom, or a group selected from methoxymethyl, difluoromethyl, ethoxy, difluoromethoxy and benzyloxy
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group; or R 3 represents a fluorine or a chlorine atom, or a methyl group,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from : methyl, ethyl, cyclopropyl,
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring, and R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom,
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group and R 3 , R 4 and R 6 each represents a hydrogen atom,
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or R 2 represents a fluorine atom or a trifluoromethoxy group,
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl trifluoromethyl,
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 6 each represents a fluorine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 8 each represents a hydrogen atom
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or R 3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
- R 5 represents a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a fluorine atom
- R 5 represents a chlorine atom, or a group selected from : methyl, trifluorom and trifluoromethoxy,
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a trifluoromethyl group
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 and R 5 each represents a fluorine atom
- R 2 , R 4 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl grou or R 3 , R 4 and R 5 each represents a fluorine atom,
- R 2 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of gene formula (I), supra, in which :
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 , R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom or a group selected from:
- R 8 and R 9 each present a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
- phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
- phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
- phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; represents a fluorine atom or a chlorine atom, or a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of gene formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
- phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine atom or a chlorine atom, or a group selected from :
- R 3 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, ethyl, difl uoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy grou or represents a trifluoromethyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy g or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of gene formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, ethyl, difl uoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 and R 9 each represents a hydrogen atom; represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen
- R 1 represents a group selected from:
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 and R 9 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 3 represents a fluorine or a chlorine atom, or a methyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 and R 9 each represents a hydrogen atom
- R 3 represents a trifluoromethyl group
- R 2 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a group
- R 4 represents a fluorine or a chlorine atom
- R 2 , R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring
- R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine or a chlorine atom
- R 3 represents a fluorine or a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring
- R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring
- R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine atom
- R 3 represents a chlorine atom or a methyl group
- R 4 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom
- R 2 and R 3 together with the carbon atoms to which they are bound form a benzo ring
- R 1 , R 4 , R 5 and R 6 each represents a hydrogen atom
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine or a chlorine atom, or a group selected from :
- R 4 represents a fluorine or a chlorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine atom, or a group selected from :
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine atom, or a group selected from :
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine atom, or a group selected from :
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine atom, or a group selected from :
- R 4 represents a fluorine atom
- R 3 , R 5 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a group
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine or a chlorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 1 (R 10 )N represents a
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a hydrogen atom
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group
- R z represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from: methyl and trifluoromethyl,
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of sa
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom or a trifluoromethyl group
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 , R 8 and R 9 each represents a hydrogen atom
- R 2 represents a fluorine atom or a trifluoromethoxy group
- R 5 represents a fluorine or a chlorine atom, or group selected from:
- R 3 , R 4 and R 6 each represents a hydrogen atom
- R 1 represents a methyl group
- R 8 and R 9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
- the present invention relates to compounds of general formula (I), supra, in which :
- R 2 and R 6 each represents a fluorine, chlorine or bromine atom
- R 3 , R 4 and R 5 each represents a hydrogen atom
- R 1 represents a group selected from:
- R 8 represents a hydrogen atom or a methyl group
- R 9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
Abstract
The present invention relates to substituted 2-(pyrazol-1-yl)-benzothiazole compounds of general formula (I) in which R1, R8, R9 and R10 are as defined herein, to methods of preparing said compounds, to intermediate compounds useful for preparing said compounds, to pharmaceutical compositions and combinations comprising said compounds and to the use of said compounds for manufacturing a pharmaceutical composition for the treatment or prophylaxis of a disease, in particular of neoplasms, as a sole agent or in combination with other active ingredients.
Description
SUBSTITUTED 2-(lH-PYRAZOL-l-YL)-BENZOTHIAZOLE COMPOUNDS
The present invention relates to substituted 2-(lH-pyrazol-l-yl)-benzothiazole compounds of general formula (I) as described and defined herein, to methods of preparing said compounds, to intermediate compounds useful for preparing said compounds, to pharmaceutical compositions and combinations comprising said compounds and to the use of said compounds for manufacturing a pharmaceutical composition for the treatment or prophylaxis of a disease, in particular of neoplasms, as a sole agent or in combination with other active ingredients.
BACKGROUND OF THE INVENTION
Cancer is the leading cause of death in developed countries and the second leading cause of death in developing countries. Deaths from cancer worldwide are projected to continue rising, with an estimated 12 million deaths in 2030. While substantial progress has been made in developing effective therapies, there is a strong need for additional therapeutic modalities that target cancer and related diseases.
The complexity of cancer disease arises after a selection process for cells with acquired functional capabilities to enhance survival and/or resistance towards apoptosis and a limitless proliferative potential. Due to lagging (neo-) vascularization unrestrained growth of cancer cells leads to tumor regions with suboptimal nutrient and oxygen supply. As distance from supplying blood vessels increases, oxygen and nutrient concentrations decrease and cancer cells react by expression of hypoxia and low-nutrition responsive pathways to promote cell survival in an unfavorable metabolic microenvironment. Indeed, cancer cells in undervascularized tumor regions are considered more resistant to radiation and cytostatic chemotherapy and to contribute to repopulation of the tumor after therapy (Minchinton IA, Tannock IF. Drug penetration in solid tumours. Nature Reviews Cancer 6, 583-592 (August 2006)). Therefore, substances that target cancer cells in poorly vascularized tumor regions or that target cancer cells which underwent metabolic remodeling or adjustment to an unfavorable metabolic microenvironment (Villalba M, Chemical Metabolic Inhibitors for the Treatment of Blood-Borne Cancers. Anti-Cancer Agents in Medicinal Chemistry, 2014, 14, 223-232) have the potential to enhance cytostatic- or radiation-based (chemo)therapy of solid tumors and haematological malignancies.
The objective of the present invention is to provide compounds which can be used for cancer therapy, in particular compounds that target cancer cells including cancer stem(-like) cells in
hypoxic or nutrient-deprived tumor regions or which underwent metabolic adjustments to an unfavorable environment.
WO2008/126899 discloses inter alia N-heteroaryl-pyrazoles and N-heteroaryl-pyrroles as xanthine oxidase inhibitors.
WO2011/126903 disclosed inter alia lH-pyrazole-3-carboxamides and lH-pyrazole-5- carboxamides as inhibitors of thrombin.
WO2012/080729 disclosed inter alia lH-pyrazole-4-carboxamides as casein kinase 1 delta inhibitors.
WO2013/070659 discloses inter alia pyrazole derivatives as modulators of opioid receptors.
WO2003/037274 A2 discloses sodium channel inhibitors for the treatment of neuropathic pain by the inhibition of sodium channels.
However, the state of the art described above does not describe the specific substituted 2-(lH- pyrazol-l-yl)-benzothiazole compounds of general formula (I) of the present invention as defined herein, or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same, as described and defined herein, and as hereinafter referred to as "compounds of the present invention", or their pharmacological activity.
DESCRIPTION of the INVENTION
It has now been found, and this constitutes the basis of the present invention, that said compounds of the present invention have surprising and advantageous properties.
In particular, said compounds of the present invention are suitable to treat cancer. The compounds of the present invention have surprisingly been found to effectively reduce tumor cell viability in nutrient deprived regions. In particular, said compounds of the present invention have been found to effectively kill cancer cells in inner tumor spheroid regions.
Said compounds of the present invention may therefore be used for the treatment or prophylaxis of diseases of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses or diseases which are accompanied with uncontrolled cell growth, proliferation and/or survival, undesirable
cellular immune responses, or undesirable cellular inflammatory responses, for example, haematological tumours, solid tumours, and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas including angioimmunoblastic T-cell lymphomas, head and neck tumours including brain tumours and brain metastases (e.g. anaplastic astrocytoma, diffuse astrocytoma, glioblastoma, oligodendrogl ioma, secondary glioblastoma multiforme), tumours of the thorax including non-small cell and small cell lung tumours, gastrointestinal tumours including cholangiocarcinoma, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas incl uding chondrosarcomas, and/or metastases thereof.
In accordance with a first aspect, the present invention covers compounds of general formula
(I) :
(I)
in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from :
methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, ethoxy, difluoromethoxy, trifluoromethoxy and benzyloxy,
and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, ethyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from: methyl, ethyl, cyclopropyl,
2,2,2-trifluoroethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a trifluoromethyl group
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from: methyl, ethyl and -CH2C(=O)OC2H5, and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom or a methyl group, and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group, and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grour. or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R6 each represents a fluorine, chlorine or bromine atom, and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom, or a group selected from : methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
and Rz, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R3 represents a fluorine or a chlorine atom,
and R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from :
-CH2C(=O)OCH3 and -CH2C(=O)OC2Hs,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R3 and R5 each represents a fluorine atom,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group, or
R3, R4 and R5 each represents a fluorine or a chlorine atom,
and R2 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl and wherein
R1 represents a hydrogen atom or a group selected from
methyl, ethyl, cyclopropyl and cyclopropylmethyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R1 represents a methyl group,
and R2 represents a fluorine or a chlorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R1 represents a methyl group,
and R3 represents a fluorine or a chlorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R4 represents a fluorine or a chlorine atom,
and R2, R3 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R5 represents a fluorine or a chlorine atom,
and R2, R3 and R4 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2 and R5 each represents a hydrogen atom,
and one of R3, R4 represents a fluorine atom whereas the other one of R3, R4 reprents a hydrogen atom,
and R8 and R9 each represents a hydrogen atom; or
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
represents a
wherein * indicates the point of attachement of said group to the carbonyl group;
and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
The term "substituted" means that one or more hydrogens on the designated atom or group are replaced with a selection from the indicated group, provided that the designated atom's normal valency under the existing circumstances is not exceeded. Combinations of substituents and/or variables are permissible.
The term "comprising" when used in the specification includes "consisting of".
If it is referred to "as mentioned herein" within the description it is referred to any of the disclosures made within the specification in any of the preceding pages.
It is possible for the compounds of general formula (I) to exist as isotopic variants. The invention therefore includes one or more isotopic variant(s) of the compounds of general formula (I), particularly deuterium-containing compounds of general formula (I).
The term "Isotopic variant" of a compound or a reagent is defined as a compound exhibiting an unnatural proportion of one or more of the isotopes that constitute such a compound.
The term "Isotopic variant of the compound of general formula (I)" is defined as a compound of general formula (I) exhibiting an unnatural proportion of one or more of the isotopes that constitute such a compound.
The expression "unnatural proportion" means a proportion of such isotope which is higher than its natural abundance. The natural abundances of isotopes to be applied in this context are described in "Isotopic Compositions of the Elements 1997", Pure Appl. Chem., 70(1), 217-235, 1998.
Examples of such isotopes include stable and radioactive isotopes of hydrogen, carbon, nitrogen, oxygen, phosphorus, sulfur, fluorine, chlorine, bromine and iodine, such as 2H (deuterium), 3H (tritium), 11C, 13C, 14C, 15N, 170, 180, 32P, 33P, 33S, 34S, 35S, 36S, 18F, 36CI, 82Br, 123l, 124l, 125l, 129l and 131l, respectively. With respect to the treatment and/or prophylaxis of the disorders specified herein the isotopic variant(s) of the compounds of general formula (I) preferably contain deuterium ("deuterium- containing compounds of general formula (I)"). Isotopic variants of the compounds of general formula (I) in which one or more radioactive isotopes, such as 3H or 14C, are incorporated are useful e.g. in drug and/or substrate tissue distribution studies. These isotopes are particularly preferred for the ease of their incorporation and detectability. Positron emitting isotopes such as 18F or 11C may be incorporated into a compound of general formula (I). These isotopic variants of the compounds of general formula (I) are useful for in vivo imaging applications. Deuterium-containing and 13C-containing compounds of general formula (I) can be used in mass spectrometry analyses in the context of preclinical or clinical studies. Isotopic variants of the compounds of general formula (I) can generally be prepared by methods known to a person skilled in the art, such as those described in the schemes and/or examples herein, by substituting a reagent for an isotopic variant of said reagent, preferably for a deuterium-containing reagent. Depending on the desired sites of deuteration, in some cases deuterium from D2O can be incorporated either directly into the compounds or into reagents that are useful for synthesizing such compounds. Deuterium gas is also a useful reagent for incorporating deuterium into molecules. Catalytic deuteration of olefinic bonds and acetylenic bonds is a rapid route for incorporation of deuterium. Metal catalysts (i.e. Pd, Pt, and Rh) in the presence of deuterium gas can be used to directly exchange deuterium for hydrogen in functional groups containing hydrocarbons. A variety of deuterated reagents and synthetic building blocks are commercially available from companies such as for example C/D/N Isotopes, Quebec, Canada; Cambridge Isotope Laboratories Inc., Andover, MA, USA; and CombiPhos Catalysts, Inc., Princeton, NJ, USA.
The term "deuterium-containing compound of general formula (I)" is defined as a compound of general formula (I), in which one or more hydrogen atom(s) is/are replaced by one or more deuterium atom(s) and in which the abundance of deuterium at each deuterated position of the compound of general formula (I) is higher than the natural abundance of deuterium, which is about 0.015%. Particularly, in a deuterium-containing compound of general formula (I) the
abundance of deuterium at each deuterated position of the compound of general formula (I) is higher than 10% 20% 30% 40% 50% 60% 70% or 80% preferably higher than 90% 95% 96% or 97%, even more preferably higher than 98% or 99% at said position(s). It is understood that the abundance of deuterium at each deuterated position is independent of the abundance of deuterium at other deuterated position(s).
The selective incorporation of one or more deuterium atom(s) into a compound of general formula (I) may alter the physicochemical properties (such as for example acidity [C. L. Perrin, et al., J. Am. Chem. Soc, 2007, 129, 4490], basicity [C. L. Perrin et al., J. Am. Chem. Soc, 2005, 127, 9641], lipophilicity [B. Testa et al., Int. J. Pharm., 1984, 19(3), 271]) and/or the metabolic profile of the molecule and may result in changes in the ratio of parent compound to metabolites or in the amounts of metabolites formed. Such changes may result in certain therapeutic advantages and hence may be preferred in some circumstances. Reduced rates of metabolism and metabolic switching, where the ratio of metabolites is changed, have been reported (A. E. Mutlib et al., Toxicol. Appl. Pharmacol., 2000, 169, 102). These changes in the exposure to parent drug and metabolites can have important consequences with respect to the pharmacodynamics, tolerability and efficacy of a deuterium-containing compound of general formula (I). In some cases deuterium substitution reduces or eliminates the formation of an undesired or toxic metabolite and enhances the formation of a desired metabolite (e.g. Nevirapine: A. M. Sharma et al., Chem. Res. Toxicol., 2013, 26, 410; Efavirenz: A. E. Mutlib et al., Toxicol. Appl. Pharmacol., 2000, 169, 102). In other cases the major effect of deuteration is to reduce the rate of systemic clearance. As a result, the biological half-life of the compound is increased. The potential clinical benefits would include the ability to maintain similar systemic exposure with decreased peak levels and increased trough levels. This could result in lower side effects and enhanced efficacy, depending on the particular compound's pharmacokinetic/ pharmacodynamic relationship. ML-337 (C. J. Wenthur et al., J. Med. Chem., 2013, 56, 5208) and Odanacatib (K. Kassahun et al., WO2012/112363) are examples for this deuterium effect. Still other cases have been reported in which reduced rates of metabolism result in an increase in exposure of the drug without changing the rate of systemic clearance (e.g. Rofecoxib: F. Schneider et al., Arzneim. Forsch. / Drug. Res., 2006, 56, 295; Telaprevir: F. Maltais et al., J. Med. Chem., 2009, 52, 7993). Deuterated drugs showing this effect may have reduced dosing requirements (e.g. lower number of doses or lower dosage to achieve the desired effect) and/or may produce lower metabolite loads.
A compound of general formula (I) may have multiple potential sites of attack for metabolism. To optimize the above-described effects on physicochemical properties and metabolic profile, deuterium-containing compounds of general formula (I) having a certain pattern of one or more deuterium-hydrogen exchange(s) can be selected. Particularly, the deuterium atom(s) of deuterium-containing compound(s) of general formula (I) is/are attached to a carbon atom and/or is/are located at those positions of the compound of general formula (I), which are sites of attack for metabolizing enzymes such as e.g. cytochrome P450.
In another embodiment the present invention concerns a deuterium-containing compound of general formula (I) having 1, 2, 3 or 4 deuterium atoms, particularly with 1, 2 or 3 deuterium atoms.
Where the plural form of the word compounds, salts, polymorphs, hydrates, solvates and the like, is used herein, this is taken to mean also a single compound, salt, polymorph, isomer, hydrate, solvate or the like.
By "stable compound' or "stable structure" is meant a compound that is sufficiently robust to survive isolation to a useful degree of purity from a reaction mixture, and formulation into an efficacious therapeutic agent.
The compounds of this invention may contain one asymmetric centre, depending upon the location and nature of the various substituents desired. Asymmetric carbon atoms are present in the (R) or (S) configuration, resulting in racemic mixtures in the case of a single asymmetric centre.
Preferred isomers are those which produce the more desirable biological activity. These separated, pure or partially purified isomers or racemic mixtures of the compounds of this invention are also included within the scope of the present invention. The purification and the separation of such materials can be accomplished by standard techniques known in the art.
The optical isomers can be obtained by resolution of the racemic mixtures according to conventional processes, for example, by the formation of diastereoisomeric salts using an optically active acid or base or formation of covalent diastereomers. Examples of appropriate acids are tartaric, diacetyltartaric, ditoluoyltartaric and camphorsulfonic acid. Mixtures of diastereoisomers can be separated into their individual diastereomers on the basis of their physical and/or chemical differences by methods known in the art, for example, by
chromatography or fractional crystallisation. The optically active bases or acids are then liberated from the separated diastereomeric salts. A different process for separation of optical isomers involves the use of chiral chromatography (e.g., chiral HPLC columns), with or without conventional derivatisation, optimally chosen to maximise the separation of the enantiomers. Suitable chiral HPLC columns are manufactured by Daicel, e.g., Chiracel OD and Chiracel OJ among many others, all routinely selectable. Enzymatic separations, with or without derivatisation, are also useful. The optically active compounds of this invention can likewise be obtained by chiral syntheses utilizing optically active starting materials.
In order to limit different types of isomers from each other reference is made to lUPAC Rules Section E (Pure Appl Chem 45, 11-30, 1976).
Isolation of a single stereoisomer, e.g. a single enantiomer of a compound of the present invention is achieved by any suitable state of the art method, such as chromatography, especially chiral chromatography, for example.
Further, the compounds of the present invention can exist as N-oxides, which are defined in that at least one nitrogen of the compounds of the present invention is oxidised. The present invention includes all such possible N-oxides.
The present invention also relates to useful forms of the compounds as disclosed herein, such as metabolites, hydrates, solvates, prodrugs, salts, in particular pharmaceutically acceptable salts, and co-precipitates.
The compounds of the present invention can exist as a hydrate, or as a solvate, wherein the compounds of the present invention contain polar solvents, in particular water, methanol or ethanol for example as structural element of the crystal lattice of the compounds. The amount of polar solvents, in particular water, may exist in a stoichiometric or non-stoichiometric ratio. In the case of stoichiometric solvates, e.g. a hydrate, hemi-, (semi-), mono-, sesqui-, di-, tri-, tetra-, penta- etc. solvates or hydrates, respectively, are possible. The present invention includes all such hydrates or solvates.
Further, the compounds of the present invention can exist in free form, e.g. as a free base, or as a free acid, or as a zwitterion, or can exist in the form of a salt. Said salt may be any salt, either an organic or inorganic addition salt, particularly any pharmaceutically acceptable organic or inorganic addition salt, customarily used in pharmacy.
The term "pharmaceutically acceptable salt" refers to a relatively non-toxic, inorganic or organic acid addition salt of a compound of the present invention. For example, see S. M. Berge, et al. "Pharmaceutical Salts," J. Pharm. Sci. 1977, 66, 1-19.
A suitable pharmaceutically acceptable salt of the compounds of the present invention may be, for example, an acid-addition salt of a compound of the present invention bearing a nitrogen atom, in a chain or in a ring, for example, which is sufficiently basic, such as an acid-addition salt with an inorganic acid, such as hydrochloric, hydrobromic, hydroiodic, sulfuric, bisulfuric, phosphoric, or nitric acid, for example, or with an organic acid, such as formic, acetic, acetoacetic, pyruvic, trifluoroacetic, propionic, butyric, hexanoic, heptanoic, undecanoic, lauric, benzoic, salicylic, 2-(4-hydroxybenzoyl)-benzoic, camphoric, cinnamic, cyclopentanepropionic, digluconic, 3-hydroxy-2-naphthoic, nicotinic, pamoic, pectinic, persulfuric, 3-phenylpropionic, picric, pivalic, 2-hydroxyethanesulfonate, itaconic, sulfamic, trifluoromethanesulfonic, dodecylsulfuric, ethansulfonic, benzenesulfonic, para-toluenesulfonic, methansulfonic, 2- naphthalenesulfonic, naphthalinedisulfonic, camphorsulfonic acid, citric, tartaric, stearic, lactic, oxalic, malonic, succinic, malic, adipic, alginic, maleic, fumaric, D-gluconic, mandelic, ascorbic, glucoheptanoic, glycerophosphoric, aspartic, sulfosalicylic, hemisulfuric, or thiocyanic acid, for example. Further, another suitably pharmaceutically acceptable salt of a compound of the present invention which is sufficiently acidic, is an alkali metal salt, for example a sodium or potassium salt, an alkaline earth metal salt, for example a calcium or magnesium salt, an ammonium salt or a salt with an organic base which affords a physiologically acceptable cation, for example a salt with N-methyl-glucamine, dimethyl-glucamine, ethyl-glucamine, lysine, dicyclohexylamine, 1,6-hexadiamine, ethanolamine, glucosamine, sarcosine, serinol, tris-hydroxy-methyl- aminomethane, aminopropandiol, sovak-base, l-amino-2,3,4-butantriol. Additionally, basic nitrogen containing groups may be quaternised with such agents as lower alkyl halides such as methyl, ethyl, propyl, and butyl chlorides, bromides and iodides ; dialkyl sulfates like dimethyl, diethyl, and dibutyl sulfate ; and diamyl sulfates, long chain halides such as decyl, lauryl,
myristyl and strearyl chlorides, bromides and iodides, aralkyl halides like benzyl and phenethyl bromides and others.
Those skilled in the art will further recognise that acid addition salts of the claimed compounds may be prepared by reaction of the compounds with the appropriate inorganic or organic acid via any of a number of known methods. Alternatively, alkali and al kaline earth metal salts of acidic compounds of the invention are prepared by reacting the compounds of the invention with the appropriate base via a variety of known methods.
The present invention includes all possible salts of the compounds of the present invention as single salts, or as any mixture of said salts, in any ratio.
In the present text, in particular in the Experimental Section, for the synthesis of intermediates and of examples of the present invention, when a compound is mentioned as a salt form with the corresponding base or acid, the exact stoichiometric composition of said salt form, as obtained by the respective preparation and/or purification process, is, in most cases, unknown.
Unless specified otherwise, suffixes to chemical names or structural formulae such as "hydrochloride", "trifluoroacetate", "sodium salt", or "x HCI", "x CF3COOH", "x Na+", for example, are to be understood as not a stoichiometric specification, but solely as a salt form.
This applies analogously to cases in which synthesis intermediates or example compounds or salts thereof have been obtained, by the preparation and/or purification processes described, as solvates, such as hydrates with (if defined) unknown stoichiometric composition.
As used herein, the term "in vivo hydrolysable ester" is understood as meaning an in vivo hydrolysable ester of a compound of the present invention containing a carboxy or hydroxy group, for example, a pharmaceutically acceptable ester which is hydrolysed in the human or animal body to produce the parent acid or alcohol. Suitable pharmaceutically acceptable esters for carboxy incl ude for example alkyl, cycloalkyl and optionally substituted phenylalkyl, in particular benzyl esters, Ci-C6 alkoxymethyl esters, e.g. methoxymethyl, Ci-C6 alkanoyloxymethyl esters, e.g. pivaloyloxymethyl, phthalidyl esters, C3-C8 cycloal koxy- carbonyloxy-Ci-C6 alkyl esters, e.g. 1-cyclohexylcarbonyloxyethyl ; l,3-dioxolen-2-onyl methyl esters, e.g. 5-methyl-l,3-dioxolen-2-onylmethyl ; and Ci-C6-alkoxycarbonyloxyethyl esters, e.g.
1-methoxycarbonyloxyethyl, and may be formed at any carboxy group in the compounds of this invention.
An in vivo hydrolysable ester of a compound of the present invention containing a hydroxy group includes inorganic esters such as phosphate esters and [alpha]-acyloxyalkyl ethers and related compounds which as a result of the in vivo hydrolysis of the ester breakdown to give the parent hydroxy group. Examples of [alpha]-acyloxyalkyl ethers include acetoxymethoxy and 2,2-dimethylpropionyloxymethoxy. A selection of in vivo hydrolysable ester forming groups for hydroxy include alkanoyl, benzoyl, phenylacetyl and substituted benzoyl and phenylacetyl, alkoxycarbonyl (to give alkyl carbonate esters), dialkylcarbamoyl and N-(dialkylaminoethyl)-N- alkylcarbamoyl (to give carbamates), dialkylaminoacetyl and carboxyacetyl. The present invention covers all such esters.
Furthermore, the present invention includes all possible crystalline forms, or polymorphs, of the compounds of the present invention, either as single polymorph, or as a mixture of more than one polymorph, in any ratio.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from :
methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluon or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a chlorine atom, or a group selected from:
methoxymethyl, difluoromethyl, ethoxy, difluoromethoxy and benzyloxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from:
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R3 represents a trifluoromethyl group
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R2 represents a fluorine atom,
and R3 represents a chlorine atom,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom,
and R3 represents a chlorine atom or a methyl group,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group, and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom, or group selected from:
methyl and trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 and R6 each represents a fluorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl, cyclopropyl, 2,2,2- trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group
R3 represents a fluorine or a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou
or
R3 represents a fluorine atom,
and R5 represents a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from : -CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a fluorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl grou
R3, R4 and R5 each represents a fluorine atom,
and R2 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a group selected from: methyl, ethyl and cyclopropyl methyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R1 represents a methyl group,
and R3 represents a fluorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R4 represents a fluorine atom,
and R2, R3 and Rs each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
')N re resents a
group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from : methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from:
amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, ethoxy, difluoromethoxy, trifluoromethoxy and benzyloxy,
and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from:
hydroxy, methyl, ethyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group,
and R2, R4, R5 and R5 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a trifluoromethyl group,
and R2, R4, R5 and R5 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl and -CH2C(=O)OC2H5 and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R5 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g
or
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom,
and R4, R5 and R5 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom or a methyl group,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from: methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R2 and R6 each represents a fluorine, chlorine or bromine atom, and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou
or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R5 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom,
and R5 represents a chlorine atom, or a group selected from:
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from : -CH2C(=O)OCH3 and
-CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 and R5 each represents a fluorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3, R4 and R5 each represents a fluorine or a chlorine atom,
and R2 and R5 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same. In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a chlorine atom, or a group selected from methoxymethyl, difluoromethyl, ethoxy, difluoromethoxy and benzyloxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl, cyclopropyl,
2,2,2-trifluoroethyl and -CH2C(=O)OC2Hs,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a trifluoromethyl group,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl and -CH2C(=O)OC2H5, and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom,
and R3 represents a chlorine atom,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom,
and R3 represents a chlorine atom or a methyl group,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom, or group selected from: methyl trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R6 each represents a fluorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and
-CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom, or a group selected from: methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group;
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom, or a group selected from: methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 represents a fluorine atom,
and R5 represents a chlorine atom, or a group selected from : methyl, trifluorom and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from : -CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a fluorine atom,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl grou or
R3, R4 and R5 each represents a fluorine atom,
and R2 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
represents a
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
and
R8 and R9 each present a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
wherein phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
methyl and methoxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, ethoxy, difluoromethoxy, trifluoromethoxy and benzyloxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
wherein phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
methyl and methoxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, ethoxy, difluoromethoxy, trifluoromethoxy and benzyloxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
wherein phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
methyl and methoxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
represents a fluorine atom or a chlorine atom, or a group selected from :
methoxymethyl, difluoromethyl, ethoxy, difl uoromethoxy and benzyloxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine, chlorine or bromine atom, or a group selected from : amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl,
wherein phenyl is optionally substituted with a fluorine or a chlorine atom or with a group selected from :
methyl and methoxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine atom or a chlorine atom, or a group selected from :
methoxymethyl, difluoromethyl, ethoxy, difl uoromethoxy and benzyloxy,
R3, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, ethyl, difl uoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 and R9 each represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group;
represents a fluorine or a chlorine atom, or a methyl group,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
represents a trifluoromethyl group
2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy g or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, ethyl, difl uoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
R2, R4, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom,
or
R3 represents a fluorine or a chlorine atom, or a methyl group,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
and
R8 and R9 each represents a hydrogen atom;
represents a trifluoromethyl group
R2, R4, R5 and R6 each represents a hydrogen
R1 represents a group selected from:
methyl, ethyl and -CH2C(=O)OC2Hs,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 and R9 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group;
or
R3 represents a fluorine or a chlorine atom, or a methyl group,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R3 represents a trifluoromethyl group
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from : hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
R2, R4, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R3 represents a fluorine or a chlorine atom, or a methyl group,
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
and
R8 and R9 each represents a hydrogen atom;
or
R3 represents a trifluoromethyl group
R2, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R4 represents a fluorine or a chlorine atom,
R2, R3, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R4 represents a fluorine or a chlorine atom,
R2, R3, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine or a chlorine atom,
R3 represents a fluorine or a chlorine atom,
R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom,
R3 represents a fluorine or a chlorine atom or a methyl group, R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group;
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and
R1, R4, R5 and R6 each represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine or a chlorine atom,
R3 represents a fluorine or a chlorine atom,
R4, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine or a chlorine atom,
R3 represents a fluorine or a chlorine atom or a methyl group,
R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom;
or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and
R1, R4, R5 and R6 each represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine atom,
R3 represents a chlorine atom,
R4, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine atom,
R3 represents a chlorine atom or a methyl group,
R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, R1, R4, R5 and R6 each represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine atom,
R3 represents a chlorine atom,
R4, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine atom,
R3 represents a chlorine atom or a methyl group,
R4, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom;
or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, R1, R4, R5 and R6 each represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R3, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine or a chlorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom;
or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R2 represents a fluorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R2 represents a fluorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine atom,
R3, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine atom, or a group selected from :
methyl and trifluoromethoxy,
R4 represents a fluorine atom,
R3, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom or a trifluoromethyl group R3, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
R3, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, R5 represents a fluorine or a chlorine atom or a trifluoromethyl group R3, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
R3, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom or a trifluoromethyl group
R3, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group or
Rz represents a fluorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom, or group selected from: methyl and trifluoromethyl,
R3, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of sa In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 represents a fluorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom or a trifluoromethyl group
R3, R4 and R6 each represents a hydrogen atom,
R1, R8 and R9 each represents a hydrogen atom;
or
R2 represents a fluorine atom or a trifluoromethoxy group,
R5 represents a fluorine or a chlorine atom, or group selected from:
methyl and trifluoromethyl,
R3, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2 and R6 each represents a fluorine, chlorine or bromine atom,
R3, R4 and R5 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and
-CH2C(=O)OC2Hs,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 and R5 each represents a fluorine, chlorine or bromine atom,
R3, R4 and R5 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and
-CH2C(=O)OC2H5,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 and R6 each represents a fluorine atom,
R3, R4 and R5 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
R^R10^ represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2 and R5 each represents a fluorine atom,
R3, R4 and R5 each represents a hydrogen atom,
R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and
-CH2C(=O)OC2H5,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from methyl, trifluoromethyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 and R8 each represents a hydrogen atom,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine, chlorine or bromine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 and R8 each represents a hydrogen atom,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, R4 represents a fluorine or a chlorine atom,
R2, R5 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of gene formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from : methyl and methoxy,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 represents a fluorine or a chlorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; and R5 each represents a trifluoromethyl group,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
R1 and R9 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl and methoxy,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R3 represents a fluorine or a chlorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom;
or
R3 and R5 each represents a trifluoromethyl group,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl and methoxy,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 represents a fluorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group or
R3 and R5 each represents a trifluoromethyl group,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group or
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
R1 and R9 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of sa
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl and methoxy,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen;
or
R3 represents a fluorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R1, R8 and R9 each represents a hydrogen atom;
or
R3 and R5 each represents a trifluoromethyl group,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl and methoxy,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine or a chlorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3 and R5 each represents a trifluoromethyl group,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a group selected from:
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
R1 and R9 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
represents a
R3 represents a fluorine or a chlorine atom, or a group selected from :
methyl and methoxy,
R5 represents a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
represents a
R3
' group,
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3 represents a fluorine or a chlorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 and R5 each represents a fluorine atom,
R2, R4 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3 represents a fluorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3 represents a fluorine atom,
R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
R2, R4 and R6 each represents a hydrogen atom,
R1 represents a methyl group,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3, R4 and R5 each represents a fluorine or a chlorine atom,
R2 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a methyl group,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl grou and wherein
R3, R4 and R5 each represents a fluorine or a chlorine atom,
R2 and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom or a methyl group,
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R3, R4 and R5 each represents a fluorine atom,
Rz and R6 each represents a hydrogen atom,
R1 represents a hydrogen atom,
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R3, R4 and R5 each represents a fluorine atom,
R2 and R6 each represents a hydrogen atom,
and
R1, R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a group selected from : methyl, ethyl, cyclopropyl cyclopropyl methyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R1 represents a methyl group,
and R2 represents a fluorine or a chlorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R3 represents a fluorine or a chlorine atom,
and R2, R4 and R5 each represents a hydrogen atom
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R4 represents a fluorine or a chlorine atom,
and R2, R3 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R5 represents a fluorine or a chlorine atom,
and R2, R3 and R4 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1(R10)N represents a
group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a group selected from
methyl, ethyl and cyclopropylmethyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R1 represents a methyl group,
and R3 represents a fluorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R4 represents a fluorine atom,
and R2, R3 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R8 represents a hydrogen atom or a methyl group;
and
wherein * indicates the point of attachement of said group to the carbonyl group;
and wherein
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl, cyclopropyl and cyclopropylmethyl-,
and
R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom;
or
R1 represents a methyl group,
and
R2 represents a fluorine or a chlorine atom,
and
R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
represents a methyl group,
and
R3 represents a fluorine or a chlorine atom,
and
R2, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
represents a methyl group,
and
R4 represents a fluorine or a chlorine atom,
and
R2, R3 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and
R5 represents a fluorine or a chlorine atom,
and
R2, R3 and R4 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R8 represents a hydrogen atom or a methyl group;
and
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group and wherein
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl and cyclopropylmethyl-,
and
R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom;
or
R1 represents a methyl group,
and
R3 represents a fluorine atom,
and
R2, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R1 represents a methyl group,
and
R4 represents a fluorine atom,
and
R2, R3 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group;
and wherein
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl and cyclopropylmethyl-,
and
R2, R3, R4 and R5 each represents a hydrogen atom;
or
R1 represents a methyl group,
and
R3 represents a fluorine atom,
and
R2, R4 and R5 each represents a hydrogen atom;
or
R1 represents a methyl group,
and
R4 represents a fluorine atom,
and
R2, R3 and R5 each represents a hydrogen atom; and
R8 and R9 each represents a hydrogen atom;
or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group;
and wherein
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl, cyclopropyl and cyclopropylmethyl-,
and
R2, R3, R4 and R5 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom, or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachment of said group to the carbonyl group;
and wherein
R1 represents a methyl group,
and
R2 represents a fluorine or a chlorine atom,
and
R3, R4 and R5 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R^R^JN re resents a
wherein * indicates the point of attachment of said group to the rest of the molecule; and wherein
R1 represents a methyl group,
and
R3 represents a fluorine or a chlorine atom,
and
R2, R4 and R5 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachment of said group to the carbonyl group;
and wherein
R1 represents a methyl group,
and
R4 represents a fluorine or a chlorine atom,
and
R2, R3 and R5 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R^R^JN re resents a
and wherein
R1 represents a methyl group,
and
R5 represents a fluorine or a chlorine atom,
and
R2, R3 and R4 each represents a hydrogen atom,
and
R8 represents a hydrogen atom or a methyl group,
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R^R^JN re resents a
wherein * indicates the point of attachment of said group to the carbonyl group;
and wherein
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl and cyclopropylmethyl-,
and
R2, R3, R4 and R5 each represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachment of said group to the carbonyl group;
and wherein
R1 represents a methyl group,
and
R3 represents a fluorine atom,
and
R2, R4 and R5 each represents a hydrogen atom,
and
R8 and R9 each represents a hydrogen atom; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachment of said group to the carbonyl gi
and wherein
R1 represents a methyl group,
and
R4 represents a fluorine atom,
and
R2, R3 and R5 each represents a hydrogen atom
and
R8 and R9 each represents a hydrogen atom; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and
R2, R3, R4 and R5 each represents a hydrogen atom;
or
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
R2, R3, R4 and R5 each represents a hydrogen atom;
R8 represents a hydrogen atom or a methyl group;
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
and
R2, R3, R4 and R5 each represents a hydrogen atom;
or
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
R2, R3, R4 and R5 each represents a hydrogen atom;
and
R8 and R9 each represents a hydrogen atom;
or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
R2, R3, R4 and R5 each represents a hydrogen atom;
R8 represents a hydrogen atom or a methyl group;
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N re resents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a methyl group,
R2, R3, R4 and R5 each represents a hydrogen atom;
and
R8 and R9 each represents a hydrogen atom; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R R^JN represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
R2, R3, R" and R5 each represents a hydrogen atom;
R8 represents a hydrogen atom or a methyl group;
and
R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group;
and wherein
represents a methyl group,
R2, R3, R4 and R5 each represents a hydrogen atom;
and
R8 and R9 each represents a hydrogen atom; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom;
represents a hydrogen atom or a methyl group;
and
represents a hydrogen atom or a fluorine atom or a methoxy group; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
In another preferred embodiment, the present invention relates to compounds of general formula (I), supra, in which :
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom;
and
R8 and R9 each represents a hydrogen atom; or a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
It is to be understood that the present invention relates also to any combination of the preferred embodiments described above.
More particularly still, the present invention covers compounds of general formula (I) which are disclosed in the Example section of this text, infra.
In accordance with another aspect, the present invention covers methods of preparing compounds of the present invention, said methods comprising the steps as described in the Experimental Section herein.
In accordance with a further aspect, the present invention covers intermediate compounds which are useful for the preparation of the compounds of general formula (I), supra.
In accordance with a further aspect, the present invention covers the use of the intermediate compound of general (V) :
(V)
in which R8 and R9 are as defined for the compounds of general formula (I) supra, for the preparation of a compound of general formula (I) as defined supra.
In accordance with a further aspect, the present invention covers the use of the intermediate compound of general formula (VII) :
(VI I)
in which R8 and R9 are as defined for the compounds of general formula (I) supra, for the preparation of a compound of general formula (I) as defined supra.
In accordance with a further aspect, the present invention covers the use of the intermediate compounds of general formula (VI) :
in which R1 and R10 are as defined for the compounds of general formula (I) supra, and salts thereof, such as for example a salt with hydrochloric acid, for the preparation of a compound of general formula (I) as defined supra.
In accordance with a further aspect, the present invention relates to compounds of general formula (I), as decribed supra, or racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, for use in the treatment or prophylaxis of a disease.
In accordance with a further aspect, the present invention relates to a pharmaceutical composition comprising a compound of general formula (I), as decribed supra, or racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, and a pharmaceutically acceptable diluent or carrier.
Particularly, the pharmaceutical combination comprises:
one or more first active ingredients selected from a compound of general formula (I) as decribed supra, and
one or more second active ingredients selected from chemotherapeutic anti-cancer agents (see below).
In accordance with a further aspect, the present invention relates to use of a compound of general formula (I), as described supra, or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, for the prophylaxis or treatment of a disease.
In accordance with a further aspect, the present invention relates to use of a compound of general formula (I), as described supra, or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, for the preparation of a medicament for the prophylaxis or treatment of a disease.
The disease as mentioned before is in particular a disease of uncontrolled cell growth, proliferation and/or survival, an undesirable cellular immune response, or an undesirable cellular inflammatory response, particularly in which the disease of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune response, or undesirable cellular inflammatory response is a haematological tumour, a solid tumour and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas, head and neck tumours including brain tu mours and brain metastases, tumours of the thorax including non-small cell and small cell lung tumours, gastrointestinal tumours, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas, and/or metastases thereof.
EXPERIMENTAL SECTION
1H-NMR data are listed in the form of 1H-NM R peaklists. For each signal peak the δ value in ppm is given, followed by the signal intensity, reported in round brackets. The δ value-signal intensity pairs from different peaks are separated by commas. Therefore, a peaklist is described by the general form : δι (intensityi), 62 (intensityz), ... , δ, (intensity,), ... , δη (intensityn).
The intensity of a sharp signal correlates with the height (in cm) of the signal in a printed NMR spectrum. When compared with other signals, this data can be correlated to the real ratios of the signal intensities. In the case of broad signals, more than one peak, or the center of the signal along with their relative intensity, compared to the most intense signal displayed in the spectrum, are shown. A 1H-N MR peaklist is similar to a classical 1H-N MR readout, and thus usually contains all the peaks listed in a classical NMR interpretation. Moreover, similar to classical 1H-NMR printouts, peaklists can show solvent signals, signals derived from stereoisomers of target compounds (also the subject of the invention), and/or peaks of
impurities. The peaks of stereoisomers, and/or peaks of impurities are typically displayed with a lower intensity compared to the peaks of the target compounds (e.g., with a purity of >90%). Such stereoisomers and/or impurities may be typical for the particular manufacturing process, and therefore their peaks may help to identify the reproduction of our manufacturing process on the basis of "by-product fingerprints". An expert who calculates the peaks of the target compounds by known methods (MestReC, ACD simulation, or by use of empirically evaluated expectation values), can isolate the peaks of target compounds as required, optionally using additional intensity filters. Such an operation would be similar to peak-picking in classical 1H- NMR interpretation. A detailed description of the reporting of NMR data in the form of peaklists can be found in the publication "Citation of NMR Peaklist Data within Patent Applications" (cf. Research Disclosure Database Number 605005, 2014, 01 Aug 2014, or http://www.researchdisclosure.com/searching-disclosures). In the peak picking routine, as described in the Research Disclosure Database Number 605005, the parameter "MinimumHeight" can be adjusted between 1% and 4%. Depending on the chemical structure and/or depending on the concentration of the measured compound it may be reasonable to set the parameter "MinimumHeight" <1%.
Chemical names were generated using the ACD/Name software from ACD/Labs. In some cases generally accepted names of commercially available reagents were used in place of ACD/Name generated names.
Table 1: Abbreviations
Other abbreviations have their meanings customary per se to the skilled person.
The various aspects of the invention described in this application are illustrated by the following examples which are not meant to limit the invention in any way.
Syntheses of Compounds (Overview)
The following schemes and general procedures illustrate general synthetic routes to the compounds of general formula (I) of the invention and are not intended to be limiting. It is obvious to the person skilled in the art that the order of transformations as exemplified in Scheme 1 can be modified in various ways. The order of transformations exemplified in Scheme 1 is therefore not intended to be limiting. In addition, interconversion of substituents, for example of residues R1, R8, R9 and R10 can be achieved before and/or after the exemplified transformations. These modifications can be such as the introduction of protecting groups, cleavage of protecting groups, reduction or oxidation of functional groups, halogenation, metallation, substitution or other reactions known to the person skilled in the art. These transformations include those which introduce a functionality which allows for further interconversion of substituents. Appropriate protecting groups and their introduction and cleavage are well-known to the person skilled in the art (see for example T. W. Greene and P.G.M. Wuts, Protective Groups in Organic Synthesis, 3rd edition, Wiley 1999).
Specific examples are described in the subsequent paragraphs. Further, it is possible that two or more successive steps may be performed without work-up being performed between said steps, e.g. in a "one-pot" reaction, as it is well-known to a person skilled in the art.
Scheme 1:
Scheme 1: Preparation of compounds of the general formula (I), starting from 2-hydrazino- benzothiazoles of general formula (III)
Scheme 1 outlines the preparation of compounds of the formula (I), in which R1, R8, R9 and R10 are as defined supra, starting from 2-hydrazinobenzothiazole derivatives of general formula (III), which can be converted into the ethyl pyrazole-carboxylate of general formula (IV) by treatment with ethyl 2-formyl-3-oxopropanoate. 2-Hydrazinobenzothiazole derivatives of general formula (III) are well known to the person skilled in the art (CAS Registry Numbers 615- 21-4, 20174-68-9, 193828-79-4, 80945-74-0) and are either commercially available or can be prepared by methods, which are well known to the person skilled in the art. Said ethyl pyrazole-carboxylate of general formula (IV) can be subsequently converted into pyrazole- carboxylic acid of general formula (V), e.g. by hydrolysis with lithium hydroxide or other methods known to the person skilled in the art. Said pyrazole-carboxylic acid of general formula (V) can be subsequently converted into compounds of the general formula (I). This can be accomplished directly by reacting a compound of the formula (V) with an amine of the general formula (VI) or a salt thereof, such as for example a salt with hydrochloric acid, in an amide
coupling reaction, for example in the presence of a tertiary aliphatic amine, such as N,N- diisopropylethylamine, and a reagent such as propane phosphonic acid anhydride (T3P) or (benzotriazol-l-yloxy)tripyrrolidinophosphonium hexafluorophosphate (PYBOP), or in the presence of a tertiary aliphatic amine, such as triethylamine, and a reagent such as 1- [bis(dimethylamino)methylene]-1H-l,2,3-triazolo[4,5-b] pyridinium 3-oxid hexafl uorophosphate (HATU), in a suitable solvent such as Ν,Ν-dimethylformamide. Amines of the general formula (VI) are well known to the person skilled in the art, and are often commercially available, or can be prepared by methods which are well known to the person skilled in the art.
Alternatively, the amide coupling reaction can be performed by reaction of compound of the general formula (VI) or a salt thereof, such as for example a salt with hydrochloric acid with an acid chloride of general formula (VII). Methods for the preparation of acid chlorides from carboxylic acid are well known to the person skilled in the art.
Scheme 2:
(I)
Scheme 2 : Alternative preparation of compounds of the general formula (I)
Scheme 2 outlines an alternative preparation of compounds of the formula (I), in which R1, R8, R9 and R10 are as defined supra, and X represents a leaving group, such as for example a halogenide or an alkylsulfonate or an arylsulfonate, starting from pyrazole-carboxylic acid of general formula (V). Said pyrazole-carboxylic acid of the general formula (V) can be converted into compounds of the general formula (l-a), which are compounds of the general formula (I), in which R1 represents a hydrogen atom.
This can be accomplished directly by reacting a compound of the general formula (V) with an amine of the general formula (Vl-a) or a salt thereof, such as for example a salt with hydrochloric acid, in an amide coupling reaction, for example in the presence of a tertiary aliphatic amine, such as Ν,Ν-diisopropylethylamine, and a reagent such as propane phosphonic acid anhydride (T3P) or (benzotriazol-l-yloxy)tripyrrolidinophosphonium hexafl uorophosphate (PYBOP), or in the presence of a tertiary aliphatic amine, such as triethylamine, and a reagent such as l-[bis(dimethylamino)methylene]-1H-l,2,3-triazolo[4,5-b]pyridinium 3-oxid hexafluorophosphate (HATU), in a suitable solvent such as Ν,Ν-dimethylformamide. Amines of the general formula (Vl-a) are well known to the person skilled in the art, and are often commercially available, or can be prepared by methods which are well known to the person skilled in the art. Alternatively, the amide coupling reaction can be performed by reaction of compound of the general formula (Vl-a) or a salt thereof, such as for example a salt with hydrochloric acid with an acid chloride of general formula (VII).
Compounds of the general formula (l-a) can be converted to compounds of the general formula (I). This can be accomplished by deprotonation of a compound of the general formula (l-a) with a base such as sodium hydride in a suitable solvent such as Ν,Ν-dimethylformamide and subsequent reaction with a compound of general formula (VIII), wherein X represents a leaving group, such as for example a halogenide or an alkylsulfonate or an arylsulfonate, preferably bromide or iodide. Compounds of general formula (VI II) are well known to the person skilled in the art, and are often commercially available.
In accordance with another aspect, the present invention also relates to a method of preparing a compound of general formula (I) as defined supra, said method comprising the step of allowing a compound of general formula (V) :
(V) in which 8 and R9 are as defined for the compounds of general formula (I) supra, to react with a compound of general formula (VI) :
(VI) in which 1 and R10 are as defined for the compounds of general formula (I) supra, or a salt thereof, such as for example a salt with hydrochloric acid, in the presence of a tertiary aliphatic amine, such as Ν,Ν-diisopropylethylamine, and propane phosphonic acid anhydride, thereby giving a compound of general formula (I) :
(I)
in which R1, R8, R9 and R10 are as defined supra.
In accordance with another aspect, the present invention also relates to a method of preparing a compound of general formula (I) as defined supra, said method comprising the step of allowing a compound of general formula (VII) :
(VI)
in which 1 and R10 are as defined for the compounds of general formula (I) supra, or a salt thereof, such as for example a salt with hydrochloric acid, in the presence of a tertiary aliphatic amine, such as Ν,Ν-diisopropylethylamine, thereby giving a compound of general formula (I) :
(I)
in which R1, R8, R9 and R10 are as defined supra.
In accordance with another aspect, the present invention also relates to a method of preparing a compound of general formula (I) as defined supra, said method comprising the step of allowing a compound of general formula (l-a) :
(l-a)
in which R8, R9 and R10 are as defined for the compounds of general formula (I) supra, to react with a compound of general formula (VIII) :
in which R1 is as defined for the compounds of general formula (I) supra, and X represents leaving group, such as bromide or iodide, in the presence of a base, such as sodium hydrd thereby giving a compound of general formula (I) :
(I)
in which R1, R8, R9 and R10 are as defined supra. General part
All reagents, for which the synthesis is not described in the experimental part, are either commercially available, or are known compounds or may be formed from known compounds by known methods by a person skilled in the art.
The compounds and intermediates produced according to the methods of the invention may require purification. Purification of organic compounds is well known to the person skilled in the art and there may be several ways of purifying the same compound. In some cases, no purification may be necessary. In some cases, the compou nds may be purified by crystallization. In some cases, impurities may be digested using a suitable solvent. In some cases, the compounds may be purified by chromatography, particularly flash column chromatography, using for example prepacked silica gel cartridges, e.g. Biotage SNAP cartidges KP-Sif or KP-N He in combination with a Biotage autopurifier system (SP4* or Isolera Four") and eluents such as gradients of hexane/ethyl acetate or dichloromethane/methanol. In some cases, the compounds may be purified by preparative HPLC using for example a Waters autopurifier equipped with a diode array detector and/or on-line electrospray ionization mass spectrometer in combination with a suitable prepacked reverse phase column and eluents such as gradients of water and acetonitrile which may contain additives such as trifluoroacetic acid, formic acid or aqueous ammonia.
In some cases, purification methods as described above can provide those compounds of the present invention which possess a sufficiently basic or acidic functionality in the form of a salt, such as, in the case of a compound of the present invention which is sufficiently basic, a trifluoroacetate or formate salt for example, or, in the case of a compound of the present invention which is sufficiently acidic, an ammonium salt for example. A salt of this type can either be transformed into its free base or free acid form, respectively, by various methods known to the persion skilled in the art, or be used as salts in subsequent biological assays. It is to be understood that the specific form (e.g. salt, free base etc.) of a compound of the present invention as isolated and as described herein is not necessarily the only form in which said compound can be applied to a biological assay in order to quantify the specific biological activity.
Methods:
Method 1:
Instrument: Waters Autopurificationsystem SQD; column: Waters XBrigde C18 5μ 100x30mm; water + 0.1% vol. formic acid (99%) / acetonitrile gradient; temperature: room temperature; injection: 2500 μL; DAD scan: 210-400 nm.
Method 2:
Instrument: Waters Acquity UPLC-MS SQD; column: Acquity UPLC BEH C18 1.7 50x2. lmm; Eluent A: water + 0.1% vol. formic acid (99%), Eluent B: acetonitrile; gradient: 0-1.6 min 1-99% B, 1.6-2.0 min 99% B; rate 0.8 mL/min; temperature: 60 °C; DAD scan: 210-400 nm; ELSD.
Method 3:
Instrument: Waters Autopurificationsystem SQD; column: Waters XBrigde C18 5μ 100x30mm; water + 0.2% vol. ammonia (32%) / acetonitrile gradient; temperature: room temperature; injection: 2500 μL; DAD scan: 210-400 nm.
Method 4:
Instrument: Waters Acquity UPLC-MS SQD; column: Acquity UPLC BEH C18 1.7 50x2. lmm; Eluent A: water + 0.2% vol. ammonia (32%), Eluent B: acetonitrile; gradient: 0-1.6 min 1-99% B, 1.6-2.0 min 99% B; rate 0.8 mL/min; temperature: 60 °C; DAD scan: 210-400 nm; ELSD.
Intermediates Intermediate 1
ethyl 1-(1,3-benzothiazo -2-yl)-1H-pyrazole-4-carboxylate
2-Hydrazinyl-l,3-benzothiazole (20.0 g, 121 mmol) was provided in a mixture of THF/ethanol (600 mL, 2:1). Ethyl 2-formyl-3-oxopropanoate (15 mL, 120 mmol) was added, and the mixture was stirred at 80 °C for 2 h. After concentration, the remaining material was stirred in a mixture
of hexane/ethanol (600 mL, 5:1). The precipitate was collected by filtration, was washed with hexane and was dried under reduced pressure at 50 °C. 27.1 g (82% of theory) of the title compound were obtained.
LC-MS (method 2): R, = 1.34 min; MS (ESIpos): m/z = 274 [M+H]+
:H-NMR (400 MHz DMSO-d5) δ [ppm]: 1.304 (7.16), 1.322 (16.00), 1.340 (7.38), 2.523 (0.82), 4.274 (2.09), 4.292 (6.78), 4.310 (6.79), 4.327 (2.10), 7.462 (1.06), 7.466 (1.09), 7.481 (2.15), 7.483 (2.38), 7.501 (1.93), 7.504 (1.83), 7.555 (1.70), 7.558 (1.60), 7.573 (1.58), 7.575 (2.39), 7.579 (1.88), 7.593 (1.32), 7.597 (1.09), 7.960 (2.23), 7.963 (2.21), 7.980 (2.10), 7.984 (1.83), 8.144 (2.13), 8.148 (2.08), 8.164 (2.00), 8.168 (1.84), 8.334 (6.43), 9.066 (7.07).
Intermediate 2
1-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxylic acid
The compound of intermediate 1 (29.1 g, 106 mmol) was provided in 1,4-dioxane (270 mL). Lithium hydroxide (5.09 g, 213 mmol) and water (110 mL) were added, and the mixture was stirred at room temperature overnight. After concentration, the remaining material was diluted with water and a 2N aqueous hydrogen chloride solution was added till a pH of 2 was reached. The precipitate was collected by filtration, was washed with water and was dried under reduced pressure. 25.6 g (98% of theory) of the title compound were obtained.
LC-MS (method 2): R, = 1.01 min; MS (ESIpos): m/z = 246 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.523 (3.06), 2.536 (0.96), 2.541 (0.70), 3.563 (7.45), 7.452 (3.27), 7.456 (3.90), 7.471 (5.83), 7.474 (6.72), 7.476 (5.09), 7.491 (6.17), 7.494 (5.69), 7.545 (5.41), 7.548 (5.34), 7.563 (4.49), 7.566 (6.11), 7.569 (5.20), 7.584 (4.29), 7.587 (4.10), 7.958 (5.75), 7.962 (5.24), 7.979 (5.13), 7.983 (5.38), 8.136 (5.77), 8.141 (5.69), 8.157 (5.24), 8.161 (5.05), 8.281 (16.00), 8.292 (0.63), 8.988 (15.89), 8.997 (0.84).
Intermediate 3
5-Fluoro-2,3-dihydro-1H-inden-l-one (500 mg, 3.33 mmol) was provided in ethanol (10 mL). A suspension of hydroxylamine hydrochloride (1:1) (555 mg, 7.99 mmol) in a mixture of water and ethanol (1:1, 2 mL) and a suspension of sodium acetate (656 mg, 7.99 mmol) in a mixture of water and ethanol (1:1, 2 mL) were added, and the resulting mixture was stirred under reflux for 3.5 h. After cooling to room temperature, the mixture was triturated with water. The precipitate was collected by filtration, washed with ethanol and dried under reduced pressure to give 470 mg (85% of theory) of the title compound.
LC-MS (method 2): R, = 0.89 min; MS (ESIpos): m/z = 166 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.052 (0.53), 2.327 (0.49), 2.523 (2.41), 2.669 (0.48), 2.781 (4.12), 2.793 (3.72), 2.798 (5.08), 2.804 (3.74), 2.808 (2.45), 2.815 (7.05), 2.978 (4.03), 2.997 (4.05), 3.012 (2.91), 7.064 (1.43), 7.070 (1.61), 7.085 (2.32), 7.087 (2.43), 7.091 (2.73), 7.093 (2.53), 7.108 (1.58), 7.114 (1.77), 7.194 (2.43), 7.200 (2.34), 7.217 (2.49), 7.223 (2.38), 7.539 (3.23), 7.553 (3.37), 7.560 (3.20), 7.574 (3.05), 10.855 (16.00).
Intermediate 4
6-fluoro-N-hydroxy-2,3-dihydro-1H-inden
6-Fluoro-2,3-dihydro-1H-inden-l-one (500 mg, 3.33 mmol) was provided in ethanol (10 mL). A suspension of hydroxylamine hydrochloride (1:1) (555 mg, 7.99 mmol) in a mixture of water and ethanol (1:1, 2 mL) and a suspension of sodium acetate (656 mg, 7.99 mmol) in a mixture of water and ethanol (1:1, 2 mL) were added, and the resulting mixture was stirred under reflux for 3.5 h. After cooling to room temperature, the mixture was triturated with water. The precipitate was collected by filtration, washed with ethanol and dried under reduced pressure to give 415 mg (75% of theory) of the title compound.
LC-MS (method 2): R, = 0.90 min; MS (ESIpos): m/z = 166 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.048 (0.45), 2.794 (3.91), 2.802 (1.98), 2.807 (4.74), 2.811 (5.43), 2.817 (3.88), 2.827 (7.58), 2.940 (4.63), 2.957 (4.72), 2.959 (4.60), 2.974 (2.92), 7.143 (1.59), 7.149 (1.99), 7.164 (2.64), 7.171 (3.26), 7.187 (1.98), 7.193 (2.45), 7.229 (3.49), 7.235 (3.21), 7.251 (3.60), 7.257 (3.18), 7.362 (2.69), 7.376 (2.87), 7.384 (2.52), 7.397 (2.33), 11.043 (16.00).
Intermediate 5
5-fluoro-2,3-dihydro-1H-inden-l-amine
The compound of intermediate 3 (470 mg, 2.85 mmol) was dissolved in a mixture of methanol (42 mL) and acetic acid (4.4 mL). Palladium on charcoal (50% water, 90.8 mg, 10 % purity, 85.4 μmοΙ) was added, and it was stirred under an atmosphere of hydrogen at room temperature for 0.5 h. Palladium on charcoal (50% water, 90.8 mg, 10 % purity, 85.4 μmοΙ) was added, and it was stirred under an atmosphere of hydrogen at room temperature for 4 h.The catalyst was filtered off and washed with methanol. After concentration, 537 mg (100% of theory) of the title compound were obtained.
1H-NMR (400 MHz, DMSO-d6) δ [ppm]: 1.647 (0.50), 1.667 (0.51), 1.679 (0.58), 1.698 (0.58), 1.700 (0.58), 1.861 (16.00), 2.340 (0.46), 2.349 (0.50), 2.359 (0.47), 2.368 (0.44), 2.372 (0.46), 2.380 (0.45), 2.523 (0.77), 2.696 (0.41), 2.716 (0.54), 2.737 (0.67), 2.844 (0.42), 2.853 (0.44), 2.865 (0.45), 2.874 (0.44), 4.211 (0.52), 4.229 (1.01), 4.248 (0.52), 6.969 (0.47), 6.984 (0.50), 6.990 (0.81), 7.006 (1.12), 7.013 (1.11), 7.030 (0.86), 7.037 (0.58), 7.353 (0.72), 7.366 (0.77), 7.372 (0.67), 7.374 (0.70), 7.387 (0.66).
Intermediate 6
6-fluoro-2,3-dihydro-1H-inden-l-amine
The compound of intermediate 4 (415 mg, 2.51 mmol) was dissolved in a mixture of methanol (34 mL) and acetic acid (3.9 mL). Palladium on charcoal (50% water, 80.2 mg, 10 % purity, 75.4 μmοΙ) was added, and it was stirred under an atmosphere of hydrogen at room temperature for 2.5 h. The catalyst was filtered off and washed with methanol. After concentration, 448 mg (100% of theory) of the title compound were obtained.
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.629 (0.59), 1.639 (0.72), 1.652 (0.87), 1.661 (1.17), 1.667 (1.08), 1.673 (0.87), 1.682 (0.95), 1.689 (0.81), 1.698 (0.58), 1.704 (0.48), 1.864 (13.04), 1.870 (16.00), 1.874 (15.89), 2.327 (0.87), 2.335 (0.80), 2.347 (1.31), 2.354 (1.38), 2.359 (1.04), 2.366 (1.39), 2.373 (1.04), 2.378 (1.36), 2.385 (1.25), 2.396 (0.74), 2.404 (0.71), 2.523 (1.91), 2.636 (0.55), 2.659 (1.03), 2.664 (0.78), 2.674 (1.31), 2.678 (1.35), 2.697 (1.60), 2.717 (0.83), 2.794 (0.95), 2.799 (1.24), 2.801 (1.26), 2.816 (1.03), 2.821 (1.25), 2.823 (1.27), 2.840 (0.84), 2.862 (0.76), 4.205 (0.62), 4.226 (1.65), 4.244 (1.55), 4.264 (0.58), 6.939 (0.72), 6.946 (1.06), 6.960 (1.27), 6.967 (2.08), 6.984 (0.98), 6.989 (1.31), 6.996 (0.69), 7.148 (0.96), 7.155 (1.77), 7.183 (3.23), 7.196 (2.15), 7.202 (2.02), 7.205 (1.91), 7.217 (1.68).
Intermediate 7
1-(1,3-benzothiazol- -yl)-N-(5-fluoro-2,3-dihydro-1H-inden-l-yl)-1H-pyrazole-4<arboxamide
The compound of intermediate 2 (581 mg, 2.37 mmol) was provided in DMF (9 mL). N,N- Diisopropylethylamine (1.2 mL, 7.10 mmol), the compound of intermediate 5 (537 mg, 2.84 mmol) and propane phosphonic acid anhydride (T3P, 1.7 mL, 50% in DMF, 2.84 mmol) were added, and the mixture was stirred at room temperature for 3 days. After filtration, purification by HPLC (column: Chromatorex C18, mobile phase: acetonitrile/water + 0.5% formic acid) yielded 236 mg (26% of theory) of the title compound.
LC-MS (method 2): R, = 1.32 min; MS (ESIpos): m/z = 379 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.932 (0.80), 1.953 (1.96), 1.964 (1.10), 1.972 (2.07), 1.985 (2.19), 1.993 (1.11), 2.004 (2.21), 2.025 (0.98), 2.322 (0.68), 2.326 (0.95), 2.332 (0.66), 2.459 (0.85), 2.468 (1.15), 2.479 (2.14), 2.522 (3.92), 2.530 (1.59), 2.540 (1.20), 2.664 (0.73), 2.668 (1.00), 2.673 (0.73), 2.826 (0.81), 2.846 (1.56), 2.865 (2.02), 2.886 (2.64), 2.907 (1.18), 2.981 (1.51), 2.991 (1.63), 3.004 (1.66), 3.013 (1.54), 3.022 (1.06), 3.031 (1.03), 3.043 (0.98),
3.045 (0.86), 3.053 (0.85), 5.438 (0.98), 5.457 (2.92), 5.477 (2.92), 5.496 (0.98), 5.760 (3.15),
6.989 (1.51), 6.996 (1.79), 7.010 (2.34), 7.017 (3.09), 7.034 (1.79), 7.040 (2.06), 7.110 (2.99),
7.117 (2.92), 7.133 (3.15), 7.140 (2.94), 7.266 (3.14), 7.278 (3.24), 7.280 (2.97), 7.285 (2.67),
7.287 (2.92), 7.299 (2.74), 7.442 (3.14), 7.445 (3.14), 7.461 (4.93), 7.463 (5.48), 7.480 (4.58),
7.483 (4.66), 7.536 (4.22), 7.539 (4.27), 7.554 (3.67), 7.557 (5.21), 7.559 (4.93), 7.575 (3.29),
7.578 (3.15), 7.915 (4.76), 7.918 (4.93), 7.935 (4.60), 7.938 (4.50), 8.129 (4.60), 8.133 (4.93), 8.149 (4.65), 8.152 (4.56), 8.316 (16.00), 8.741 (4.51), 8.761 (4.45), 9.266 (15.59).
Intermediate 8
1-(1,3-benzothiazol-2-yl)-N-(6-fluoro-2,3-dihydro-1H-inden-l-yl)-1H-pyrazole-4<arboxamide
The compound of intermediate 2 (515 mg, 2.10 mmol) was provided in DMF (8 mL). N,N- Diisopropyl ethylamine (1.1 mL, 6.3 mmol), the compound of intermediate 6 (448 mg, 2.52 mmol) and propane phosphonic acid anhydride (T3P, 1.5 mL, 50% in DMF, 2.52 mmol) were added, and the mixture was stirred at room temperature for 3 days. After filtration, purification by HPLC (column: Chromatorex C18, mobile phase: acetonitrile/water + 0.5% formic acid) yielded 208 mg (26% of theory) of the title compound.
LC-MS (method 2): R, = 1.33 min; MS (ESIpos): m/z = 379 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.931 (0.89), 1.953 (2.49), 1.963 (1.21), 1.973 (2.60), 1.985 (2.79), 1.995 (1.19), 2.005 (2.79), 2.026 (1.07), 2.323 (0.89), 2.327 (1.28), 2.332 (0.92), 2.471 (1.24), 2.480 (1.94), 2.523 (7.73), 2.531 (3.69), 2.542 (1.79), 2.551 (1.43), 2.665 (0.89), 2.669 (1.26), 2.674 (0.87), 2.788 (0.72), 2.810 (1.32), 2.827 (1.75), 2.847 (2.32), 2.869 (1.09), 2.940 (1.56), 2.946 (1.45), 2.948 (1.68), 2.961 (1.70), 2.963 (1.53), 2.970 (1.64), 2.978 (1.15), 2.987 (1.09), 3.000 (1.02), 3.009 (0.92), 5.461 (1.13), 5.480 (3.43), 5.500 (3.45), 5.520 (1.15), 5.760 (5.84), 7.043 (7.33), 7.049 (2.83), 7.060 (3.26), 7.066 (8.88), 7.084 (2.75), 7.090 (1.60), 7.288 (2.34), 7.301 (2.58), 7.306 (2.58), 7.311 (2.43), 7.323 (2.17), 7.445 (3.32), 7.448 (3.15), 7.463 (5.13), 7.466 (5.94), 7.483 (5.24), 7.486 (5.13), 7.539 (4.67), 7.542 (4.77), 7.557 (3.94), 7.559 (5.54), 7.562 (5.48), 7.577 (3.60), 7.580 (3.45), 7.918 (5.09), 7.921 (5.67), 7.939 (5.18),
7.942 (4.75), 8.132 (4.88), 8.136 (5.28), 8.152 (4.99), 8.156 (4.96), 8.323 (15.98), 8.784 (4.79), 8.804 (4.69), 9.270 (0.55), 9.279 (16.00), 9.288 (0.55).
Intermediate 9
l-[3-methyl-5-(trifluoromethyl)phenyl]methanamine hydrochloride (1:1)
3-Methyl-5-(trifluoromethyl)benzonitrile (1.00 g, 5.40 mmol) was provided in THF (30 mL). A solution of borane - tetrahydrofuran complex (1:1) (27 mL, 1.0 M, 27 mmol) was added, and the resulting mixture was stirred at room temperature overnight. After concentration, a solution of hydrogen chloride in methanol (1%, 30 mL) was added, and the mixture was stirred at 50 °C overnight. After concentration, a solution of hydrogen chloride in methanol (1%, 20 mL) was added, and the mixture was stirred at room temperature for 10 minutes. This procedure was repeated two more times. After concentration, 988 mg of the title compound were obtained and used without further purification.
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.353 (1.48), 1.401 (0.46), 1.408 (2.00), 1.417 (2.73), 1.424 (7.32), 1.430 (2.86), 1.439 (2.15), 1.446 (0.64), 2.332 (0.57), 2.366 (0.89), 2.368 (0.84),
2.376 (1.26), 2.385 (2.31), 2.393 (16.00), 2.523 (0.49), 3.355 (0.50), 3.361 (2.20), 3.371 (2.52),
3.377 (6.67), 3.383 (2.57), 3.393 (2.36), 3.399 (0.63), 3.720 (0.44), 3.976 (10.25), 7.502 (2.92), 7.572 (3.02), 7.650 (2.88).
Intermediate 10
l-[3-chloro-5-(trifluoromethoxy)phenyl]methanamine hydrochloride (1:1)
3-Chloro-5-(trifluoromethoxy)benzonitrile (1.00 g, 4.51 mmol) was provided in THF (30 mL). A solution of borane - tetrahydrofuran complex (1:1) (23 mL, 1.0 M, 23 mmol) was added, and the resulting mixture was stirred at room temperature overnight. After concentration, a solution of hydrogen chloride in methanol (1%, 30 mL) was added, and the mixture was stirred at 50 °C overnight. After concentration, a solution of hydrogen chloride in methanol (1%, 20 mL) was added, and the mixture was stirred at room temperature for 10 minutes. This procedure was repeated two more times. After concentration, 1.08 g of the title compound were obtained and used without further purification.
1H-NMR (400 MHz, DMSO-dg) δ [ppm]: 0.869 (0.59), 1.353 (3.04), 1.408 (1.27), 1.417 (1.71), 1.424 (4.67), 1.430 (1.82), 1.439 (1.46), 1.446 (0.48), 2.523 (1.15), 3.165 (0.55), 3.310 (0.67), 3.327 (1.03), 3.343 (0.72), 3.350 (0.52), 3.355 (0.65), 3.362 (1.71), 3.371 (1.82), 3.378 (4.17), 3.384 (1.84), 3.393 (1.71), 3.400 (0.68), 3.410 (0.43), 3.726 (1.39), 3.943 (16.00), 7.386 (0.45), 7.464 (2.30), 7.469 (4.16), 7.472 (4.18), 7.487 (3.78), 7.600 (3.41), 7.605 (5.06), 7.608 (3.19).
Examples Example 1
1-(1,3-benzothiazol-2- l)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (1.50 g, 6.12 mmol) was provided in DMF (18 mL). (lR)-2,3- Dihydro-1H-inden-l-amine (1.22 g, 9.17 mmol), (benzotriazol-l-yloxy)tripyrrolidinophos- phonium hexafluorophosphate (PYBOP, 4.77 g, 9.17 mmol) and diisopropylethylamine (3.2 mL, 18.3 mmol) were added, and the resulting mixture was stirred at room temperature overnight. After concentration, the remaining material was triturated with ethanol and water and stirred for 30 minutes. The precipitate was collected by filtration and dried under reduced pressure to give 2.19 g (99% of theory) of the title compound.
LC-MS (method 2): Rt = 1.30 min; MS (ESIpos): m/z = 361 [M+H]
1H-NMR (400 MHz, DMSO-d e) δ [ppm]: 1.887 (0.81), 1.908 (2.29), 1 919 (1.09), 1 928 (2 32),
1 940 (2.53), 1.950 (1.09), 1 960 (2.56), 1.981 (1.03), 2.322 (0.58), 2 326 (0.84), 2 332 (0 61),
2 439 (0.86), 2.447 (0.96), 2 458 (1.94), 2.467 (2.42), 2.470 (1.83), 2 479 (2.84), 2 523 (2 36),
2 664 (0.68), 2.669 (0.98), 2 673 (0.69), 2.728 (0.47), 2.822 (0.89), 2 843 (1.73), 2 862 (2 17),
2 883 (2.91), 2.888 (1.36), 2 903 (1.29), 2.976 (1.67), 2.985 (1.85), 2 998 (1.85), 3 007 (1 73),
3 015 (1.21), 3.024 (1.17), 3 037 (1.11), 3.046 (0.96), 5.487 (1.18), 5 507 (3.55), 5 527 (3 56),
5 547 (1.17), 7.181 (0.95), 7 185 (1.15), 7.199 (3.00), 7.203 (3.72), 7 216 (3.87), 7 221 (5 69),
7 226 (3.75), 7.239 (3.63), 7 244 (5.14), 7.257 (2.79), 7.262 (6.20), 7 266 (5.32), 7 283 (8 61),
7 301 (2.78), 7.442 (2.95), 7 445 (3.04), 7.460 (4.74), 7.463 (5.42), 7 480 (4.33), 7 483 (4 43),
7 535 (3.87), 7.539 (3.96), 7 553 (3.41), 7.556 (5.26), 7.559 (4.49), 7 573 (3.03), 7 577 (2 91),
7 914 (4.82), 7.917 (5.01), 7 934 (4.57), 7.938 (4.52), 8.129 (4.65), 8 133 (4.99), 8 149 (4 33),
8 153 (4.48), 8.325 ( 16.00), 8 753 (4.49), 8.774 (4.33), 9.270 ( 15.56).
Example 2
1-(1,3-benzothiazol-2-yl)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4- carboxamide
The compound of example 1 (95.6 mg, 265 μmοΙ) was provided in DMF (1.4 mL). Sodium hydride (13.8 mg, 60% in mineral oil, 345 μmοΙ) was added, and the mixture was stirred at room temperature for 1 h. lodomethane (25 μL, 400 μmοΙ) was added at 0 °C, and the mixture was stirred at room temperature for 3 h. Ethanol and water were added, the mixture was stirred for 15 minutes and the precipitate was collected by filtration and dried under reduced pressure to yield 57.3 mg (55% of theory) of the title compound.
LC-MS (method 2): R, = 1.39 min; MS (ESIpos): m/z = 375 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.804 (1.01), 0.823 (1.30), 0.831 (1.45), 0.847 (1.41), 0.851 (1.99), 0.868 (0.69), 1.054 (0.58), 1.071 (0.43), 1.231 (5.61), 1.986 (1.05), 2.019 (1.52), 2.039 (1.30), 2.084 (0.69), 2.096 (0.80), 2.125 (0.98), 2.151 (0.76), 2.318 (0.69), 2.322 (1.63), 2.327 (2.32), 2.331 (1.92), 2.337 (1.19), 2.366 (1.59), 2.395 (2.17), 2.523 (13.18), 2.659 (7.60), 2.664 (9.30), 2.669 (7.75), 2.673 (5.25), 2.678 (3.08), 2.729 (1.23), 2.819 (1.01), 2.837 (1.45),
2.857 (2.46), 2.889 (16.00), 2.921 (2.39), 2.943 (1.56), 2.993 (2.17), 3.018 (2.06), 3.058 (0.87), 3.863 (0.69), 5.671 (0.87), 5.691 (1.52), 5.713 (0.87), 6.166 (1.30), 6.186 (2.46), 6.208 (1.34), 7.248 (12.60), 7.266 (10.71), 7.274 (12.05), 7.299 (7.24), 7.317 (2.82), 7.445 (2.39), 7.464 (4.60), 7.483 (2.93), 7.485 (2.71), 7.541 (3.22), 7.543 (3.48), 7.562 (4.13), 7.581 (1.77), 7.937 (6.81), 7.957 (6.37), 8.118 (2.06), 8.135 (4.71), 8.153 (3.62), 8.215 (2.64), 8.294 (4.49), 8.873 (2.68), 9.067 (4.67).
Example 3
1-(1,3-benzothiazol-2-yl)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-N-ethyl-1H-pyrazole-4- carboxamide
The compound of example 1 (150 mg, 416 μmοΙ) was provided in DMF (3.4 mL). Sodium hydride (25.0 mg, 60 % in mineral oil, 624 μmοΙ) was added, and the mixture was stirred at room temperature for 1 h. lodoethane (60 μL, 750 μmοΙ) was added at 0 °C, and the mixture was stirred at room temperature for 3 h. Sodium hydride (10.0 mg, 60 % in mineral oil, 250 μmοΙ) and iodoethane (33 μL, 416 μmοΙ) were added, and the mixture was stirred at room temperature for 3 h. After concentration, the remaining material was dissolved in DMF. After filtration, purification by HPLC (column: chromatorex C18, mobile phase: acetonitrile/water + 0.1% formic acid) yielded 50.3 mg (30% of theory) of the title compound.
LC-MS (method 2): R, = 1.44 min; MS (ESIpos): m/z = 389 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.982 (2.48), 0.998 (2.91), 1.078 (6.04), 1.229 (0.57), 1.302 (1.04), 1.319 (2.35), 1.337 (1.04), 2.061 (0.65), 2.083 (2.09), 2.094 (1.39), 2.105 (2.57), 2.116 (2.78), 2.126 (1.61), 2.137 (2.65), 2.159 (1.09), 2.318 (0.74), 2.322 (1.74), 2.327 (2.57), 2.332 (1.91), 2.337 (0.87), 2.430 (1.78), 2.442 (2.13), 2.469 (1.57), 2.523 (14.17), 2.539 (3.83), 2.660 (0.78), 2.665 (1.83), 2.669 (2.65), 2.673 (1.96), 2.679 (0.87), 2.728 (9.22), 2.781 (0.57), 2.802 (1.04), 2.821 (1.52), 2.842 (1.91), 2.888 (13.91), 2.954 (1.74), 2.977 (2.65), 3.016 (2.35), 4.290 (0.91), 4.307 (0.91), 5.666 (1.52), 7.197 (0.48), 7.244 (4.39), 7.245 (4.78), 7.266 (8.74), 7.278 (9.26), 7.285 (16.00), 7.301 (6.91), 7.308 (4.26), 7.435 (2.91), 7.454 (6.70), 7.471 (4.57), 7.473 (4.65), 7.503 (0.52), 7.506 (0.48), 7.527 (3.39), 7.546 (5.52), 7.565 (2.91), 7.581 (0.61),
7.930 (5.52), 7.950 (6.78), 7.967 (0.96), 7.984 (0.48), 7.986 (0.48), 8.121 (6.30), 8.141 (6.04), 8.154 (1.00), 8.172 (0.52), 8.175 (0.43), 8.222 (6.52), 8.346 (0.83), 8.849 (2.26), 9.082 (0.83).
Example 4
1-(1,3-benzothiazol-2-yl)-N-(6-fluoro-2,3-dihydro-1H-inden-l-yl)-N-methyl-1H-pyrazole-4- carboxamide
The compound of intermediate 8 (175 mg, 462 μmοΙ) was provided in DMF (2 mL). Sodium hydride (24.0 mg, 60% in mineral oil, 601 μmοΙ) was added, and the mixture was stirred at room temperature for 30 minutes, lodomethane (43 μL, 694 μmοΙ) was added, and the mixture was stirred at room temperature overnight. Water was added, the mixture was stirred for 15 minutes, and the precipitate was collected by filtration and dried under reduced pressure to yield 139 mg (69% of theory) of the title compound.
LC-MS (method 2): R, = 1.39 min; MS (ESIpos): m/z = 393 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.827 (0.45), 0.843 (0.46), 0.847 (0.55), 1.225 (1.53), 2.023 (0.51), 2.045 (0.65), 2.055 (0.72), 2.078 (0.64), 2.327 (0.50), 2.390 (0.97), 2.404 (1.09), 2.420 (1.07), 2.442 (0.66), 2.523 (1.50), 2.659 (0.84), 2.665 (1.49), 2.669 (2.31), 2.674 (3.20), 2.676 (3.24), 2.678 (3.08), 2.713 (0.41), 2.728 (11.70), 2.780 (0.44), 2.800 (0.54), 2.813 (0.60), 2.835 (0.71), 2.854 (0.86), 2.876 (1.32), 2.888 (16.00), 2.912 (7.92), 2.951 (1.09), 2.973 (0.93), 3.313 (0.41), 5.673 (0.58), 6.121 (0.65), 6.144 (1.21), 6.166 (0.59), 7.061 (1.06), 7.063 (1.08), 7.084 (2.24), 7.105 (2.31), 7.107 (2.22), 7.124 (1.21), 7.127 (1.18), 7.177 (0.60), 7.199 (0.53), 7.296 (1.68), 7.310 (1.82), 7.312 (1.77), 7.331 (0.91), 7.448 (1.26), 7.466 (2.11), 7.485 (1.27), 7.543 (1.57), 7.563 (1.93), 7.582 (0.80), 7.938 (4.22), 7.950 (2.57), 7.957 (3.96), 8.118 (0.77), 8.136 (2.28), 8.156 (1.64), 8.209 (1.03), 8.292 (2.50), 8.901 (1.05), 9.119 (2.56).
Example 5
1-(1,3-benzothiazol-2-yl)-N-[(lR)-6-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole- 4-carboxamide, or
1-(1,3-benzothiazol-2-yl)-N-[(lS)-6-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole- 4-carboxamide
or
The racemate of the compound of example 4 (115 mg) was separated by chiral chromatography (instrument: Labomatic HD5000, Labocord-5000; Gilson GX-241, Labcol Vario 4000, column: Chiralpak IA 5μ 250x30mm; eluent A: acetonitrile + 0.1 vol% diethylamine (99%); eluent B: ethanol; 50% A + 50% B; 50.0 mL/min; UV 280 nm) to yield 49.0 mg of the title compound.
LC-MS (instrument: Agilent HPLC 1260; column: Chiralpak IA 3μ 100x4.6mm; eluent A: acetonitrile + 0.1 vol% diethylamine (99%); eluent B: ethanol; 50% A + 50% B; 1.0 mL/min; temperature: 25 °C; DAD 280 nm): Rt = 1.99 min; ee value: 100%
LC-MS (method 2): Rt = 1.38 min; MS (ESIpos): m/z = 393 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.966 (0.72), 1.106 (16.00), 1.143 (0.46), 1.208 (0.55), 1.230 (1.14), 2.023 (0.68), 2.055 (0.97), 2.078 (0.84), 2.101 (0.46), 2.126 (0.38), 2.157 (0.51), 2.318 (0.80), 2.322 (1.94), 2.326 (2.70), 2.332 (1.94), 2.336 (0.93), 2.366 (0.42), 2.390 (1.18), 2.420 (1.27), 2.443 (0.72), 2.522 (12.50), 2.660 (1.56), 2.664 (3.04), 2.668 (4.64), 2.673 (5.49), 2.678 (4.94), 2.782 (0.51), 2.801 (0.63), 2.819 (0.76), 2.838 (0.84), 2.857 (1.01), 2.877 (1.39), 2.912 (10.72), 2.952 (1.39), 2.975 (1.22), 3.016 (0.46), 4.193 (1.44), 5.650 (0.42), 5.672 (0.76), 5.692 (0.46), 6.122 (0.84), 6.142 (1.60), 6.164 (0.84), 7.063 (1.31), 7.065 (1.35), 7.085 (2.87), 7.107 (3.00), 7.109 (2.91), 7.128 (1.60), 7.180 (0.80), 7.203 (0.68), 7.299 (2.11), 7.313 (2.36), 7.315 (2.24), 7.334 (1.14), 7.450 (1.60), 7.468 (2.74), 7.487 (1.65), 7.544 (1.98), 7.566 (2.49), 7.583 (1.10), 7.940 (5.53), 7.959 (4.94), 8.121 (0.97), 8.140 (3.00), 8.158 (2.20), 8.209 (1.44), 8.293 (3.46), 8.903 (1.44), 9.123 (3.50).
Example 6
1-(1,3-benzothiazol-2-yl)-N-(5-fluoro-2,3-dihydro-1H-inden-l-yl)-N-methyl-1H-pyrazole-4- carboxamide
The compound of intermediate 7 (205 mg, 542 μmοΙ) was provided in DMF (2 mL). Sodium hydride (28.2 mg, 60% in mineral oil, 704 μmοΙ) was added, and the mixture was stirred at room temperature for 30 minutes, lodomethane (51 μL, 810 μmοΙ) was added, and the mixture was stirred at room temperature overnight. Water was added, the mixture was stirred for 15 minutes and the precipitate was collected by filtration, washed with water and dried under reduced pressure to yield 192 mg (86% of theory) of the title compound.
LC-MS (method 2): R, = 1.39 min; MS (ESIpos): m/z = 393 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.771 (0.49), 0.796 (0.69), 0.812 (0.72), 0.823 (0.78), 0.844 (0.92), 0.860 (0.43), 1.171 (1.05), 1.219 (2.42), 1.998 (0.40), 2.019 (1.01), 2.051 (1.52), 2.074 (1.34), 2.095 (0.81), 2.121 (0.78), 2.154 (0.96), 2.177 (0.72), 2.322 (0.47), 2.327 (0.61), 2.331 (0.49), 2.366 (0.63), 2.394 (1.88), 2.423 (2.42), 2.448 (1.84), 2.523 (2.85), 2.652 (7.60), 2.669 (2.71), 2.674 (1.88), 2.727 (1.55), 2.786 (0.54), 2.807 (0.90), 2.828 (1.37), 2.850 (2.35), 2.882 (16.00), 2.886 (14.50), 2.917 (2.31), 2.939 (1.66), 2.991 (2.22), 3.015 (2.06), 3.056 (0.85), 5.635 (0.81), 5.656 (1.43), 5.659 (1.41), 5.678 (0.83), 6.116 (1.39), 6.136 (2.44), 6.155 (1.39), 6.157 (1.30), 7.030 (1.48), 7.054 (3.68), 7.075 (2.89), 7.118 (4.75), 7.141 (4.64), 7.245 (1.79), 7.259 (2.62), 7.262 (2.69), 7.279 (2.42), 7.309 (1.68), 7.325 (0.94), 7.440 (2.31), 7.441 (2.51), 7.460 (4.97), 7.481 (3.07), 7.538 (3.32), 7.557 (4.41), 7.577 (1.95), 7.934 (7.80), 7.954 (7.19), 8.130 (4.84), 8.149 (3.92), 8.207 (2.55), 8.284 (4.86), 8.878 (2.58), 9.066 (4.95).
Example 7
1-(1,3-benzothiazol-2-yl)-N-[(lR)-5-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole- 4-carboxamide, or
1-(1,3-benzothiazol-2-yl)-N-[(lS)-5-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole- 4-carboxamide,
The racemate of the compound of example 6 (140 mg) was separated by chiral chromatography (instrument: Labomatic HD5000, Labocord-5000; Gilson GX-241, Labcol Vario 4000, column: Chiralpak IA 5μ 250x30mm; eluent A: acetonitrile + 0.1 vol% diethylamine (99%); eluent B: ethanol; 50% A + 50% B; 50.0 mL/min; UV 280 nm) to yield 60.0 mg of the title compound.
LC-MS (instrument: Agilent HPLC 1260; column: Chiralpak IA 3μ 100x4.6mm; eluent A: acetonitrile + 0.1 vol% diethylamine (99%); eluent B: ethanol; 50% A + 50% B; 1.0 mL/min; temperature: 25 °C; DAD 280 nm): Rt = 2.40 min; ee value: 100%
LC-MS (method 2): R, = 1.38 min; MS (ESIpos): m/z = 393 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.106 (6.58), 1.228 (1.35), 2.021 (0.96), 2.054 (1.42),
2.083 (6.58), 2.125 (0.74), 2.153 (0.88), 2.178 (0.71), 2.317 (0.64), 2.322 (1.56), 2.326 (2.23), 2.332 (1.63), 2.336 (0.81), 2.393 (1.49), 2.428 (2.12), 2.450 (1.70), 2.522 (9.81), 2.541 (0.64),
2.653 (7.36), 2.659 (6.30), 2.664 (4.99), 2.668 (4.46), 2.673 (3.08), 2.678 (1.84), 2.810 (0.74), 2.832 (1.17), 2.853 (2.02), 2.884 (16.00), 2.921 (2.05), 2.943 (1.49), 2.995 (1.98), 3.018 (1.88),
3.059 (0.74), 3.320 (0.57), 4.193 (0.57), 5.637 (0.78), 5.658 (1.38), 5.678 (0.81), 5.760 (0.78),
6.115 (1.20), 6.134 (2.27), 6.136 (2.34), 6.157 (1.27), 7.033 (1.31), 7.055 (3.29), 7.057 (3.36), 7.077 (2.80), 7.122 (4.32), 7.147 (4.42), 7.246 (1.52), 7.265 (2.48), 7.283 (2.12), 7.314 (1.49),
7.332 (0.81), 7.444 (2.02), 7.446 (2.34), 7.464 (4.60), 7.483 (2.97), 7.543 (3.15), 7.561 (4.11),
7.563 (3.93), 7.582 (1.63), 7.938 (8.07), 7.958 (7.33), 8.137 (4.57), 8.156 (3.61), 8.209 (2.55), 8.288 (4.96), 8.882 (2.58), 9.072 (5.06).
Example 8
The compound of example 22 (90.0 mg, 234 μmοΙ) was provided in DMF (1.2 mL). Sodium hydride (14 mg, 60% in mineral oil, 351 μmοΙ) was added, and the mixture was stirred at room temperature for 1 h. lodomethane (29 μL, 470 μmοΙ) was added at 0 °C, and the mixture was stirred at room temperature for 2 h. lodomethane (11 μL, 176 μmοΙ) was added, and the mixture was stirred at room temperature overnight. Water was added, the mixture was stirred for 15 minutes and the precipitate was collected by filtration and dried under reduced pressure to yield 80.5 mg (81% of theory) of the title compound.
LC-MS (method 2): Rt = 1.34 min; MS (ESIpos): m/z = 399 [M+H]+
2H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.806 (0.61), 0.833 (1.04), 0.851 (1.60), 0.868 (0.66), 1.231 (4.39), 2.182 (1.98), 2.282 (0.61), 2.318 (0.85), 2.322 (1.98), 2.327 (2.88), 2.331 (2.12), 2.336 (0.99), 2.523 (16.00), 2.659 (0.90), 2.664 (2.03), 2.669 (2.97), 2.673 (2.17), 2.678 (1.09), 2.729 (1.46), 2.889 (2.41), 2.959 (1.98), 3.157 (1.42), 3.203 (16.00), 3.837 (2.93), 4.870 (10.71), 7.141 (1.51), 7.276 (2.97), 7.396 (5.95), 7.417 (7.98), 7.447 (5.52), 7.467 (12.08), 7.486 (8.92), 7.543 (5.90), 7.545 (6.14), 7.563 (8.92), 7.580 (5.33), 7.582 (5.00), 7.634 (10.24), 7.652 (8.45), 7.943 (4.63), 7.965 (4.01), 8.135 (5.43), 8.137 (5.43), 8.156 (4.72), 8.286 (5.10), 8.358 (0.61), 9.082 (5.24), 9.102 (1.51).
Example 9
1-(1,3-benzothiazo -2-yl)-N-[4-chloro-3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (200 mg, 815 μmοΙ) was provided in DMF (5 mL). l-[4-Chloro- 3-(trifluoromethyl)phenyl]methanamine (150 μL, 980 μηιοΙ), HATU (465 mg, 1.22 mmol) and triethylamine (510 μL, 3.7 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried
over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 161 mg (45% of theory) of the title compound.
1H-NM (300 MHz, DMSO-d5) δ [ppm]: 1.229 (1.85), 2.270 (0.77), 2.275 (0.62), 2.726 (0.89), 2.732 (0.91), 3.160 (0.46), 4.531 (10.38), 4.551 (10.45), 5.750 (0.43), 7.441 (2.73), 7.444 (2.90), 7.465 (5.39), 7.469 (5.74), 7.491 (4.57), 7.496 (4.48), 7.537 (3.94), 7.542 (4.37), 7.565 (5.79), 7.569 (5.37), 7.589 (3.14), 7.593 (3.07), 7.638 (2.56), 7.641 (2.53), 7.666 (6.12), 7.671 (6.65), 7.673 (6.60), 7.700 (10.24), 7.728 (3.87), 7.790 (0.47), 7.826 (8.16), 7.829 (7.94), 7.833 (7.80), 7.865 (0.50), 7.932 (5.36), 7.935 (6.46), 7.959 (5.41), 7.963 (4.78), 8.125 (5.04), 8.130 (5.78), 8.152 (4.83), 8.157 (4.92), 8.292 (16.00), 9.040 (2.24), 9.060 (4.78), 9.082 (2.23), 9.228 (15.89).
Example 10
1-(1,3-benzothiazol- -yl)-N-(3,5-dichlorobenzyl)-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (100 mg, 408 μmοΙ) was provided in DMF (2.5 mL). l-(3,5- Dichlorophenyl)methanamine (65 μL, 490 μmοΙ), HATU (186 mg, 489 μmοΙ) and triethylamine (260 μL, 1.8 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 137 mg (83% of theory) of the title compound.
LC-MS (method 2): Rt = 1.42 min; MS (ESIpos): m/z = 403 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.173 (0.58), 1.986 (0.93), 2.322 (0.54), 2.327 (0.78), 2.331 (0.58), 2.523 (2.80), 2.664 (0.58), 2.669 (0.82), 2.674 (0.58), 2.943 (0.43), 4.472 (7.92), 4.487 (7.96), 7.394 (16.00), 7.399 (15.46), 7.449 (2.60), 7.452 (2.76), 7.467 (4.31), 7.470 (4.62), 7.487 (4.12), 7.490 (3.73), 7.502 (4.85), 7.506 (8.19), 7.511 (4.27), 7.545 (3.65), 7.548 (3.57), 7.563 (3.34), 7.566 (4.58), 7.569 (3.77), 7.576 (0.43), 7.584 (2.87), 7.587 (2.60), 7.938 (4.31),
7.942 (4.00), 7.959 (4.00), 7.962 (3.65), 8.130 (4.31), 8.134 (4.12), 8.150 (4.00), 8.154 (3.73), 8.297 (12.43), 9.015 (1.75), 9.030 (3.65), 9.045 (1.71), 9.238 (12.00).
Example 11
1-(1,3-benzothiazol- -yl)-N-(3,4-dichlorobenzyl)-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (100 mg, 408 μmοΙ) was provided in DMF (2.5 mL). l-(3,4- Dichlorophenyl)methanamine (65 μL, 490 μmοΙ), HATU (186 mg, 489 μmοΙ) and triethylamine (260 μL, 1.8 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 117 mg (66% of theory) of the title compound.
LC-MS (method 2): Rt = 1.39 min; MS (ESIpos): m/z = 403 [M+H]+
1H-NMR (300 MHz, DMSO-d5) δ [ppm]: 2.270 (0.64), 2.720 (0.54), 2.732 (0.93), 2.889 (0.79), 2.932 (1.97), 3.079 (1.87), 4.459 (8.62), 4.478 (8.76), 4.871 (0.51), 7.322 (3.37), 7.329 (3.60), 7.349 (3.84), 7.356 (4.38), 7.440 (1.85), 7.444 (2.16), 7.464 (4.04), 7.468 (4.73), 7.491 (3.67), 7.495 (3.72), 7.537 (2.78), 7.542 (3.27), 7.565 (4.50), 7.569 (4.29), 7.596 (16.00), 7.602 (8.81), 7.625 (7.12), 7.937 (4.77), 7.959 (4.31), 8.125 (4.35), 8.130 (4.99), 8.151 (3.81), 8.157 (4.18), 8.293 (13.17), 9.001 (1.87), 9.022 (3.87), 9.041 (1.90), 9.158 (0.47), 9.231 (13.20).
Example 12
1-(1,3-benzothiazol-2-yl)-N-[2-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (100 mg, 408 μmοΙ) was provided in DMF (2.5 mL). l-[2- (Trifluoromethoxy)phenyl]methanamine (62 μL, 410 μmοΙ), HATU (155 mg, 408 μmοΙ) and triethylamine (230 μL, 1.6 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 126 mg (74% of theory) of the title compound.
LC-MS (method 2): Rt = 1.37 min; MS (ESIpos): m/z = 419 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.322 (0.72), 2.327 (0.98), 2.331 (0.76), 2.523 (3.13), 2.664 (0.70), 2.669 (0.98), 2.674 (0.74), 2.730 (3.81), 2.890 (5.09), 4.533 (10.37), 4.548 (10.59), 7.359 (0.54), 7.363 (1.66), 7.368 (2.23), 7.378 (2.17), 7.382 (5.07), 7.387 (4.93), 7.389 (3.63), 7.391 (4.01), 7.396 (6.86), 7.401 (3.91), 7.413 (11.63), 7.420 (8.80), 7.433 (3.31), 7.439 (3.75), 7.449 (2.91), 7.452 (4.07), 7.457 (1.16), 7.468 (5.05), 7.470 (5.75), 7.487 (4.75), 7.490 (4.81), 7.497 (5.07), 7.503 (4.47), 7.514 (2.93), 7.516 (3.21), 7.520 (2.99), 7.545 (4.15), 7.548 (4.19), 7.563 (3.85), 7.565 (5.51), 7.568 (4.25), 7.583 (3.25), 7.586 (3.03), 7.934 (5.09), 7.937 (5.73), 7.955 (5.39), 7.958 (4.73), 8.132 (4.97), 8.136 (5.23), 8.152 (4.69), 8.156 (4.73), 8.303 (15.86), 8.951 (2.19), 8.965 (4.53), 8.980 (2.17), 9.258 (16.00).
Example 13
1-(1,3-benzothiazol-2- l)-N-(naphthalen-l-ylmethyl)-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (100 mg, 408 μmοΙ) was provided in DMF (2.5 mL). 1- (Naphthalen-l-yl)methanamine (60 μL, 410 μmοΙ), HATU (155 mg, 408 μmοΙ) and triethylamine (230 μL, 1.6 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with
dichloromethane and methanol. The precipitate was collected by filtration and dried to give 84 mg (54% of theory) of the title compound.
LC-MS (method 2): Rt = 1.35 min; MS (ESIpos): m/z = 385 [M+H]+
!H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.174 (0.49), 1.987 (0.90), 2.322 (0.54), 2.326 (0.75), 2.331 (0.56), 2.523 (2.45), 2.664 (0.54), 2.669 (0.75), 2.674 (0.54), 4.938 (9.51), 4.952 (9.71), 5.752 (1.20), 7.437 (2.51), 7.441 (2.81), 7.456 (4.62), 7.459 (5.41), 7.476 (4.27), 7.479 (4.34), 7.483 (3.31), 7.501 (6.87), 7.521 (7.69), 7.531 (9.81), 7.535 (9.92), 7.545 (5.30), 7.549 (9.88), 7.551 (10.12), 7.555 (6.81), 7.565 (6.98), 7.569 (8.74), 7.587 (4.25), 7.591 (4.42), 7.604 (2.10), 7.608 (1.72), 7.870 (3.87), 7.872 (4.53), 7.874 (4.12), 7.889 (3.52), 7.892 (4.19), 7.911 (5.80), 7.929 (4.88), 7.932 (4.70), 7.956 (4.49), 7.960 (5.11), 7.974 (3.03), 7.980 (4.06), 8.120 (4.70), 8.124 (5.09), 8.141 (4.66), 8.144 (4.75), 8.154 (4.66), 8.157 (4.06), 8.174 (4.14), 8.178 (3.61), 8.321 (16.00), 8.965 (2.06), 8.979 (4.25), 8.992 (2.08), 9.264 (15.70).
Example 14
1-(1,3-benzothiazol-2-yl)-N-(2-chlorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (75.0 mg, 306 μmοΙ) was provided in DMF (2 mL). l-(2- Chlorophenyl)-N-methylmethanamine (51 μL, 370 μmοΙ), HATU (174 mg, 459 μmοΙ) and triethylamine (190 μL, 1.4 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 104 mg (88% of theory) of the title compound.
LC-MS (method 2): Rt = 1.41 min; MS (ESIpos): m/z = 383 [M+H]+
1H-NMR (300 MHz, DMSO-d5) δ [ppm]: 1.226 (0.47), 2.109 (0.52), 2.270 (1.14), 2.525 (7.47), 2.643 (0.47), 2.726 (1.25), 2.878 (0.49), 2.936 (2.26), 2.980 (1.27), 3.257 (12.70), 3.399 (0.86), 4.766 (9.26), 5.757 (1.38), 7.355 (16.00), 7.359 (15.14), 7.440 (3.02), 7.466 (5.72), 7.489 (9.63),
7.506 (4.32), 7.514 (4.94), 7.521 (4.58), 7.539 (3.51), 7.564 (4.55), 7.588 (2.08), 7.942 (3.98), 7.968 (3.07), 8.133 (4.60), 8.160 (3.95), 8.289 (4.01), 9.100 (4.24).
Example 15
ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-benzylglycinate
The compound of intermediate 2 (100 mg, 408 μmοΙ) was provided in DMF (3 mL). Ethyl N- benzylglycinate (92 μL, 490 μmοΙ), HATU (155 mg, 408 μηιοΙ) and triethylamine (230 μL, 1.6 mmol) were added, and the resulting mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water, extracted with ethyl acetate, washed with brine, dried over sodium sulfate, and was filtered and concentrated. The remaining material was triturated with dichloromethane and methanol. The precipitate was collected by filtration and dried to give 154 mg (88% of theory) of the title compound.
LC-MS (method 2): Rt = 1.37 min; MS (ESIpos): m/z = 421 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.179 (1.22), 1.196 (2.45), 1.211 (1.39), 1.215 (1.28), 1.229 (0.44), 2.522 (0.54), 3.023 (12.20), 3.026 (16.00), 3.310 (0.70), 3.742 (0.60), 4.101 (0.49), 4.107 (0.43), 4.119 (1.35), 4.126 (0.49), 4.137 (1.34), 4.154 (0.48), 4.225 (0.81), 4.812 (0.95), 7.301 (0.62), 7.309 (0.63), 7.314 (0.88), 7.326 (0.42), 7.341 (0.56), 7.357 (1.68), 7.368 (1.31), 7.374 (0.43), 7.385 (0.84), 7.389 (0.45), 7.451 (0.60), 7.453 (0.61), 7.471 (0.49), 7.527 (0.42), 7.548 (0.62), 7.551 (0.43), 7.910 (0.62), 7.930 (0.55), 8.081 (1.83), 8.100 (0.61), 8.768 (0.71).
Example 16
The compound of intermediate 2 (150 mg, 587 μmοΙ) was provided in DMF (1.9 mL). l-(3- Chloro-5-fluorophenyl)methanamine (145 mg, 881 μmοΙ), (benzotriazol-l-yloxy) tripyrrolidino phosphonium hexafluorophosphate (PYBOP, 458 mg, 881 μmοΙ) and diisopropylethylamine (310 μL, 1.8 mmol) were added, and the resulting mixture was stirred at room temperature overnight. After concentration, the remaining material was triturated with water. The precipitate was collected by filtration and dried to give 166 mg (73% of theory) of the title compound.
LC-MS (method 2): R, = 1.33 min; MS (ESIpos): m/z = 387 [M+H]+
2H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.323 (1.07), 2.327 (1.46), 2.331 (1.04), 2.337 (0.48), 2.523 (10.13), 2.531 (5.00), 2.659 (0.50), 2.665 (1.11), 2.669 (1.50), 2.674 (1.07), 2.678 (0.50), 2.729 (0.80), 2.888 (1.09), 3.359 (0.72), 4.481 (10.54), 4.495 (10.67), 7.170 (2.52), 7.177 (3.65), 7.181 (2.91), 7.195 (2.78), 7.198 (3.65), 7.200 (3.59), 7.205 (2.80), 7.273 (4.85), 7.278 (8.59), 7.282 (5.30), 7.319 (2.93), 7.325 (4.20), 7.330 (2.54), 7.341 (3.00), 7.346 (4.20), 7.352 (2.52), 7.451 (3.46), 7.454 (3.24), 7.469 (5.67), 7.472 (6.26), 7.489 (5.22), 7.492 (5.09), 7.547 (4.54), 7.550 (4.74), 7.566 (4.39), 7.568 (6.17), 7.571 (5.50), 7.586 (3.59), 7.589 (3.35), 7.940 (5.54), 7.943 (6.28), 7.961 (5.39), 7.964 (4.93), 8.137 (5.24), 8.141 (5.30), 8.157 (5.04), 8.161 (5.00), 8.304 (15.57), 8.315 (0.48), 9.037 (2.41), 9.052 (5.07), 9.067 (2.43), 9.252 (16.00).
Example 17
1-(1,3-benzothiazol- -yl)-N-[3-chloro-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide
1-(1,3-Benzothiazol-2-yl)-1H-pyrazole-4-carboxylic acid (intermediate 2) (60.0 mg, 245 μmοΙ) and l-[3-chloro-5-(trifluoromethyl)phenyl]methanamine (61.5 mg, 294 μmοΙ) were added to
anhydrous DMF (2 mL). N-ethyl-N-isopropylpropan-2-amine (190 μL, 1.1 mmol) and propane phosphonic acid anhydride (T3P, 210 μL, 50% in DMF, 370 μmοΙ) were added, and the mixture was stirred at room temperature overnight. The reaction mixture was concentrated and purified by HPLC (method 3) affording 60 mg (56% of theory) of the title compound.
LC-MS (method 4): , = 1.42 min; MS (ESIpos): m/z = 437 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.075 (1.93), 2.318 (0.64), 2.322 (1.50), 2.326 (2.07), 2.332 (1.54), 2.336 (0.71), 2.522 (9.11), 2.660 (0.64), 2.664 (1.50), 2.668 (2.07), 2.673 (1.54), 2.678 (0.68), 4.561 (9.79), 4.575 (9.96), 7.450 (3.25), 7.454 (3.71), 7.469 (5.46), 7.472 (6.25), 7.489 (5.54), 7.492 (5.11), 7.547 (4.93), 7.550 (5.21), 7.565 (4.21), 7.567 (6.14), 7.570 (5.82), 7.585 (3.75), 7.589 (3.68), 7.696 (7.89), 7.734 (4.14), 7.739 (8.00), 7.743 (4.89), 7.773 (4.43), 7.778 (7.39), 7.784 (3.43), 7.940 (5.21), 7.943 (7.29), 7.960 (5.07), 7.964 (4.96), 8.136 (5.43), 8.140 (5.43), 8.157 (4.86), 8.161 (4.93), 8.305 (16.00), 9.081 (2.32), 9.096 (5.04), 9.111 (2.39), 9.252 (16.00).
Example 18
1-(1,3-benzothiazol-2-yl)-N-[5-fluoro-2-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (150 mg, 612 μmοΙ) was provided in DMF (2.3 mL). N,N- Diisopropylethylamine (320 μL, 1.8 mmol), l-[5-fluoro-2-(trifluoromethoxy)phenyl]methan- amine (153 mg, 734 μmοΙ) and propane phosphonic acid anhydride (T3P, 430 μL, 50% in DMF, 730 μmοΙ) were added, and the mixture was stirred at room temperature for 3 days. After filtration, purification by HPLC (column: Chromatorex C18, mobile phase: acetonitrile/water + 0.1% formic acid) yielded 180 mg (67% of theory) of the title compound.
:H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.083 (0.41), 2.317 (0.44), 2.322 (1.07), 2.326 (1.45), 2.331 (1.04), 2.336 (0.51), 2.523 (4.07), 2.659 (0.44), 2.664 (1.04), 2.669 (1.48), 2.674 (1.02), 2.678 (0.46), 3.305 (0.44), 4.517 (9.41), 4.532 (9.45), 7.255 (1.62), 7.264 (2.30), 7.278 (2.40),
7.284 (3.25), 7.286 (3.64), 7.298 (1.99), 7.306 (3.08), 7.313 (4.27), 7.321 (3.08), 7.336 (4.12), 7.344 (3.05), 7.446 (2.13), 7.451 (4.78), 7.454 (4.56), 7.462 (2.50), 7.470 (6.59), 7.473 (7.03), 7.481 (2.11), 7.485 (1.96), 7.489 (4.29), 7.493 (3.98), 7.547 (3.85), 7.550 (4.02), 7.565 (3.66), 7.568 (5.21), 7.570 (4.63), 7.586 (3.03), 7.589 (2.86), 7.941 (5.70), 7.959 (4.80), 7.962 (4.44), 8.137 (4.75), 8.141 (5.02), 8.157 (4.56), 8.161 (4.46), 8.305 (16.00), 9.000 (2.06), 9.015 (4.39), 9.029 (2.06), 9.271 (15.68).
Example 19
1-(1,3-benzothiazo -2-yl)-N-[3-fluoro-5-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (300 mg, 1.22 mmol) was provided in DMF (3 mL). N,N- Diisopropylethylamine (640 μL, 3.7 mmol), l-[3-fluoro-5-(trifluoromethoxy)phenyl]methan- amine (384 mg, 1.83 mmol) and propane phosphonic acid anhydride (T3P, 1.1 mL, 50% in DMF, 1.8 mmol) were added, and the mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water and extracted with dichloromethane. The combined organic phases were washed with brine, dried over sodium sulfate, filtered and concentrated to give 395 mg of crude material. After purification of 245 mg of the crude material by HPLC (method 1) 76 mg of the title compound were obtained.
LC-MS (method 2): , = 1.39 min; MS (ESIpos): m/z = 437 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.084 (4.05), 2.322 (0.54), 2.327 (0.81), 2.331 (0.59), 2.523 (4.94), 2.665 (0.59), 2.669 (0.86), 2.673 (0.65), 3.357 (0.62), 3.363 (0.46), 4.524 (9.53), 4.539 (9.80), 7.226 (6.26), 7.250 (1.77), 7.255 (4.34), 7.259 (3.80), 7.272 (3.46), 7.279 (4.76), 7.282 (4.26), 7.293 (3.04), 7.450 (3.02), 7.453 (3.12), 7.469 (5.02), 7.471 (5.80), 7.488 (4.34), 7.492 (3.93), 7.547 (4.11), 7.550 (4.21), 7.565 (3.85), 7.568 (5.58), 7.570 (5.07), 7.585 (3.30), 7.588 (3.14), 7.940 (4.99), 7.943 (5.61), 7.961 (5.30), 7.964 (4.75), 8.135 (4.96), 8.138 (5.43), 8.154 (4.72), 8.158 (4.88), 8.304 (15.87), 9.071 (2.18), 9.086 (4.63), 9.100 (2.24), 9.249 (16.00).
Example 20
1-(1,3-benzothiaz -2-yl)-N-[3,5-bis(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (10.0 g, 40.8 mmol) was provided in DMF (150 mL). N,N- Diisopropylethylamine (21 mL, 120 mmol), l-[3,5-bis(trifluoromethyl)phenyl]methanamine (14.9 g, 61.2 mmol) and propane phosphonic acid anhydride (T3P, 36 mL, 50% in DMF, 61 mmol) were added, and the mixture was stirred at room temperature for 1 h. After concentration, ethanol (300 mL) and water (100 mL) were added, the mixture was stirred for 20 minutes and the precipitate was collected by filtration, washed with ethanol and dried under reduced pressure at 50 °C to yield 15.6 g (80% of theory) of the title compound.
LC-MS (method 2): , = 1.45 min; MS (ESIpos): m/z = 471 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 1.905 (0.49), 2.326 (0.40), 2.523 (1.20), 2.669 (0.43), 3.429 (0.44), 4.654 (9.03), 4.669 (8.93), 7.447 (2.16), 7.450 (2.65), 7.467 (5.47), 7.485 (3.51), 7.488 (3.65), 7.543 (3.08), 7.546 (3.50), 7.563 (5.02), 7.566 (4.65), 7.581 (2.26), 7.585 (2.49), 7.938 (5.71), 7.959 (5.05), 8.021 (6.73), 8.049 (15.81), 8.130 (4.39), 8.134 (5.28), 8.151 (5.03), 8.154 (5.03), 8.304 (15.76), 9.121 (2.20), 9.136 (4.49), 9.150 (2.12), 9.249 (16.00).
Example 21
1-(1,3-benzothiaz -2-yl)-N-[3-fluoro-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (150 mg, 587 μmοΙ) was provided in DMF (1.7 mL). N,N- Diisopropylethylamine (310 μL, 1.8 mmol), l-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine (120 μL, 760 μηιοΙ) and propane phosphonic acid anhydride (T3P, 410 μL, 50% in DMF, 700 μmοΙ) were added, and the mixture was stirred at room temperature overnight. N,N-
Diisopropylethylamine (150 μL, 880 μmοΙ), l-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine (43 μL, 290 μmοΙ) and propane phosphonic acid anhydride (T3P, 170 μL, 50% in DMF, 290 μmοΙ) were added, and the mixture was stirred at room temperature for 3 days. Ethanol and water were added, after 30 minutes the precipitate was collected by filtration and dried under reduced pressure to yield 165 mg (67% of theory) of the title compound.
LC-MS (method 2): , = 1.37 min; MS (ESIpos): m/z = 421 [M+H]+
:H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.322 (0.71), 2.327 (1.02), 2.331 (0.81), 2.523 (2.92), 2.664 (0.77), 2.669 (1.06), 2.674 (0.75), 4.569 (8.96), 4.584 (8.96), 7.449 (2.36), 7.452 (2.63), 7.468 (4.53), 7.471 (5.28), 7.488 (3.76), 7.491 (3.40), 7.513 (2.94), 7.517 (2.36), 7.535 (2.80), 7.536 (3.05), 7.542 (2.36), 7.546 (3.91), 7.549 (3.76), 7.567 (8.08), 7.569 (7.31), 7.580 (8.21), 7.584 (10.36), 7.587 (7.58), 7.942 (5.29), 7.959 (4.87), 8.133 (4.85), 8.136 (5.16), 8.153 (4.62), 8.156 (4.66), 8.302 (16.00), 9.068 (1.96), 9.083 (4.18), 9.098 (1.98), 9.248 (15.65).
Example 22
1-(1,3-benzothiazol-2- -N-[2-(difluoromethyl)benzyl]-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (1.00 g, 3.91 mmol) was provided in DMF (11 mL). N,N- Diisopropylethylamine (2.0 mL, 12 mmol), l-[2-(difluoromethyl)phenyl]methanamine (923 mg, 5.87 mmol) and propane phosphonic acid anhydride (T3P, 3.4 mL, 50% in DMF, 5.9 mmol) were added, and the mixture was stirred at room temperature overnight. After concentration, ethanol and water were added and the mixture was stirred for 30 minutes. The precipitate was collected by filtration and dried under reduced pressure. Purification by HPLC (column: Chromatorex C18, mobile phase: acetonitrile/water + 0.1% formic acid) yielded 1.04 g (66% of theory) of the title compound.
LC-MS (method 2): R, = 1.27 min; MS (ESIpos): m/z = 385 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.322 (0.87), 2.330 (2.44), 2.523 (3.21), 2.664 (0.79), 2.669 (1.10), 2.674 (0.91), 4.446 (0.49), 4.460 (0.47), 4.617 (8.39), 4.632 (8.37), 7.187 (3.94), 7.324 (7.09), 7.416 (1.64), 7.436 (4.39), 7.438 (4.12), 7.449 (3.21), 7.452 (4.65), 7.461 (4.51), 7.470 (7.67), 7.487 (6.13), 7.490 (8.71), 7.525 (3.55), 7.544 (6.98), 7.548 (4.73), 7.565 (6.13),
7.567 (4.95), 7.582 (2.70), 7.586 (2.46), 7.599 (4.89), 7.617 (4.00), 7.936 (5.69), 7.954 (5.36), 8.132 (5.18), 8.135 (5.38), 8.152 (5.08), 8.155 (4.79), 8.304 (16.00), 8.987 (2.13), 9.001 (4.30), 9.016 (2.07), 9.254 (15.68), 9.269 (0.75).
Example 23
1-(1,3-benzothiazol- -yl)-N-(3-chloro-4-fluorobenzyl)-1H-pyrazole-4-carboxamide
The compound of intermediate 2 (200 mg, 815 μmοΙ) was provided in DMF (3.3 mL). N,N-Diiso propylethylamine (430 μL, 2.4 mmol), l-(3-chloro-4-fluorophenyl)methanamine (201 mg, 1.22 mmol) and propane phosphonic acid anhydride (T3P, 570 μL, 50% in DMF, 980 μmοΙ) were added, and the mixture was stirred at room temperature overnight. After concentration, ethanol and water were added. The precipitate was collected by filtration and dried under reduced pressure at 50 °C. After purification of the crude material by HPLC (method 1) 122 mg (35% of theory) of the title compound were obtained.
LC-MS (method 2): , = 1.31 min; MS (ESIpos): m/z = 387 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.322 (0.90), 2.327 (1.28), 2.331 (0.93), 2.523 (3.54), 2.664 (0.90), 2.669 (1.28), 2.674 (0.93), 4.449 (9.15), 4.464 (9.23), 7.333 (1.01), 7.338 (1.09), 7.346 (1.48), 7.355 (4.17), 7.360 (4.48), 7.370 (9.97), 7.393 (8.88), 7.415 (2.76), 7.448 (2.92), 7.451 (3.04), 7.466 (4.94), 7.469 (5.57), 7.486 (3.97), 7.490 (3.93), 7.537 (4.20), 7.542 (4.71), 7.544 (5.57), 7.548 (4.63), 7.555 (4.44), 7.560 (4.79), 7.565 (6.00), 7.568 (5.02), 7.583 (3.23), 7.586 (3.00), 7.935 (4.98), 7.939 (5.10), 7.956 (4.94), 7.959 (4.59), 8.130 (4.98), 8.134 (4.94), 8.150 (4.71), 8.154 (4.44), 8.292 (16.00), 8.991 (2.06), 9.006 (4.24), 9.021 (1.99), 9.229 (15.92), 9.632 (0.51).
Example 24
The compound of intermediate 2 (173 mg, 705 μmοΙ) was provided in DMF (2 mL). N,N- Diisopropylethylamine (370 μL, 2.1 mmol), the compound of intermediate 9 (200 mg, 1.06 mmol) and propane phosphonic acid anhydride (T3P, 620 μL, 50% in DMF, 1.1 mmol) were added, and the mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water and extracted with dichloromethane. The combined organic phases were washed with brine, dried over sodium sulfate, filtered and concentrated to give 199 mg of crude material. After purification of 100 mg of the crude material by HPLC (method 1) 59 mg of the title compound were obtained.
LC-MS (method 2): , = 1.39 min; MS (ESIpos): m/z = 417 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.084 (2.88), 2.327 (0.56), 2.331 (0.45), 2.392 (16.00), 2.523 (3.01), 2.549 (0.47), 2.669 (0.51), 4.514 (4.13), 4.529 (4.21), 5.755 (1.24), 7.448 (2.90), 7.452 (4.38), 7.457 (5.00), 7.467 (3.59), 7.469 (3.40), 7.480 (3.44), 7.483 (2.96), 7.486 (2.99), 7.490 (2.26), 7.544 (1.40), 7.548 (1.53), 7.565 (2.32), 7.568 (1.90), 7.583 (1.16), 7.587 (1.09), 7.939 (2.61), 7.957 (2.31), 8.132 (2.11), 8.136 (2.25), 8.153 (2.12), 8.156 (2.18), 8.302 (6.82), 9.028 (0.96), 9.043 (1.97), 9.058 (0.97), 9.243 (6.90).
Example 25
1-(1,3-benzothiazol-2-yl)-N-[3-chloro-5-(trifluoromethoxy)benzyl]-1H-pyrazole-4- carboxamide
The compound of intermediate 2 (145 mg, 591 μmοΙ) was provided in DMF (2 mL). N,N- Diisopropyl ethylamine (310 μL, 1.8 mmol), the compound of intermediate 10 (200 mg, 887 μmοΙ) and propane phosphonic acid anhydride (T3P, 520 μL, 50% in DMF, 890 μmοΙ) were
added, and the mixture was stirred at room temperature overnight. The mixture was poured into a saturated, aqueous solution of sodium bicarbonate, was diluted with water and extracted with dichloromethane. The combined organic phases were washed with brine, dried over sodium sulfate, filtered and concentrated to give 252 mg of crude material. After purification of 150 mg of the crude material by HPLC (method 1) 60 mg of the title compound were obtained.
LC-MS (method 2): Rt = 1.46 min; MS (ESIpos): m/z = 453 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 2.327 (0.45), 2.523 (0.87), 2.669 (0.45), 4.518 (9.16), 4.533 (9.06), 7.344 (5.20), 7.347 (6.25), 7.350 (5.62), 7.448 (3.20), 7.452 (4.23), 7.455 (3.77), 7.459 (6.04), 7.467 (8.24), 7.472 (8.52), 7.477 (8.46), 7.481 (3.91), 7.486 (4.35), 7.490 (4.25), 7.545 (3.85), 7.548 (3.96), 7.563 (3.70), 7.565 (5.27), 7.568 (4.60), 7.583 (2.96), 7.587 (2.80), 7.938 (5.00), 7.942 (5.52), 7.959 (5.06), 7.962 (4.37), 8.132 (4.91), 8.136 (4.96), 8.153 (4.69), 8.156 (4.75), 8.302 (15.94), 9.066 (2.15), 9.081 (4.51), 9.097 (2.05), 9.235 (0.44), 9.245 (16.00).
Example 26
1-(1,3-benzothiazol-2-yl)-N-[(lR)-l,2,3,4-tetrahydronaphthalen-l-yl]-1H-pyrazole-4- carboxamide
The compound of intermediate 2 (150 mg, 587 μmοΙ) was provided in DMF (1.7 mL). N,N-Diiso- propylethylamine (310 μL, 1.8 mmol), (lR)-l,2,3,4-tetrahydronaphthalen-l-amine (130 mg, 881 μmοΙ) and propane phosphonic acid anhydride (T3P, 510 μL, 50% in DMF, 880 μmοΙ) were added, and the mixture was stirred at room temperature overnight. Water was added, and the precipitate was collected by filtration and dried under reduced pressure to yield 104 mg (45% of theory) of the title compound.
LC-MS (method 2): R, = 1.36 min; MS (ESIpos): m/z = 375 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.901 (0.43), 0.918 (0.93), 0.934 (0.60), 0.936 (0.55), 1.231 (0.51), 1.474 (0.63), 1.751 (0.82), 1.776 (2.47), 1.781 (2.74), 1.794 (3.52), 1.803 (3.19), 1.820 (2.32), 1.846 (0.98), 1.907 (0.55), 1.921 (0.55), 1.936 (1.06), 1.945 (1.39), 1.949 (1.53), 1.962 (2.97), 1.965 (3.29), 1.977 (3.41), 1.984 (2.86), 1.998 (2.26), 2.024 (0.63), 2.322 (0.74),
2.327 (1.06), 2.331 (0.82), 2.523 (6.47), 2.664 (0.82), 2.669 (1.18), 2.673 (0.89), 2.678 (0.46), 2.729 (0.91), 2.756 (1.53), 2.758 (1.68), 2.770 (3.02), 2.787 (2.86), 2.799 (2.52), 2.801 (2.49), 2.817 (1.46), 2.843 (0.75), 2.860 (0.48), 5.182 (0.93), 5.200 (2.16), 5.202 (2.25), 5.213 (1.97), 5.218 (1.85), 5.222 (1.73), 5.232 (1.15), 7.125 (2.21), 7.131 (2.38), 7.136 (2.14), 7.142 (3.34), 7.150 (8.92), 7.155 (3.09), 7.166 (10.87), 7.172 (9.69), 7.183 (2.61), 7.188 (4.01), 7.205 (5.93), 7.211 (4.22), 7.223 (2.78), 7.226 (2.80), 7.228 (2.45), 7.440 (2.69), 7.443 (2.95), 7.458 (4.80), 7.461 (5.49), 7.478 (4.05), 7.481 (3.96), 7.533 (3.84), 7.536 (3.98), 7.553 (5.35), 7.556 (4.87), 7.571 (3.09), 7.575 (2.97), 7.908 (5.97), 7.925 (4.87), 7.928 (4.70), 8.125 (4.82), 8.128 (5.56), 8.146 (4.70), 8.149 (4.82), 8.325 (15.28), 8.746 (4.46), 8.767 (4.41), 9.280 (16.00). Example 27
1-(1,3-benzothiazol-2-yl)-N-methyl-N-[(lR)-l,2,3,4-tetrahydronaphthalen-l-yl]-1H-pyrazole-4- carboxamide
The compound of example 26 (83.9 mg, 224 μmοΙ) was provided in DMF (1.2 mL). Sodium hydride (11.6 mg, 60% in mineral oil, 291 μmοΙ) was added, and the mixture was stirred at room temperature for 1 h. lodomethane (21 μL, 340 μmοΙ) was added at 0 °C, and the mixture was stirred at room temperature for 3 h. Ethanol and water were added, the mixture was stirred for 15 minutes and the precipitate was collected by filtration and dried under reduced pressure to yield 43.2 mg (45% of theory) of the title compound.
LC-MS (method 2): R, = 1.44 min; MS (ESIpos): m/z = 389 [M+H]+
1H-NMR (400 MHz, DMSO-d5) δ [ppm]: 0.804 (0.47), 0.823 (0.58), 0.831 (0.67), 0.847 (0.67), 0.851 (0.88), 1.054 (0.51), 1.231 (2.46), 1.734 (0.43), 1.765 (0.88), 1.793 (1.07), 1.805 (1.08), 1.819 (1.03), 1.823 (1.09), 1.848 (1.19), 1.873 (0.74), 1.875 (0.75), 1.904 (0.92), 1.938 (1.07), 1.973 (2.21), 1.983 (1.91), 1.986 (1.84), 2.010 (1.41), 2.084 (1.75), 2.102 (0.45), 2.322 (0.58), 2.327 (0.82), 2.331 (0.62), 2.523 (4.74), 2.659 (8.02), 2.669 (1.88), 2.673 (1.36), 2.678 (0.83), 2.716 (0.91), 2.730 (1.13), 2.770 (1.53), 2.798 (1.15), 2.801 (1.16), 2.840 (0.87), 2.889 (0.90), 2.905 (16.00), 3.837 (0.78), 5.201 (0.59), 5.216 (0.65), 5.242 (0.45), 5.806 (0.67), 5.820 (0.76), 5.831 (0.90), 5.845 (0.72), 7.089 (0.88), 7.098 (1.24), 7.101 (1.33), 7.111 (1.63), 7.131 (1.15),
Reference Compound 1
1-(1,3-benzothiazol-2-yl)-N-[3,5-bis(trifluoromethyl)benzyl]-5-(trifluoromethyl)-1H-pyrazole 4-carboxamide
See WO 03/037274 A2, compound # 246.
Further, the compounds of formula (I) of the present invention can be converted to any salt as described herein, by any method which is known to the person skilled in the art. Similarly, any
salt of a compound of formula (I) of the present invention can be converted into the free compound, by any method which is known to the person skilled in the art.
Pharmaceutical compositions of the compounds of the invention
This invention also relates to pharmaceutical compositions containing one or more compounds of the present invention. These compositions can be utilised to achieve the desired pharmacological effect by administration to a patient in need thereof. A patient, for the purpose of this invention, is a mammal, including a human, in need of treatment for the particular condition or disease. Therefore, the present invention includes pharmaceutical compositions that are comprised of a pharmaceutically acceptable carrier and a pharmaceutically effective amount of a compound, or salt thereof, of the present invention. A pharmaceutically acceptable carrier is preferably a carrier that is relatively non-toxic and innocuous to a patient at concentrations consistent with effective activity of the active ingredient so that any side effects ascribable to the carrier do not vitiate the beneficial effects of the active ingredient. A pharmaceutically effective amount of compound is preferably that amount which produces a result or exerts an influence on the particular condition being treated. The compounds of the present invention can be administered with pharmaceutically- acceptable carriers well known in the art using any effective conventional dosage unit forms, including immediate, slow and timed release preparations, orally, parenterally, topically, nasally, ophthalmically, optically, sublingually, rectally, vaginally, and the like.
For oral administration, the compounds can be formulated into solid or liquid preparations such as capsules, pills, tablets, troches, lozenges, melts, powders, solutions, suspensions, or emulsions, and may be prepared according to methods known to the art for the manufacture of pharmaceutical compositions. The solid unit dosage forms can be a capsule that can be of the ordinary hard- or soft-shelled gelatine type containing, for example, surfactants, lubricants, and inert fillers such as lactose, sucrose, calcium phosphate, and corn starch.
In another embodiment, the compounds of this invention may be tableted with conventional tablet bases such as lactose, sucrose and cornstarch in combination with binders such as acacia, corn starch or gelatine, disintegrating agents intended to assist the break-up and dissolution of the tablet following administration such as potato starch, alginic acid, corn starch, and guar gum, gum tragacanth, acacia, lubricants intended to improve the flow of tablet granulation and to prevent the adhesion of tablet material to the surfaces of the tablet dies and punches, for
example talc, stearic acid, or magnesium, calcium or zinc stearate, dyes, colouring agents, and flavouring agents such as peppermint, oil of wintergreen, or cherry flavouring, intended to enhance the aesthetic qualities of the tablets and make them more acceptable to the patient. Suitable excipients for use in oral liquid dosage forms include dicalcium phosphate and diluents such as water and alcohols, for example, ethanol, benzyl alcohol, and polyethylene alcohols, either with or without the addition of a pharmaceutically acceptable surfactant, suspending agent or emulsifying agent. Various other materials may be present as coatings or to otherwise modify the physical form of the dosage unit. For instance tablets, pills or capsules may be coated with shellac, sugar or both.
Dispersible powders and granules are suitable for the preparation of an aqueous suspension. They provide the active ingredient in admixture with a dispersing or wetting agent, a suspending agent and one or more preservatives. Suitable dispersing or wetting agents and suspending agents are exemplified by those already mentioned above. Additional excipients, for example those sweetening, flavouring and colouring agents described above, may also be present.
The pharmaceutical compositions of this invention may also be in the form of oil-in-water emulsions. The oily phase may be a vegetable oil such as liquid paraffin or a mixture of vegetable oils. Suitable emulsifying agents may be ( 1) naturally occurring gums such as gum acacia and gum tragacanth, (2) naturally occurring phosphatides such as soy bean and lecithin, (3) esters or partial esters derived from fatty acids and hexitol anhydrides, for example, sorbitan monooleate, (4) condensation products of said partial esters with ethylene oxide, for example, polyoxyethylene sorbitan monooleate. The emulsions may also contain sweetening and flavouring agents.
Oily suspensions may be formulated by suspending the active ingredient in a vegetable oil such as, for exam ple, arachis oil, olive oil, sesame oil or coconut oil, or in a mineral oil such as liquid paraffin. The oily suspensions may contain a thickening agent such as, for example, beeswax, hard paraffin, or cetyl alcohol. The suspensions may also contain one or more preservatives, for example, ethyl or n-propyl p-hydroxybenzoate ; one or more colouring agents ; one or more flavouring agents ; and one or more sweetening agents such as sucrose or saccharin.
Syrups and elixirs may be formulated with sweetening agents such as, for example, glycerol, propylene glycol, sorbitol or sucrose. Such formulations may also contain a demulcent, and preservative, such as methyl and propyl parabens and flavouring and colouring agents.
The compounds of this invention may also be administered parenterally, that is, subcutaneously, intravenously, intraocularly, intrasynovially, intramuscularly, or interperitoneally, as injectable dosages of the compound in preferably a physiologically acceptable diluent with a pharmaceutical carrier which can be a sterile liquid or mixture of liquids such as water, saline, aqueous dextrose and related sugar solutions, an alcohol such as ethanol, isopropanol, or hexadecyl alcohol, glycols such as propylene glycol or polyethylene glycol, glycerol ketals such as 2,2-dimethyl-l,l-dioxolane-4-methanol, ethers such as poly(ethylene glycol) 400, an oil, a fatty acid, a fatty acid ester or, a fatty acid glyceride, or an acetylated fatty acid glyceride, with or without the addition of a pharmaceutically acceptable surfactant such as a soap or a detergent, suspending agent such as pectin, carbomers, methylcellulose, hydroxypropylmethylcellulose, or carboxymethylcellulose, or emulsifying agent and other pharmaceutical adjuvants.
Illustrative of oils which can be used in the parenteral formulations of this invention are those of petroleum, animal, vegetable, or synthetic origin, for example, peanut oil, soybean oil, sesame oil, cottonseed oil, corn oil, olive oil, petrolatum and mineral oil. Suitable fatty acids include oleic acid, stearic acid, isostearic acid and myristic acid. Suitable fatty acid esters are, for example, ethyl oleate and isopropyl myristate. Suitable soaps include fatty acid alkali metal, ammonium, and triethanolamine salts and suitable detergents include cationic detergents, for example dimethyl dialkyl ammonium halides, alkyl pyridinium halides, and alkylamine acetates ; anionic detergents, for example, alkyl, aryl, and olefin sulfonates, alkyl, olefin, ether, and monoglyceride sulfates, and sulfosuccinates ; non-ionic detergents, for example, fatty amine oxides, fatty acid alkanolamides, and poly(oxyethylene-oxypropylene)s or ethylene oxide or propylene oxide copolymers ; and amphoteric detergents, for example, alkyl-beta- aminopropionates, and 2-alkylimidazoline quarternary ammonium salts, as well as mixtures. The parenteral compositions of this invention will typically contain from about 0.5% to about 25% by weight of the active ingredient in solution. Preservatives and buffers may also be used advantageously. In order to minimise or eliminate irritation at the site of injection, such compositions may contain a non-ionic surfactant having a hydrophile-lipophile balance (HLB) preferably of from about 12 to about 17. The quantity of surfactant in such formulation preferably ranges from about 5% to about 15% by weight. The surfactant can be a single component having the above HLB or can be a mixture of two or more components having the desired HLB.
Illustrative of surfactants used in parenteral formulations are the class of polyethylene sorbitan fatty acid esters, for example, sorbitan monooleate and the high molecular weight adducts of ethylene oxide with a hydrophobic base, formed by the condensation of propylene oxide with propylene glycol.
The pharmaceutical compositions may be in the form of sterile injectable aqueous suspensions. Such suspensions may be formulated according to known methods using suitable dispersing or wetting agents and suspending agents such as, for example, sodium carboxymethylcellulose, methylcellulose, hydroxypropylmethyl-cellulose, sodium alginate, polyvinylpyrrolidone, gum tragacanth and gum acacia ; dispersing or wetting agents which may be a naturally occurring phosphatide such as lecithin, a condensation product of an alkylene oxide with a fatty acid, for example, polyoxyethylene stearate, a condensation product of ethylene oxide with a long chain aliphatic alcohol, for example, heptadeca-ethyleneoxycetanol, a condensation product of ethylene oxide with a partial ester derived form a fatty acid and a hexitol such as polyoxyethylene sorbitol monooleate, or a condensation product of an ethylene oxide with a partial ester derived from a fatty acid and a hexitol anhydride, for example polyoxyethylene sorbitan monooleate.
The sterile injectable preparation may also be a sterile injectable solution or suspension in a non-toxic parenterally acceptable diluent or solvent. Diluents and solvents that may be employed are, for example, water, Ringer's solution, isotonic sodium chloride solutions and isotonic glucose solutions. In addition, sterile fixed oils are conventionally employed as solvents or suspending media. For this purpose, any bland, fixed oil may be employed including synthetic mono- or diglycerides. In addition, fatty acids such as oleic acid can be used in the preparation of injectables.
A composition of the invention may also be administered in the form of suppositories for rectal administration of the drug. These compositions can be prepared by mixing the drug with a suitable non-irritation excipient which is solid at ordinary temperatures but liquid at the rectal temperature and will therefore melt in the rectum to release the drug. Such materials are, for example, cocoa butter and polyethylene glycol.
Another formulation employed in the methods of the present invention employs transdermal delivery devices ("patches"). Such transdermal patches may be used to provide continuous or discontinuous infusion of the compounds of the present invention in controlled amounts. The construction and use of transdermal patches for the delivery of pharmaceutical agents is well
known in the art (see, e.g., US Patent No. 5,023,252, issued June 11, 1991, incorporated herein by reference). Such patches may be constructed for continuous, pulsatile, or on demand delivery of pharmaceutical agents.
Controlled release formulations for parenteral administration include liposomal, polymeric microsphere and polymeric gel formulations that are known in the art.
It may be desirable or necessary to introduce the pharmaceutical composition to the patient via a mechanical delivery device. The construction and use of mechanical delivery devices for the delivery of pharmaceutical agents is well known in the art. Direct techniques for, for example, administering a drug directly to the brain usually involve placement of a drug delivery catheter into the patient's ventricular system to bypass the blood-brain barrier. One such implantable delivery system, used for the transport of agents to specific anatomical regions of the body, is described in US Patent No. 5,011,472, issued April 30, 1991.
The compositions of the invention can also contain other conventional pharmaceutically acceptable compounding ingredients, generally referred to as carriers or diluents, as necessary or desired. Conventional procedures for preparing such compositions in appropriate dosage forms can be utilized.
Such ingredients and procedures include those described in the following references, each of which is incorporated herein by reference: Powell, M.F. ei al., "Compendium of Excipients for Parenteral Formulations" PDA Journal of Pharmaceutical Science & Technology 1998, 52(5), 238-311 ; Strickley, .G "Parenteral Formulations of Small Molecule Therapeutics Marketed in the United States (1999)-Part-1" PDA Journal of Pharmaceutical Science & Technology 1999, 53(6), 324-349 ; and Nema, S. ei al., "Excipients and Their Use in Injectable Products" PDA Journal of Pharmaceutical Science & Technology 1997, 51(4), 166-171.
Commonly used pharmaceutical ingredients that can be used as appropriate to formulate the composition for its intended route of administration include:
acidifying agents (examples include but are not limited to acetic acid, citric acid, fumaric acid, hydrochloric acid, nitric acid) ;
alkalinizing agents (examples include but are not limited to ammonia solution, ammonium carbonate, diethanolamine, monoethanolamine, potassium hydroxide, sodium borate, sodium carbonate, sodium hydroxide, triethanolamine, trolamine) ;
adsorbents (examples include but are not limited to powdered cellulose and activated charcoal) ;
aerosol propellants (examples include but are not limited to carbon dioxide, CCI2F2, F2CIC-CCIF2 air displacement agents (examples include but are not limited to nitrogen and argon) ;
antifungal preservatives (examples include but are not limited to benzoic acid, butylparaben, ethylparaben, methylparaben, propylparaben, sodium benzoate) ;
antimicrobial preservatives (examples include but are not limited to benzalkon ium chloride, benzethonium chloride, benzyl alcohol, cetylpyridin ium chloride, chlorobutanol, phenol, phenylethyl alcohol, phenylmercuric nitrate and thimerosal) ;
antioxidants (examples include but are not limited to ascorbic acid, ascorbyl palmitate, butylated hydroxyanisole, butylated hydroxytoluene, hypophosphorus acid, monothioglycerol, propyl gallate, sodium ascorbate, sodium bisulfite, sodium formaldehyde sulfoxylate, sodium metabisulfite) ;
binding materials (examples include but are not limited to block polymers, natural and synthetic rubber, polyacrylates, polyurethanes, silicones, polysiloxanes and styrene-butadiene copolymers) ;
buffering agents (examples include but are not limited to potassium metaphosphate, dipotassium phosphate, sodium acetate, sodium citrate anhydrous and sodium citrate dihydrate)
carrying agents (examples include but are not limited to acacia syrup, aromatic syrup, aromatic elixir, cherry syrup, cocoa syrup, orange syrup, corn oil, mineral oil, peanut oil, sesame oil, bacteriostatic sodium chloride injection and bacteriostatic water for injection)
chelating agents (examples include but are not limited to edetate disodium and edetic acid) colourants (examples include but are not limited to FD&C Red No. 3, FD&C Red No. 20, FD&C Yellow No. 6, FD&C Blue No. 2, D&C Green No. 5, D&C Orange No. 5, D&C Red No. 8, caramel and ferric oxide red) ;
clarifying agents (examples include but are not limited to bentonite) ;
emulsifying agents (examples include but are not limited to acacia, cetomacrogol, cetyl alcohol, glyceryl monostearate, lecithin, sorbitan monooleate, polyoxyethylene 50 monostearate) ;
encapsulating agents (examples include but are not limited to gelatin and cellulose acetate phthalate)
flavourants (examples include but are not limited to anise oil, cinnamon oil, cocoa, menthol, orange oil, peppermint oil and vanillin) ;
humectants (examples include but are not limited to glycerol, propylene glycol and sorbitol) ; levigating agents (examples include but are not limited to mineral oil and glycerin) ;
oils (examples include but are not limited to arachis oil, mineral oil, olive oil, peanut oil, sesame oil and vegetable oil) ;
ointment bases (examples include but are not limited to lanolin, hydrophilic ointment, polyethylene glycol ointment, petrolatum, hydrophilic petrolatum, white ointment, yellow ointment, and rose water ointment) ;
penetration enhancers (transdermal delivery) (examples include but are not limited to monohydroxy or polyhydroxy alcohols, mono- or polyvalent alcohols, saturated or unsaturated fatty alcohols, saturated or unsaturated fatty esters, saturated or unsaturated dicarboxylic acids, essential oils, phosphatidyl derivatives, cephalin, terpenes, amides, ethers, ketones and ureas)
plasticizers (examples include but are not limited to diethyl phthalate and glycerol) ;
solvents (examples include but are not limited to ethanol, corn oil, cottonseed oil, glycerol, isopropanol, mineral oil, oleic acid, peanut oil, purified water, water for injection, sterile water for injection and sterile water for irrigation) ;
stiffening agents (examples include but are not limited to cetyl alcohol, cetyl esters wax, microcrystalline wax, paraffin, stearyl alcohol, white wax and yellow wax) ;
suppository bases (examples include but are not limited to cocoa butter and polyethylene glycols (mixtures)) ;
surfactants (examples incl ude but are not limited to benzalkonium chloride, nonoxynol 10, oxtoxynol 9, polysorbate 80, sodium lauryl sulfate and sorbitan mono-palmitate) ;
suspending agents (examples include but are not limited to agar, bentonite, carbomers, carboxymethylcellulose sodium, hydroxyethyl cellulose, hydroxypropyl cellulose, hydroxypropyl methylcellulose, kaolin, methylcellulose, tragacanth and veegum) ;
sweetening agents (examples include but are not limited to aspartame, dextrose, glycerol, mannitol, propylene glycol, saccharin sodium, sorbitol and sucrose) ;
tablet anti-adherents (examples include but are not limited to magnesium stearate and talc) ; tablet binders (examples include but are not limited to acacia, alginic acid, carboxymethylcellulose sodium, compressible sugar, ethylcellulose, gelatin, liquid glucose, methylcellulose, non-crosslinked polyvinyl pyrrolidone, and pregelatinized starch) ;
tablet and capsule diluents (examples include but are not limited to dibasic calcium phosphate, kaolin, lactose, mannitol, microcrystalline cellulose, powdered cellulose, precipitated calcium carbonate, sodium carbonate, sodium phosphate, sorbitol and starch) ;
tablet coating agents (examples include but are not limited to liquid glucose, hydroxyethyl cellulose, hydroxypropyl cellulose, hydroxypropyl methylcellulose, methylcellulose, ethylcellulose, cellulose acetate phthalate and shellac) ;
tablet direct compression excipients (examples include but are not limited to dibasic calcium phosphate) ;
tablet disintegrants (examples include but are not limited to alginic acid, carboxymethylcellulose calcium, microcrystalline cell ulose, polacrillin potassium, cross-linked polyvinylpyrrolidone, sodium alginate, sodium starch glycollate and starch) ;
tablet glidants (examples include but are not limited to colloidal silica, corn starch and talc) ; tablet lubricants (examples include but are not limited to calcium stearate, magnesium stearate, mineral oil, stearic acid and zinc stearate) ;
tablet/capsule opaquants (examples include but are not limited to titanium dioxide) ;
tablet polishing agents (examples include but are not limited to carnuba wax and white wax) ; thickening agents (exam ples include but are not limited to beeswax, cetyl alcohol and paraffin) ;
tonicity agents (examples include but are not limited to dextrose and sodium chloride) ;
viscosity increasing agents (examples include but are not limited to alginic acid, bentonite, carbomers, carboxymethylcellulose sodium, methylcel lulose, polyvinyl pyrrolidone, sodium alginate and tragacanth) ; and
wetting agents (examples include but are not limited to heptadecaethylene oxycetanol, lecithins, sorbitol monooleate, polyoxyethylene sorbitol monooleate, and polyoxyethylene stearate).
Pharmaceutical compositions according to the present invention can be illustrated as follows: Sterile IV Solution: A 5 mg/mL solution of the desired compound of this invention can be made using sterile, injectable water, and the pH is adjusted if necessary. The solution is diluted for administration to 1 - 2 mg/mL with sterile 5% dextrose and is administered as an IV infusion over about 60 min.
Lyophilised powder for IV administration: A sterile preparation can be prepared with (i) 100 - 1000 mg of the desired compound of this invention as a lyophilised powder, (ii) 32- 327 mg/mL sodium citrate, and (iii) 300 - 3000 mg Dextran 40. The formulation is reconstituted with sterile, injectable saline or dextrose 5% to a concentration of 10 to 20 mg/mL, which is further diluted with saline or dextrose 5% to 0.2 - 0.4 mg/mL, and is administered either IV bolus or by IV infusion over 15 - 60 min.
Intramuscular suspension: The following solution or suspension can be prepared, for intramuscular injection:
50 mg/mL of the desired, water-insoluble compound of this invention
5 mg/mL sodium carboxymethylcellulose
4 mg/mL TWEEN 80
9 mg/mL sodium chloride
9 mg/mL benzyl alcohol
Hard Shell Capsules: A large number of unit capsules are prepared by filling standard two-piece hard galantine capsules each with 100 mg of powdered active ingredient, 150 mg of lactose, 50 mg of cellulose and 6 mg of magnesium stearate.
Soft Gelatin Capsules: A mixture of active ingredient in a digestible oil such as soybean oil, cottonseed oil or olive oil is prepared and injected by means of a positive displacement pump into molten gelatin to form soft gelatin capsules containing 100 mg of the active ingredient. The capsules are washed and dried. The active ingredient can be dissolved in a mixture of polyethylene glycol, glycerin and sorbitol to prepare a water miscible medicine mix.
Tablets: A large number of tablets are prepared by conventional procedures so that the dosage unit is 100 mg of active ingredient, 0.2 mg. of colloidal silicon dioxide, 5 mg of magnesium stearate, 275 mg of microcrystalline cellulose, 11 mg of starch, and 98.8 mg of lactose. Appropriate aqueous and non-aqueous coatings may be applied to increase palatability, improve elegance and stability or delay absorption.
Immediate Release Tablets/Capsules: These are solid oral dosage forms made by conventional and novel processes. These units are taken orally without water for immediate dissolution and delivery of the medication. The active ingredient is mixed in a liquid containing ingredient such as sugar, gelatin, pectin and sweeteners. These liquids are solidified into solid tablets or caplets by freeze drying and solid state extraction techniques. The drug compounds may be compressed with viscoelastic and thermoelastic sugars and polymers or effervescent components to produce porous matrices intended for immediate release, without the need of water.
Combination therapies
The term "combination" in the present invention is used as known to persons skilled in the art and may be present as a fixed combination, a non-fixed combination or kit-of-parts.
A "fixed combination" in the present invention is used as known to persons skilled in the art and is defined as a combination wherein the said first active ingredient and the said second active ingredient are present together in one unit dosage or in a single entity. One example of a "fixed combination" is a pharmaceutical composition wherein the said first active ingredient and the said second active ingredient are present in admixture for simultaneous administration, such as in a formulation. Another example of a "fixed combination" is a pharmaceutical combination wherein the said first active ingredient and the said second active ingredient are present in one unit without being in admixture.
A non-fixed combination or "kit-of-parts" in the present invention is used as known to persons skilled in the art and is defined as a combination wherein the said first active ingredient and the said second active ingredient are present in more than one unit. One example of a non-fixed combination or kit-of-parts is a combination wherein the said first active ingredient and the said second active ingredient are present separately. The components of the non-fixed combination or kit-of-parts may be administered separately, sequentially, simultaneously, concurrently or chronologically staggered.
The compounds of this invention can be administered as the sole pharmaceutical agent or in combination with one or more other pharmaceutical agents where the combination causes no unacceptable adverse effects. The present invention relates also to such combinations. For example, the compounds of this invention can be combined with known chemotherapeutic agents or anti-cancer agents, e.g. anti-hyper-proliferative or other indication agents, and the like, as well as with admixtures and combinations thereof. Other indication agents include, but are not limited to, anti-angiogenic agents, mitotic inhibitors, alkylating agents, antimetabolites, DNA-intercalating antibiotics, growth factor inhibitors, cell cycle inhibitors, enzyme inhibitors, toposisomerase inhibitors, biological response modifiers, or anti-hormones. The term "chemotherapeutic anti-cancer agents", includes but is not limited to
1311-chTNT, abarelix, abiraterone, aclarubicin, ado-trastuzumab emtansine, afatinib, aflibercept, aldesleukin, alemtuzumab, Alendronic acid, alitretinoin, altretamine, amifostine, aminoglutethimide, Hexyl aminolevulinate, amrubicin, amsacrine, anastrozole, ancestim, anethole dithiolethione, angiotensin II, antithrombin III, aprepitant, arcitumomab, arglabin, arsenic trioxide, asparaginase, axitinib, azacitidine, basiliximab, belotecan, bendamustine, belinostat, bevacizumab, bexarotene, bicalutamide, bisantrene, bleomycin, bortezomib, buserelin, bosutinib, brentuximab vedotin, busulfan, cabazitaxel, cabozantinib, calcium folinate, calcium levofolinate, capecitabine, capromab, carboplatin, carfilzomib, carmofur, carmustine, catumaxomab, celecoxib, celmoleukin, ceritinib, cetuximab, chlorambucil, chlormadinone, chlormethine, cidofovir, cinacalcet, cisplatin, cladribine, clodronic acid, clofarabine, copanlisib, crisantaspase, cyclophosphamide, cyproterone, cytarabine, dacarbazine, dactinomycin, darbepoetin alfa, dabrafenib, dasatinib, daunorubicin, decitabine, degarelix, denileukin diftitox, denosumab, depreotide, deslorelin, dexrazoxane, dibrospidium chloride, dianhydrogalactitol, diclofenac, docetaxel, dolasetron, doxifluridine, doxorubicin, doxorubicin + estrone, dronabinol, eculizumab, edrecolomab, elliptinium acetate, eltrombopag, endostatin, enocitabine, enzalutamide, epirubicin, epitiostanol, epoetin alfa, epoetin beta, epoetin zeta, eptaplatin, eribulin, erlotinib, esomeprazole, estradiol, estramustine, etoposide, everolimus, exemestane, fadrozole, fentanyl, filgrastim, fluoxymesterone, floxuridine, fludarabine, fluorouracil, flutamide, folinic acid, formestane, fosaprepitant, fotemustine, fulvestrant, gadobutrol, gadoteridol, gadoteric acid meglumine, gadoversetamide, gadoxetic acid, gallium nitrate, ganirelix, gefitinib, gemcitabine, gemtuzumab, Glucarpidase, glutoxim, GM-CSF, goserelin, granisetron, granulocyte colony stimulating factor, histamine dihydrochloride, histrelin, hydroxycarbamide, I-125 seeds, lansoprazole, ibandronic acid, ibritumomab tiuxetan, ibrutinib,
idarubicin, ifosfamide, imatinib, imiquimod, improsulfan, indisetron, incadronic acid, ingenol mebutate, interferon alfa, interferon beta, interferon gamma, iobitridol, iobenguane (1231), iomeprol, ipilimumab, irinotecan, Itraconazole, ixabepilone, lanreotide, lapatinib, lasocholine, lenalidomide, lenograstim, lentinan, letrozole, leuprorelin, levamisole, levonorgestrel, levothyroxine sodium, lisuride, lobaplatin, lomustine, lonidamine, masoprocol, medroxyprogesterone, megestrol, melarsoprol, melphalan, mepitiostane, mercaptopurine, mesna, methadone, methotrexate, methoxsalen, methylaminolevulinate, methylprednisolone, methyltestosterone, metirosine, mifamurtide, miltefosine, miriplatin, mitobronitol, mitoguazone, mitolactol, mitomycin, mitotane, mitoxantrone, mogamulizumab, molgramostim, mopidamol, morphine hydrochloride, morphine sulfate, nabilone, nabiximols, nafarelin, naloxone + pentazocine, naltrexone, nartograstim, nedaplatin, nelarabine, neridronic acid, nivolumabpentetreotide, nilotinib, nilutamide, nimorazole, nimotuzumab, nimustine, nitracrine, nivolumab, obinutuzumab, octreotide, ofatumumab, omacetaxine mepesuccinate, omeprazole, ondansetron, oprelvekin, orgotein, orilotimod, oxaliplatin, oxycodone, oxymetholone, ozogamicine, p53 gene therapy, paclitaxel, palifermin, palladium-103 seed, palonosetron, pamidronic acid, panitumumab, pantoprazole, pazopanib, pegaspargase, PEG- epoetin beta (methoxy PEG-epoetin beta), pembrolizumab, pegfilgrastim, peginterferon alfa- 2b, pemetrexed, pentazocine, pentostatin, peplomycin, Perflubutane, perfosfamide, Pertuzumab, picibanil, pilocarpine, pirarubicin, pixantrone, plerixafor, plicamycin, poliglusam, polyestradiol phosphate, polyvinylpyrrolidone + sodium hyaluronate, polysaccharide-K, pomalidomide, ponatinib, porfimer sodium, pralatrexate, prednimustine, prednisone, procarbazine, procodazole, propranolol, quinagolide, rabeprazole, racotumomab, radium-223 chloride, radotinib, raloxifene, raltitrexed, ramosetron, ramucirumab, ranimustine, rasburicase, razoxane, refametinib, regorafenib, risedronic acid, rhenium-186 etidronate, rituximab, romidepsin, romiplostim, romurtide, roniciclib, samarium (153Sm) lexidronam, sargramostim, satumomab, secretin, sipuleucel-T, sizofiran, sobuzoxane, sodium glycididazole, sorafenib, stanozolol, streptozocin, sunitinib, talaporfin, tamibarotene, tamoxifen, tapentadol, tasonermin, teceleukin, technetium (99mTc) nofetumomab merpentan, 99mTc-HYNIC-[Tyr3]- octreotide, tegafur, tegafur + gimeracil + oteracil, temoporfin, temozolomide, temsirolimus, teniposide, testosterone, tetrofosmin, thalidomide, thiotepa, thymalfasin, thyrotropin alfa, tioguanine, tocilizumab, topotecan, toremifene, tositumomab, trabectedin, tramadol, trastuzumab, trastuzumab emtansine, treosulfan, tretinoin, trifluridine + tipiracil, trilostane, triptorelin, trametinib, trofosfamide, thrombopoietin, tryptophan, ubenimex, valatinib, valrubicin, vandetanib, vapreotide, vemurafenib, vinblastine, vincristine, vindesine, vinflunine,
vinorelbine, vismodegib, vorinostat, vorozole, yttrium-90 glass microspheres, zinostatin, zinostatin stimalamer, zoledronic acid, zorubicin.
The compounds of the invention may also be administered in combination with protein therapeutics. Such protein therapeutics suitable for the treatment of cancer or other angiogenic disorders and for use with the compositions of the invention include, but are not limited to, an interferon (e.g., interferon .alpha., .beta., or .gamma.) supraagonistic monoclonal antibodies, Tuebingen, TRP-1 protein vaccine, Colostrinin, anti-FAP antibody, YH-16, gemtuzumab, infliximab, cetuximab, trastuzumab, denileukin diftitox, rituximab, thymosin alpha 1, bevacizumab, mecasermin, mecasermin rinfabate, oprelvekin, natalizumab, rhMBL, MFE-CP1 + ZD-2767-P, ABT-828, ErbB2-specific immunotoxin, SGN-35, MT-103, rinfabate, AS- 1402, B43-genistein, L-19 based radioimmunotherapeutics, AC-9301, NY-ESO-1 vaccine, IMC- 1C11, CT-322, rhCCIO, r(m)CRP, MORAb-009, aviscumine, MDX-1307, Her-2 vaccine, APC-8024, NGR-hTNF, rhH1.3, IGN-311, Endostatin, volociximab, PRO-1762, lexatumumab, SGN-40, pertuzumab, EMD-273063, L19-IL-2 fusion protein, PRX-321, CNTO-328, MDX-214, tigapotide, CAT-3888, labetuzumab, alpha-particle-emitting radioisotope-llinked lintuzumab, EM-1421, HyperAcute vaccine, tucotuzumab celmoleukin, galiximab, HPV-16-E7, Javelin - prostate cancer, Javelin - melanoma, NY-ESO-1 vaccine, EGF vaccine, CYT-004-MelQbG10, WT1 peptide, oregovomab, ofatumumab, zalutumumab, cintredekin besudotox, WX-G250, Albuferon, aflibercept, denosumab, vaccine, CTP-37, efungumab, or 1311-chTNT-l/B. Monoclonal antibodies useful as the protein therapeutic include, but are not limited to, muromonab-CD3, abciximab, edrecolomab, daclizumab, gentuzumab, alemtuzumab, ibritumomab, cetuximab, bevicizumab, efalizumab, adalimumab, omalizumab, muromomab-CD3, rituximab, daclizumab, trastuzumab, palivizumab, basiliximab, and infliximab.
A compound of general formula (I) as defined herein can optionally be administered in combination with one or more of the following: ARRY-162, ARRY-300, ARRY-704, AS-703026, AZD-5363, AZD-8055, BEZ-235, BGT-226, BKM-120, BYL-719, CAL-101, CC-223, CH-5132799, deforolimus, E-6201, enzastaurin , GDC-0032, GDC-0068, GDC-0623, GDC-0941, GDC-0973, GDC-0980, GSK-2110183, GSK-2126458, GSK-2141795, MK-2206, novolimus, OSI-027, perifosine, PF-04691502, PF-05212384, PX-866, rapamycin, RG-7167, RO-4987655, RO- 5126766, selumetinib, TAK-733, trametinib, triciribine, UCN-01, WX-554, XL-147, XL-765, zotarolimus, ZSTK-474.
Generally, the use of cytotoxic and/or cytostatic agents in combination with a compound or composition of the present invention will serve to:
(1) yield better efficacy in reducing the growth of a tumor or even eliminate the tumor as compared to administration of either agent alone,
(2) provide for the administration of lesser amounts of the administered chemo- therapeutic agents,
(3) provide for a chemotherapeutic treatment that is well tolerated in the patient with fewer deleterious pharmacological complications than observed with single agent chemotherapies and certain other combined therapies,
(4) provide for treating a broader spectrum of different cancer types in mammals, especially humans,
(5) provide for a higher response rate among treated patients,
(6) provide for a longer survival time among treated patients compared to standard chemotherapy treatments,
(7) provide a longer time for tumor progression, and/or
(8) yield efficacy and tolerability results at least as good as those of the agents used alone, compared to known instances where other cancer agent combinations produce antagonistic effects.
Methods of Sensitizing Cells to Radiation
In a distinct embodiment of the present invention, a compound of the present invention may be used to sensitize a cell to radiation. That is, treatment of a cell with a compound of the present invention prior to radiation treatment of the cell renders the cell more susceptible to DNA damage and cell death than the cell would be in the absence of any treatment with a compound of the invention. In one aspect, the cell is treated with at least one compound of the invention.
Thus, the present invention also provides a method of killing a cell, wherein a cell is administered one or more compounds of the invention in combination with conventional radiation therapy.
The present invention also provides a method of rendering a cell more susceptible to cell death, wherein the cell is treated with one or more compounds of the invention prior to the treatment of the cell to cause or induce cell death. In one aspect, after the cell is treated with one or more compounds of the invention, the cell is treated with at least one compound, or at least one method, or a combination thereof, in order to cause DNA damage for the purpose of inhibiting the function of the normal cell or killing the cell.
In one embodiment, a cell is killed by treating the cell with at least one DNA damaging agent. That is, after treating a cell with one or more compounds of the invention to sensitize the cell to cell death, the cell is treated with at least one DNA damaging agent to kill the cell. DNA damaging agents useful in the present invention include, but are not limited to, chemotherapeutic agents (e.g., cisplatinum), ionizing radiation (X-rays, ultraviolet radiation), carcinogenic agents, and mutagenic agents.
In another embodiment, a cell is killed by treating the cell with at least one method to cause or induce DNA damage. Such methods include, but are not limited to, activation of a cell signalling pathway that results in DNA damage when the pathway is activated, inhibiting of a cell signalling pathway that results in DNA damage when the pathway is inhibited, and inducing a biochemical change in a cell, wherein the change results in DNA damage. By way of a non- limiting example, a DNA repair pathway in a cell can be inhibited, thereby preventing the repair of DNA damage and resulting in an abnormal accumulation of DNA damage in a cell. In one aspect of the invention, a compound of the invention is administered to a cell prior to the radiation or other induction of DNA damage in the cell. In another aspect of the invention, a compound of the invention is administered to a cell concomitantly with the radiation or other induction of DNA damage in the cell. In yet another aspect of the invention, a compound of the invention is administered to a cell immediately after radiation or other induction of DNA damage in the cell has begun.
In another aspect, the cell is in vitro. In another embodiment, the cell is in vivo.
As mentioned supra, the compounds of the present invention have surprisingly been found to effectively reduce tumor cell viability in nutrient deprived regions. In particular, said compounds of the present invention have been found to effectively kill cancer cells in inner tumor spheroid regions and may therefore be used for the treatment or prophylaxis of diseases of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses, or diseases which are accompanied
with uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses, particularly in which the uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses are affected by reduction of tumor cell viability in nutrient deprived regions, such as, for example, haematological tumours, solid tumours, and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas, head and neck tumours including brain tumours and brain metastases, tumours of the thorax including non-small cell and small cell lung tumours, gastrointestinal tumours, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas, and/or metastases thereof.
In accordance with another aspect therefore, the present invention covers a compound of general formula (I), or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, as described and defined herein, for use in the treatment or prophylaxis of a disease, as mentioned supra.
Another particular aspect of the present invention is therefore the use of a compound of general formula (I), described supra, or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, for the prophylaxis or treatment of a disease.
Another particular aspect of the present invention is therefore the use of a compound of general formula (I) described supra for manufacturing a pharmaceutical composition for the treatment or prophylaxis of a disease.
The diseases referred to in the two preceding paragraphs are diseases of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses, or diseases which are accompanied with uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune responses, or undesirable cellular inflammatory responses, such as, for example, haematological tumours, solid tumours, and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas, head and neck tumours including brain tumours and brain metastases, tumours of the thorax including non-small cell and small cell lung tumours, gastrointestinal tumours, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas, and/or metastases thereof.
The term "undesirable" within the context of the present invention, in particular in the context of "undesirable cellular immune responses, or undesirable cellular inflammatory responses", as used herein, is to be understood as meaning a response which is less than, or greater than normal, and which is associated with, responsible for, or results in, the pathology of said diseases.
Preferably, the use is in the treatment or prophylaxis of diseases, wherein the diseases are haemotological tumours, solid tumours and/or metastases thereof.
Method of treating hyper-proliferative disorders
The present invention relates to a method for using the compounds of the present invention and compositions thereof, to treat mammalian hyper-proliferative disorders. Compounds can be utilized to inhibit, block, reduce, decrease, etc., cell proliferation and/or cell division, and/or produce apoptosis. This method comprises administering to a mammal in need thereof, including a human, an amount of a compound of this invention, or a pharmaceutically acceptable salt, isomer, polymorph, metabolite, hydrate, solvate or ester thereof ; etc. which is effective to treat the disorder. Hyperproliferative disorders include but are not limited, e.g., psoriasis, keloids, and other hyperplasias affecting the skin, benign prostate hyperplasia (BPH), solid tumours, such as cancers of the breast, respiratory tract, brain, reproductive organs, digestive tract, urinary tract, eye, liver, skin, head and neck, thyroid, parathyroid and their distant metastases. Those disorders also include lymphomas, sarcomas, and leukaemias.
Examples of breast cancer include, but are not limited to invasive ductal carcinoma, invasive lobular carcinoma, ductal carcinoma in situ, and lobular carcinoma in situ.
Examples of cancers of the respiratory tract include, but are not limited to small-cell and non- small-cell lung carcinoma, as well as bronchial adenoma and pleuropulmonary blastoma.
Examples of brain cancers include, but are not limited to brain stem and hypophtalmic glioma, cerebellar and cerebral astrocytoma, medulloblastoma, ependymoma, anaplastic astrocytoma, diffuse astrocytoma, glioblastoma, oligodendroglioma, secondary glioblastoma multiforme as well as neuroectodermal and pineal tumour.
Tumours of the male reproductive organs include, but are not limited to prostate and testicular cancer. Tumours of the female reproductive organs include, but are not limited to endometrial, cervical, ovarian, vaginal, and vulvar cancer, as well as sarcoma of the uterus.
Tumours of the digestive tract incl ude, but are not limited to anal, colon, colorectal, oesophageal, gallbladder, gastric, pancreatic, rectal, small-intestine, and salivary gland cancers.
Tumours of the urinary tract include, but are not limited to bladder, penile, kidney, renal pelvis, ureter, urethral and human papillary renal cancers.
Eye cancers include, but are not limited to intraocular melanoma and retinoblastoma.
Examples of liver cancers include, but are not limited to hepatocellular carcinoma (liver cell carcinomas with or without fibrolamellar variant), cholangiocarcinoma (intrahepatic bile duct carcinoma), and mixed hepatocellular cholangiocarcinoma.
Skin cancers incl ude, but are not limited to squamous cell carcinoma, Kaposi's sarcoma, malignant melanoma, Merkel cell skin cancer, and non-melanoma skin cancer.
Head-and-neck cancers include, but are not limited to laryngeal, hypopharyngeal, nasopharyngeal, oropharyngeal cancer, lip and oral cavity cancer and squamous cell. Lymphomas include, but are not limited to AIDS-related lymphoma, non-Hodgkin's lymphoma, cutaneous T-cell lymphoma, Burkitt lymphoma, Hodgkin's disease, and lymphoma of the central nervous system.
Sarcomas include, but are not limited to sarcoma of the soft tissue, osteosarcoma, malignant fibrous histiocytoma, lymphosarcoma, and rhabdomyosarcoma.
Leukemias include, but are not limited to acute myeloid leukemia, acute lymphoblastic leukemia, chronic lymphocytic leukemia, chronic myelogenous leukemia, and hairy cell leukemia.
These disorders have been well characterized in humans, but also exist with a similar etiology in other mammals, and can be treated by administering pharmaceutical compositions of the present invention.
The term "treating" or "treatment" as stated throughout this document is used conventionally, e.g., the management or care of a subject for the purpose of combating, alleviating, reducing, relieving, improving the condition of, etc., of a disease or disorder, such as a carcinoma.
Methods of treating angiogenic disorders
The present invention also provides methods of treating disorders and diseases associated with excessive and/or abnormal angiogenesis.
Undesirable and ectopic expression of angiogenesis can be deleterious to an organism. A number of pathological conditions are associated with the growth of extraneous blood vessels. These include, e.g., diabetic retinopathy, ischemic retinal-vein occlusion, and retinopathy of prematurity [Aiello et al. New Engl. J. Med. 1994, 331, 1480 ; Peer et al. Lab. Invest. 1995, 72, 638], age-related macular degeneration [AMD ; see, Lopez et al. Invest. Opththalmol. Vis. Sci. 1996, 37, 855], neovascular glaucoma, psoriasis, retrolental fibroplasias, angiofibroma, inflammation, rheumatoid arthritis ( A), restenosis, in-stent restenosis, vascular graft restenosis, etc. In addition, the increased blood supply associated with cancerous and neoplastic tissue, encourages growth, leading to rapid tumour enlargement and metastasis. Moreover, the growth of new blood and lymph vessels in a tumour provides an escape route for renegade cells, encouraging metastasis and the consequence spread of the cancer. Thus, compounds of the present invention can be utilized to treat and/or prevent any of the aforementioned angiogenesis disorders, e.g., by inhibiting and/or reducing blood vessel formation ; by inhibiting, blocking, reducing, decreasing, etc. endothelial cell proliferation or other types involved in angiogenesis, as well as causing cell death or apoptosis of such cell types.
Dose and administration
Based upon standard laboratory techniques known to evaluate compounds useful for the treatment of hyper-proliferative disorders and angiogenic disorders, by standard toxicity tests and by standard pharmacological assays for the determination of treatment of the conditions identified above in mammals, and by comparison of these results with the results of known medicaments that are used to treat these conditions, the effective dosage of the compounds of this invention can readily be determined for treatment of each desired indication. The amount of the active ingredient to be administered in the treatment of one of these conditions can vary widely according to such considerations as the particular compound and dosage unit employed, the mode of administration, the period of treatment, the age and sex of the patient treated, and the nature and extent of the condition treated.
The total amount of the active ingredient to be administered will generally range from about 0.001 mg/kg to about 200 mg/kg body weight per day, and preferably from about 0.01 mg/kg to about 20 mg/kg body weight per day. Clinically useful dosing schedules will range from one to three times a day dosing to once every four weeks dosing. In addition, "drug holidays" in
which a patient is not dosed with a drug for a certain period of time, may be beneficial to the overall balance between pharmacological effect and tolerability. A unit dosage may contain from about 0.5 mg to about 1500 mg of active ingredient, and can be administered one or more times per day or less than once a day. The average daily dosage for administration by injection, including intravenous, intramuscular, subcutaneous and parenteral injections, and use of infusion techniques will preferably be from 0.01 to 200 mg/kg of total body weight. The average daily rectal dosage regimen will preferably be from 0.01 to 200 mg/kg of total body weight. The average daily vaginal dosage regimen will preferably be from 0.01 to 200 mg/kg of total body weight. The average daily topical dosage regimen will preferably be from 0.1 to 200 mg administered between one to four times daily. The transdermal concentration will preferably be that required to maintain a daily dose of from 0.01 to 200 mg/kg. The average daily inhalation dosage regimen will preferably be from 0.01 to 100 mg/kg of total body weight.
Of course the specific initial and continuing dosage regimen for each patient will vary according to the nature and severity of the condition as determined by the attending diagnostician, the activity of the specific compound employed, the age and general condition of the patient, time of administration, route of administration, rate of excretion of the drug, drug combinations, and the like. The desired mode of treatment and number of doses of a compound of the present invention or a pharmaceutically acceptable salt or ester or composition thereof can be ascertained by those skilled in the art using conventional treatment tests.
Preferably, the diseases of said method are haematological tumours, solid tumour and/or metastases thereof.
The compounds of the present invention can be used in particular in therapy and prevention, i.e. prophylaxis, of tumour growth and metastases, especially in solid tumours of all indications and stages with or without pre-treatment of the tumour growth.
Methods of testing for a particular pharmacological or pharmaceutical property are well known to persons skilled in the art.
The example testing experiments described herein serve to illustrate the present invention and the invention is not limited to the examples given.
Biological assays:
Examples were tested in selected biological assays one or more times. When tested more than once, data are reported as either average values or as median values, wherein
• the average value, also referred to as the arithmetic mean value, represents the sum of the values obtained divided by the number of times tested, and
· the median value represents the middle number of the group of values when ranked in ascending or descending order. If the number of values in the data set is odd, the median is the middle value. If the number of values in the data set is even, the median is the arithmetic mean of the two middle values.
Examples were synthesized one or more times. When synthesized more than once, data from biological assays represent average values or median values calculated utilizing data sets obtained from testing of one or more synthetic batch.
3D tumor spheroid assay
With three-dimensional growth conditions, multicellular tumor spheroids (MCTS) reproduce several parameters of the tumor microenvironment, including oxygen and nutrient gradients as well as the development of dormant tumor regions and therefore represent a promising model system for discovery of compounds that target tumor cells in stressed, hypoxic or nutrient- depleted regions (Wenzel CW., 3D high-content screening for the identification of compounds that target cells in dormant tumor spheroid regions. Experimental Cell Research 323, 2014, 131- 143).
By using automated microscopy and image analysis (high-content analysis) the tumor spheroid assay enables the identification of compounds that induce cell death in inner, nutrient-deprived tumor spheroid core regions, while not affecting well-supplied outer regions with direct access to the culture media, thereby excluding general cytotoxic compounds.
In general tumor spheroids were generated for high-content screening by seeding single cell suspensions of cancer cells into agarose-coated multiwell (e.g. 96 well or 384 well plates) plates (Friedrich J. Spheroid-based drug screen: considerations and practical approach. Nat. Protoc. 4, 309-324, 2009; Wenzel CW., 3D high-content screening for the identification of compounds that target cells in dormant tumor spheroid regions. Experimental Cell Research 323, 2014, 131-143) and incubated for 4 days in a humidified incubator (37 °C and 5% CO2). During this time, the cells form so called tumor spheroids, round cell aggregates with diameters of 400-600 μιη.
These reproduce several parameters of the metabolic tumor microenvironment and are used to screen for compounds that target cancer cells in nutrient-deprived tumor spheroid regions.
More precisely, for the generation of imaging-compatible 3D tumor spheroids, 10 μL of a heated (e.g. by Microwave) 1.5% w/v agarose (e.g. Agarose NA, Sigma-Aldrich GE17-0554- 01)(in DMEM (e.g. Life Technologies 11880-028) without phenol red and without fetal bovine serum (FBS)) solution was dispended by liquid dispensers (e.g. Multidrop Combi, Type 836 and standard tube dispensing cassettes, Thermo Scientific) into sterile 384-well clear bottom imaging plates (e.g. Greiner bio-one, 781090) and let cool for 2 h. To prevent premature gelation of the agarose suspension, the multidrop and dispensing cassette was heated by infrared lamps. For tumor spheroid seeding, a trypsinized (e.g. TrypLE from Life Technologies 12604-013) single cell suspension (of e.g. T47D (ATCC: HTB-133), MCF7 (ATCC: HTB-22), DLD-1 (ATCC: CCL-221), H460 (ATCC: HTB-177)) was seeded into agarose-coated (1.5% w/v) 384-well clear bottom plates in 40 μL PMI1640 or suitable cell culture medium (e.g. Life Technologies, 11875-093) containing 10% (v/v) FBS (e.g. PAA Laboratories A15-151) supplemented with 1% Penicillin/Streptomycin (e.g. Sigma-Aldrich P0781) (and 0.01 μg/mL insulin for T47D cells (e.g. Life Technologies 12585-014)) using a liquid dispenser (e.g. Multidrop Combi, Type 836 and standard tube dispensing cassettes, Thermo Scientific). Cell lines seeding number was optimized to obtain spheroids with an approximate diameter of 400 μιη on day 4 (e.g. typically 2000 cells per well (c/w) for T47D and MCF-7, 5000 c/w for DLD1 and 200 c/w for H-460). The plates were incubated under standard cell culture conditions at 37 °C and 5% C02 in humidified incubators for 4 days to allow formation of reproducible spheroids of defined size and morphology. On day 4 test compounds were added from a 3x stock solution by hand or liquid handling robots (e.g. CyBi-Well with 384-Well pipetting head) in 20 μL suitable cell culture medium (e.g. Life Technologies, 11875-093) containing 10% (v/v) FBS (e.g. PAA Laboratories A15-151) supplemented with 1% Penicillin/Streptomycin (e.g. Sigma-Aldrich P0781) (and 0.01 μg/mL insulin for T47D cells (e.g. Life Technologies 12585-014)) either in single concentration, typically reaching 10 μΜ endconcentration on the spheroids from a 10 mM Stock solution with DMSO levels never exceeding 1%, or as dilution typically covering a range of 10 μΜ to 0.51 nM final concentration on the spheroids and subsequently incubated for three days under standard cell culture conditions at 37 °C and 5% C02 in humidified incubators.
Prior to imaging, spheroids were stained for 6 h by adding Hoechst 33342 (final 2μg/mL from a 1 mg/mL stock solution, e.g. Life Technologies H-1399) as counterstain for all nuclei and 0.5 μΜ
Sytox Green ( as stain for dead cells (e.g. from a 2 mM stock solution, Life Technologies S26926) in 10 μL of a 7x solution in suitable cell culture medium (e.g. Life Technologies, 11875-093) containing 10% (v/v) FBS (e.g. PAA Laboratories A15-151) supplemented with 1% Penicillin/Streptomycin (e.g. Sigma-Aldrich P0781) (and 0.01 μg/mL insulin for T47D cells (e.g. Life Technologies 12585-014)) by liquid dispensers (e.g. Multidrop Combi, Type 836 and standard tube dispensing cassettes, Thermo Scientific).
Subsequently the plates were imaged on automated microscopes at the appropriate wavelengths and filter conditions for Hoechst and Sytox green staining (e.g. Opera confocal spinning disc, Hoechst excitation : 405 nm, emission : 450 nm; Sytox green excitation 488 nm, emission 540-575 nm).
For automated image analysis, the total area of the spheroid was identified by images from the Hoechst staining and subsequently intensity values in the second image (from sytox green staining) were determined as a read-out for the extent of cell death induced by the respective compound ( Wenzel CW., 3D high-content screening for the identification of compounds that target cells in dormant tumor spheroid regions. Experimental Cell Research 323, 2014, 131-143) (software programs used were e.g. Molecular Devices MetaXpress and Genedata Screener Assay Analyzer and Condoseo).
Table 2: Induction of inner core cell death in 3D tumor spheroids, T47D cells
Claims
)N
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, ethoxy, difluoromethoxy, trifluoromethoxy and benzyloxy,
and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, ethyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy, trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R5 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from: methyl, ethyl, cyclopropyl,
2,2,2-trifluoroethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a trifluoromethyl group
and R2, R4, R5 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom,
and R3 represents a fluorine or a chlorine atom or a methyl group,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine or a chlorine atom, or a group selected from:
methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R2 represents a fluorine or a chlorine atom, or a group selected from: methyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R2 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R5 represents a fluorine or a chlorine atom, or group selected from: methyl, ethyl, difluoromethyl and trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy grou or
R2 and R6 each represents a fluorine, chlorine or bromine atom, and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from:
methyl, ethyl, cyclopropyl, 2,2,2-trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy gro or
R3 represents a fluorine or a chlorine atom, or a group selected from : methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy g or
R3 represents a fluorine or a chlorine atom,
and R5 represents a chlorine atom, or a group selected from :
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from :
-CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 and R5 each represents a fluorine atom,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group, or
R3, R4 and R5 each represents a fluorine or a chlorine atom, and R2 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R1 represents a hydrogen atom or a group selected from :
methyl, ethyl, cyclopropyl and cyclopropylmethyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R1 represents a methyl group,
and R2 represents a fluorine or a chlorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R3 represents a fluorine or a chlorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R4 represents a fluorine or a chlorine atom,
and R2, R3 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1 represents a methyl group,
and R5 represents a fluorine or a chlorine atom,
and R2, R3 and R4 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
wherein * indicates the point of attachment of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2 and R5 each represents a hydrogen atom,
and one of R3, R4 represents a fluorine atom whereas the other one of R3, R4 reprents a hydrogen atom,
and R8 and R9 each represents a hydrogen atom; or
re resents a
wherein * indicates the point of attachement of said group to the carbonyl g and wherein
R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R" and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4, R5 and R5 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from:
methyl, ethyl and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine, chlorine or bromine atom, or a group selected from: amino, nitro, methyl, methoxymethyl, difluoromethyl, trifluoromethyl, methoxy, trifluoromethoxy and phenyl, wherein phenyl is optionally substituted with a fluori or a chlorine atom or with a group selected from: methyl and methoxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a chlorine atom, or a group selected from:
methoxymethyl, difluoromethyl, ethoxy, difluoromethoxy and benzyloxy, and R3, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine, chlorine or bromine atom, or a group selected from: hydroxy, methyl, difluoromethyl, trifluoromethyl, methoxy, difluoromethoxy,
trifluoromethoxy and phenyloxy,
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3 represents a fluorine or a chlorine atom, or a methyl group, and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from:
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a trifluoromethyl group
and R2, R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a group selected from : methyl, ethyl and
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R4 represents a fluorine or a chlorine atom,
and R2, R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom,
and R3 represents a chlorine atom,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R2 represents a fluorine atom,
and R3 represents a chlorine atom or a methyl group,
and R4, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 and R3 together with the carbon atoms to which they are bound form a benzo ring, and R1, R4, R5 and R6 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom, or a group selected from: methyl and trifluoromethoxy, and R4 represents a fluorine atom,
and R3, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom or a trifluoromethyl group,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R2 represents a fluorine atom or a trifluoromethoxy group,
and R5 represents a fluorine or a chlorine atom, or group selected from: methyl and trifluoromethyl,
and R3, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R2 and R6 each represents a fluorine atom,
and R3, R4 and R5 each represents a hydrogen atom,
and R1 represents a group selected from: methyl, ethyl, cyclopropyl, 2,2,2- trifluoroethyl, 2-methoxyethyl and -CH2C(=O)OC
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom, or a group selected from : methyl, trifluoromethyl and trifluoromethoxy,
and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 and R8 each represents a hydrogen atom,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom or a trifluoromethoxy group, and R4 represents a fluorine or a chlorine atom,
and R2, R5 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine or a chlorine atom, or a group selected from:
methyl and methoxy,
and R5 represents a chlorine atom, or a group selected from:
methyl, trifluoromethyl and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 represents a fluorine atom,
and R5 represents a chlorine atom, or a group selected from: methyl, trifluoromet and trifluoromethoxy,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a methyl group,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R3 and R5 each represents a trifluoromethyl group,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom or a group selected from: -CH2C(=O)OCH3 and -CH2C(=O)OC2H5,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
R3 and R5 each represents a fluorine atom,
and R2, R4 and R6 each represents a hydrogen atom,
and R1 and R9 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group; or
R3, R4 and R5 each represents a fluorine atom,
and R2 and R6 each represents a hydrogen atom,
and R1 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
wherein * indicates the point of attachment of said group to the carbonyl group; and wherein
R1 represents a hydrogen atom or a group selected from : methyl, ethyl and cyclopropylmethyl-,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R9 represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group;
R1 represents a methyl group,
and R3 represents a fluorine atom,
and R2, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group;
or
R1 represents a methyl group,
and R4 represents a fluorine atom,
and R2, R3 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein R1 represents a hydrogen atom or a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R1 represents a methyl group,
and R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or
R1(R10)N represents a
wherein * indicates the point of attachement of said group to the carbonyl group; and wherein
R2, R3, R4 and R5 each represents a hydrogen atom,
and R8 represents a hydrogen atom or a methyl group,
and R9 represents a hydrogen atom or a fluorine atom or a methoxy group; or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
3. The compound according to any one of claims 1 or 2, which is selected from the group consisting of:
1-(1,3-benzothiazol-2-yl)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4-carbox- amide ,
1-(1,3-benzothiazol-2-yl)-N-[(lR)-2,3-dihydro-1H-inden-l-yl]-N-ethyl-1H-pyrazole-4-carbox- amide ,
1-(1,3-benzothiazol-2-yl)-N-(6-fluoro-2,3-dihydro-1H-inden-l-yl)-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[(lR)-6-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[(lS)-6-fluoro-2,3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(5-fluoro-2,3-dihydro-1H-inden-l-yl)-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[(lR)-5-fluoro-2;3-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[(lS)-5-fluoro-2^-dihydro-1H-inden-l-yl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-(difluoromethyl)benzyl]-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[4-chloro-3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3;5-dichlorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3;4-dichlorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(naphthalen-l-ylmethyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2-chlorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide , ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-benzylglycinate ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-5-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-chloro-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[5-fluoro-2-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-fluoro-5-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3;5-bis(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-fluoro-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-(difluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-4-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-methyl-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-chloro-5-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[(lR)-l,2,3,4-tetrahydronaphthalen-l-yl]-1H-pyrazole-4-carbox- amide ,
1-(1,3-benzothiazol-2-yl)-N-methyl-N-[(lR)-l,2,3,4-tetrahydronaphthalen-l-yl]-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3-fluoro-5-methyl benzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3;4;5-trifluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-(difluoromethoxy)benzyl]-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3;5-dimethyl benzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3-chlorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3,5-difluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2;6-difluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(4-fluoro-2-methyl benzyl )-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-methyl-5-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[4-fluoro-2-(trifluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide , ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-(2,6-difluorobenzyl)glycinate ,
1-(1'3-benzothiazol-2-yl)-N-(3-chlorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3,4-difluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(4-fluoro-2-methyl benzyl )-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-5-fluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(4-fluoro-3-methyl benzyl )-1H-pyrazole-4-carboxamide , ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-(3-chlorobenzyl)glycinate ,
1-(1,3- benzothiazol -2-yl)- N -benzyl-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -benzyl-N-ethyl-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -[4-fluoro-3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(2-chlorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -[3-(difluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(3-bromobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -[(4'-chlorobiphenyl-2-yl)methyl]-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(2-methylbenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(3-methylbenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(4-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3- benzothiazol -2-yl)- N -(cyclopropyl methyl)-N-[(lR)-2;3-dihydro-1H-inden-l-yl]-1H- pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-methyl-N-(3-methylbenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[(4'-fluorobiphenyl-2-yl)methyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2;6-difluorobenzyl)-N-ethyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[5-fluoro-2-(trifluoromethoxy)benzyl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-benzyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3-chlorobenzyl)-N-ethyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(4-chlorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-methyl-N-[(lS)-l,2,3,4-tetrahydronaphthalen-l-yl]-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2-bromobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-phenoxybenzyl)-1H-pyrazole-4-carboxamide ,
[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl] (5-chloro-3,4-dihydroisoquinolin-2(lH)-yl) methanone ,
1-(1'3-benzothiazol-2-yl)-N-(5-chloro-2-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[2-fluoro-5-(trifluoromethyl)benzyl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[(4'-methoxybiphenyl-2-yl)methyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-methoxybenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[3-fluoro-5-(trifluoromethyl)benzyl]-N-methyl-1H-pyrazole-4- carboxamide
1-(1,3-benzothiazol-2-yl)-N-(biphenyl-2-ylmethyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2,4-difluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(4-chloro-3-fluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide , ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-[3-(trifluoromethyl)benzyl]- glycinate ,
1-(1'3-benzothiazol-2-yl)-N-[(3'-fluorobiphenyl-2-yl)methyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(4-chloro-3-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-cyclopropyl-N-(3-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[2-fluoro-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(2-methoxybenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-4-fluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[3-fluoro-5-(trifluoromethoxy)benzyl]-N-methyl-1H-pyrazole-4- carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(2,6-difluorobenzyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carbox- amide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-2-fluorobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-methyl-N-[3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[4-fluoro-2-(trifluoromethoxy)benzyl]-N-methyl-1H-pyrazole-4-
carboxamide ,
[1-(1'3-benzothiazol-2-yl)-1H-pyrazol-4-yl] (3;4-dihydroisoquinolin-2(lH)-yl)methanone ,
1-(1'3-benzothiazol-2-yl)-N-(3-fluorobenzyl)-N-(2;2;2-trifluoroethyl)-1H-pyrazole-4-carbox- amide ,
1-(1'3-benzothiazol-2-yl)-N-(2;4-difluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide , ethyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-[3,5-bis(trifluoromethyl)benzyl]- glycinate ,
1-(1'3-benzothiazol-2-yl)-N-(5-chloro-2-fluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(2;6-difluorobenzyl)-N-(2-methoxyethyl)-1H-pyrazole-4-carbox- amide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chlorobenzyl)-N-cyclopropyl-1H-pyrazole-4-carboxamide , N-(2-aminobenzyl)-1-(1'3-benzothiazol-2-yl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3-chlorobenzyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carbox- amide ,
1-(1,3-benzothiazol-2-yl)-N-(3-fluoro-5-methyl benzyl )-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(3-hydroxybenzyl)-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-(3-chloro-2-fluorobenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-cyclopropyl-N-(2;6-difluorobenzyl)-1H-pyrazole-4-carboxamide , N-[3;5-bis(trifluoromethyl)benzyl]-l-(5-methoxy-l;3-benzothiazol-2-yl)-1H-pyrazole-4-carbox- amide ,
1-(1,3-benzothiazol-2-yl)-N-[2-(methoxymethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1'3-benzothiazol-2-yl)-N-[(4'-methylbiphenyl-2-yl)methyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[2-(benzyloxy)benzyl]-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-ethyl-N-[3-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[4-fluoro-3-(trifluoromethoxy)benzyl]-N-methyl-1H-pyrazole-4- carboxamide ,
N-[3,5-bis(trifluoromethyl)benzyl]-l-(5-fluoro-l,3-benzothiazol-2-yl)-1H-pyrazole-4-carbox- amide ,
1-(1'3-benzothiazol-2-yl)-N-(2-fluoro-5-methylbenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(2-nitrobenzyl)-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-[3-methoxy-5-(trifluoromethyl)benzyl]-1H-pyrazole-4-carboxamide , methyl N-{[1-(1,3-benzothiazol-2-yl)-1H-pyrazol-4-yl]carbonyl}-N-[3,5-bis(trifluoromethyl)- benzyl]glycinate ,
1-(1,3-benzothiazol-2-yl)-N-[2-(methoxymethyl)benzyl]-N-methyl-1H-pyrazole-4-carboxamid ,
1-(1,3-benzothiazol-2-yl)-N-(2-fluoro-3-methyl benzyl )-N-methyl-1H-pyrazole-4-carboxamide ,
1-(1,3-benzothiazol-2-yl)-N-(2-ethoxybenzyl)-N-methyl-1H-pyrazole-4-carboxamide ,
N-[3;5-bis(trifluoromethyl)benzyl]-l-(4-methyl-l;3-benzothiazol-2-yl)-1H-pyrazole-4-carbox- amide , and
1-(1,3-benzothiazol-2-yl)-N-[3-(difluoromethoxy)benzyl]-1H-pyrazole-4-carboxamide , or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, or a mixture of same.
4. A method of preparing a compound of general formula (I) according to any one of claims 1, 2 or 3, said method comprising the step of allowing a compound of general formula (V) :
(V) in which R8 and R9 are as defined for the compounds of general formula (I) according to any one of claims 1, 2 or 3,
to react with a compound of general formula (VI) :
H
R'°
(VI) in which R1 and R10 are are as defined for the compounds of general formula (I) according to any one of claims 1, 2 or 3, or a salt thereof, such as for example a salt with hydrochloric acid, in the presence of a tertiary aliphatic amine, such as Ν,Ν-diisopropylethylamine, and propane phosphonic acid anhydride,
(I)
in which R1, R8, R9 and R10 are as defined for the compounds of general formula (I) according to any one of claims 1, 2 or 3.
5. A compound of general formula (I), or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, according to any one of claims 1, 2 or 3, for use in the treatment or prophylaxis of a disease.
6. A pharmaceutical composition comprising a compound of general formula (I), or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, according to any one of claims 1, 2 or 3, and a pharmaceutically acceptable diluent or carrier.
7. A pharmaceutical combination comprising :
one or more first active ingredients selected from a compound of general formula (I) according to any of claims 1, 2 or 3, and
one or more second active ingredients selected from chemotherapeutic anti-cancer agents.
8. Use of a compound of general formula (I), or a racemate, tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, according to any one of claims 1, 2 or 3, for the prophylaxis or treatment of a disease.
9. Use of a compound of general formula (I), or a racemate, a tautomer, an N-oxide, a hydrate, a solvate, or a salt thereof, particularly a pharmaceutically acceptable salt thereof, or a mixture of same, according to any one of claims 1, 2 or 3, for the preparation of a medicament for the prophylaxis or treatment of a disease.
10. Use according to claim 5, 8 or 9, wherein said disease is a disease of uncontrolled cell growth, proliferation and/or survival, an undesirable cellular immune response, or an undesirable cellular inflammatory response, particu larly in which the disease of uncontrolled cell growth, proliferation and/or survival, undesirable cellular immune response, or undesirable
cellular inflammatory response is a haematological tumour, a solid tumour and/or metastases thereof, e.g. leukaemias and myelodysplastic syndrome, malignant lymphomas, head and neck tumours including brain tumours and brain metastases, tumours of the thorax including non- small cell and small cell lung tumours, gastrointestinal tumours, endocrine tumours, mammary and other gynaecological tumours, urological tumours including renal, bladder and prostate tumours, skin tumours, and sarcomas, and/or metastases thereof.
11. Use of a compound of general formula (V) :
(V)
in which R8 and R9 are as defined for the compounds of general formula (I) according to any one of claims 1, 2 or 3,
for the preparation of a compound of general formula (I) according to any one of claims 1, 2 or 3.
12. Use of a compound of general formula (VI)
in which R1 and R10 are are as defined for the compounds of general formula (I) according to any one of claims 1 to 3, or a salt thereof, such as for example a salt with hydrochloric acid, for the preparation of a compound of general formula (I) according to any one of claims 1, 2 or
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201562240687P | 2015-10-13 | 2015-10-13 | |
US62/240,687 | 2015-10-13 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2017063966A1 true WO2017063966A1 (en) | 2017-04-20 |
Family
ID=57113357
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/EP2016/074122 WO2017063966A1 (en) | 2015-10-13 | 2016-10-10 | Substituted 2-(1h-pyrazol-1-yl)-benzothiazole compounds |
Country Status (1)
Country | Link |
---|---|
WO (1) | WO2017063966A1 (en) |
Cited By (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US10287353B2 (en) | 2016-05-11 | 2019-05-14 | Huya Bioscience International, Llc | Combination therapies of HDAC inhibitors and PD-1 inhibitors |
US10385131B2 (en) | 2016-05-11 | 2019-08-20 | Huya Bioscience International, Llc | Combination therapies of HDAC inhibitors and PD-L1 inhibitors |
CN115181250A (en) * | 2022-08-10 | 2022-10-14 | 烟台九目化学股份有限公司 | Side chain imidazole functionalized polymer and preparation method and application thereof |
Citations (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5011472A (en) | 1988-09-06 | 1991-04-30 | Brown University Research Foundation | Implantable delivery system for biological factors |
US5023252A (en) | 1985-12-04 | 1991-06-11 | Conrex Pharmaceutical Corporation | Transdermal and trans-membrane delivery of drugs |
WO2003037274A2 (en) | 2001-11-01 | 2003-05-08 | Icagen, Inc. | Pyrazole-amides and-sulfonamides |
WO2005095386A1 (en) * | 2004-03-30 | 2005-10-13 | Chiron Corporation | Substituted thiophene derivatives as anti-cancer agents |
WO2008126899A1 (en) | 2007-04-11 | 2008-10-23 | Kissei Pharmaceutical Co., Ltd. | 5-membered heterocyclic derivative and use thereof for medical purposes |
WO2011126903A2 (en) | 2010-03-30 | 2011-10-13 | Verseon, Inc. | Multisubstituted aromatic compounds as inhibitors of thrombin |
WO2012080729A2 (en) | 2010-12-14 | 2012-06-21 | Electrophoretics Limited | CASEIN KINASE 1δ (CK1δ) INHIBITORS |
WO2012112363A1 (en) | 2011-02-14 | 2012-08-23 | Merck Sharp & Dohme Corp. | Cathepsin cysteine protease inhibitors |
WO2013070659A1 (en) | 2011-11-07 | 2013-05-16 | Sunovion Pharmaceuticals Inc. | Modulators of opioid receptors and methods of use thereof |
-
2016
- 2016-10-10 WO PCT/EP2016/074122 patent/WO2017063966A1/en active Application Filing
Patent Citations (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5023252A (en) | 1985-12-04 | 1991-06-11 | Conrex Pharmaceutical Corporation | Transdermal and trans-membrane delivery of drugs |
US5011472A (en) | 1988-09-06 | 1991-04-30 | Brown University Research Foundation | Implantable delivery system for biological factors |
WO2003037274A2 (en) | 2001-11-01 | 2003-05-08 | Icagen, Inc. | Pyrazole-amides and-sulfonamides |
WO2005095386A1 (en) * | 2004-03-30 | 2005-10-13 | Chiron Corporation | Substituted thiophene derivatives as anti-cancer agents |
WO2008126899A1 (en) | 2007-04-11 | 2008-10-23 | Kissei Pharmaceutical Co., Ltd. | 5-membered heterocyclic derivative and use thereof for medical purposes |
WO2011126903A2 (en) | 2010-03-30 | 2011-10-13 | Verseon, Inc. | Multisubstituted aromatic compounds as inhibitors of thrombin |
WO2012080729A2 (en) | 2010-12-14 | 2012-06-21 | Electrophoretics Limited | CASEIN KINASE 1δ (CK1δ) INHIBITORS |
WO2012112363A1 (en) | 2011-02-14 | 2012-08-23 | Merck Sharp & Dohme Corp. | Cathepsin cysteine protease inhibitors |
WO2013070659A1 (en) | 2011-11-07 | 2013-05-16 | Sunovion Pharmaceuticals Inc. | Modulators of opioid receptors and methods of use thereof |
Non-Patent Citations (24)
Title |
---|
"Citation of NMR Peaklist Data within Patent Applications", RESEARCH DISCLOSURE DATABASE NUMBER 605005, 1 August 2014 (2014-08-01), Retrieved from the Internet <URL:http://www.researchdisclosure.com/searching-disclosures> |
"Isotopic Compositions of the Elements 1997", PURE APPL. CHEM., vol. 70, no. 1, 1998, pages 217 - 235 |
A. E. MUTLIB ET AL., TOXICOL. APPL. PHARMACOL., vol. 169, 2000, pages 102 |
A. M. SHARMA ET AL., CHEM. RES. TOXICOL., vol. 26, 2013, pages 410 |
AIELLO ET AL., NEW ENGL. J. MED., vol. 331, 1994, pages 1480 |
B. TESTA ET AL., INT. J. PHARM., vol. 19, no. 3, 1984, pages 271 |
C. J. WENTHUR ET AL., J. MED. CHEM., vol. 56, 2013, pages 5208 |
C. L. PERRIN ET AL., J. AM. CHEM. SOC., vol. 127, 2005, pages 9641 |
C. L. PERRIN ET AL., J. AM. CHEM. SOC., vol. 129, 2007, pages 4490 |
F. SCHNEIDER ET AL., ARZNEIM. FORSCH. / DRUG. RES., vol. 56, 2006, pages 295 |
FRIEDRICH J.: "Spheroid-based drug screen: considerations and practical approach", NAT. PROTOC., vol. 4, 2009, pages 309 - 324, XP055150985, DOI: doi:10.1038/nprot.2008.226 |
IUPAC RULES SECTION E (PURE APPL CHEM, vol. 45, 1976, pages 11 - 30 |
LOPEZ ET AL., INVEST. OPTHTHALMOL. VIS. SCI., vol. 37, 1996, pages 855 |
MINCHINTON IA; TANNOCK IF: "Drug penetration in solid tumours", NATURE REVIEWS CANCER, vol. 6, August 2006 (2006-08-01), pages 583 - 592 |
NEMA, S. ET AL.: "Excipients and Their Use in Injectable Products", PDA JOURNAL OF PHARMACEUTICAL SCIENCE & TECHNOLOGY, vol. 51, no. 4, 1997, pages 166 - 171 |
PEER ET AL., LAB. INVEST., vol. 72, 1995, pages 638 |
PORTER J ET AL: "Tetrahydroisoquinoline amide substituted phenyl pyrazoles as selective Bcl-2 inhibitors", BIOORGANIC & MEDICINAL CHEMISTRY LETTERS, PERGAMON, AMSTERDAM, NL, vol. 19, no. 1, 1 January 2009 (2009-01-01), pages 230 - 233, XP025816913, ISSN: 0960-894X, [retrieved on 20081031], DOI: 10.1016/J.BMCL.2008.10.113 * |
POWELL, M.F. ET AL.: "Compendium of Excipients for Parenteral Formulations", PDA JOURNAL OF PHARMACEUTICAL SCIENCE & TECHNOLOGY, vol. 52, no. 5, 1998, pages 238 - 311, XP009119027 |
S. M. BERGE ET AL.: "Pharmaceutical Salts", J. PHARM. SCI., vol. 66, 1977, pages 1 - 19, XP002675560, DOI: doi:10.1002/jps.2600660104 |
STRICKLEY, R.G: "Parenteral Formulations of Small Molecule Therapeutics Marketed in the United States (1999)-Part-1", PDA JOURNAL OF PHARMACEUTICAL SCIENCE & TECHNOLOGY, vol. 53, no. 6, 1999, pages 324 - 349 |
T.W. GREENE; P.G.M. WUTS: "Protective Groups in Organic Synthesis", 1999, WILEY |
TELAPREVIR: F. MALTAIS ET AL., J. MED. CHEM., vol. 52, 2009, pages 7993 |
VILLALBA M: "Chemical Metabolic Inhibitors for the Treatment of Blood-Borne Cancers", ANTI-CANCER AGENTS IN MEDICINAL CHEMISTRY, vol. 14, 2014, pages 223 - 232, XP008174000, DOI: doi:10.2174/18715206113136660374 |
WENZEL CW.: "3D high-content screening for the identification of compounds that target cells in dormant tumor spheroid regions", EXPERIMENTAL CELL RESEARCH, vol. 323, 2014, pages 131 - 143, XP055303442, DOI: doi:10.1016/j.yexcr.2014.01.017 |
Cited By (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US10287353B2 (en) | 2016-05-11 | 2019-05-14 | Huya Bioscience International, Llc | Combination therapies of HDAC inhibitors and PD-1 inhibitors |
US10385130B2 (en) | 2016-05-11 | 2019-08-20 | Huya Bioscience International, Llc | Combination therapies of HDAC inhibitors and PD-1 inhibitors |
US10385131B2 (en) | 2016-05-11 | 2019-08-20 | Huya Bioscience International, Llc | Combination therapies of HDAC inhibitors and PD-L1 inhibitors |
US11535670B2 (en) | 2016-05-11 | 2022-12-27 | Huyabio International, Llc | Combination therapies of HDAC inhibitors and PD-L1 inhibitors |
CN115181250A (en) * | 2022-08-10 | 2022-10-14 | 烟台九目化学股份有限公司 | Side chain imidazole functionalized polymer and preparation method and application thereof |
CN115181250B (en) * | 2022-08-10 | 2023-07-04 | 烟台九目化学股份有限公司 | Side chain imidazole functionalized polymer and preparation method and application thereof |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP3322694B1 (en) | 5-hydroxyalkylbenzimidazoles as midh1 inhibitors | |
EP3325451B1 (en) | Fused imidazoles as midh1 inhibitors | |
EP3319945B1 (en) | 2-aryl- and 2-arylalkyl-benzimidazoles as midh1 inhibitors | |
EP3303302B1 (en) | N-menthylbenzimidazoles as midh1 inhibitors | |
EP3209646B1 (en) | Benzimidazol-2-amines as midh1 inhibitors | |
US10137110B2 (en) | 1-cyclohexyl-2-phenylaminobenzimidazoles as mIDH1 inhibitors for the treatment of tumors | |
AU2016257302A1 (en) | Amido-substituted cyclohexane derivatives | |
WO2017055313A1 (en) | Amido-substituted azole compounds | |
WO2017055316A1 (en) | Amido-substituted azole compounds | |
WO2016202758A1 (en) | Substituted 2-(1h-pyrazol-1-yl)-1h-benzimidazole compounds | |
WO2017063966A1 (en) | Substituted 2-(1h-pyrazol-1-yl)-benzothiazole compounds | |
WO2016202756A1 (en) | Substituted 2-(1h-pyrazol-1-yl)-1h-benzimidazole compounds | |
WO2016202759A1 (en) | Cytotoxic substituted 2-(1 h-pyrazol-1 -yl)-1,3-benzothiazole compounds for the treatment of cancer | |
WO2024079252A1 (en) | Sos1 inhibitors | |
WO2018087126A1 (en) | Amido-substituted cyclohexane derivatives as inhibitors of tankyrase | |
WO2018078009A1 (en) | Amido-substituted cyclohexane derivatives |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 16778395 Country of ref document: EP Kind code of ref document: A1 |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
122 | Ep: pct application non-entry in european phase |
Ref document number: 16778395 Country of ref document: EP Kind code of ref document: A1 |